WebHostal/war/js/materialize.js

10022 lines
359 KiB
JavaScript
Raw Permalink Blame History

This file contains ambiguous Unicode characters!

This file contains ambiguous Unicode characters that may be confused with others in your current locale. If your use case is intentional and legitimate, you can safely ignore this warning. Use the Escape button to highlight these characters.

/*!
* Materialize v0.100.2 (http://materializecss.com)
* Copyright 2014-2017 Materialize
* MIT License (https://raw.githubusercontent.com/Dogfalo/materialize/master/LICENSE)
*/
var _createClass = function () { function defineProperties(target, props) { for (var i = 0; i < props.length; i++) { var descriptor = props[i]; descriptor.enumerable = descriptor.enumerable || false; descriptor.configurable = true; if ("value" in descriptor) descriptor.writable = true; Object.defineProperty(target, descriptor.key, descriptor); } } return function (Constructor, protoProps, staticProps) { if (protoProps) defineProperties(Constructor.prototype, protoProps); if (staticProps) defineProperties(Constructor, staticProps); return Constructor; }; }();
function _classCallCheck(instance, Constructor) { if (!(instance instanceof Constructor)) { throw new TypeError("Cannot call a class as a function"); } }
// Check for jQuery.
if (typeof jQuery === 'undefined') {
// Check if require is a defined function.
if (typeof require === 'function') {
jQuery = $ = require('jquery');
// Else use the dollar sign alias.
} else {
jQuery = $;
}
}
; /*
* jQuery Easing v1.4.0 - http://gsgd.co.uk/sandbox/jquery/easing/
* Open source under the BSD License.
* Copyright © 2008 George McGinley Smith
* All rights reserved.
* https://raw.github.com/gdsmith/jquery-easing/master/LICENSE
*/
(function (factory) {
if (typeof define === "function" && define.amd) {
define(['jquery'], function ($) {
return factory($);
});
} else if (typeof module === "object" && typeof module.exports === "object") {
exports = factory(require('jquery'));
} else {
factory(jQuery);
}
})(function ($) {
// Preserve the original jQuery "swing" easing as "jswing"
$.easing['jswing'] = $.easing['swing'];
var pow = Math.pow,
sqrt = Math.sqrt,
sin = Math.sin,
cos = Math.cos,
PI = Math.PI,
c1 = 1.70158,
c2 = c1 * 1.525,
c3 = c1 + 1,
c4 = 2 * PI / 3,
c5 = 2 * PI / 4.5;
// x is the fraction of animation progress, in the range 0..1
function bounceOut(x) {
var n1 = 7.5625,
d1 = 2.75;
if (x < 1 / d1) {
return n1 * x * x;
} else if (x < 2 / d1) {
return n1 * (x -= 1.5 / d1) * x + .75;
} else if (x < 2.5 / d1) {
return n1 * (x -= 2.25 / d1) * x + .9375;
} else {
return n1 * (x -= 2.625 / d1) * x + .984375;
}
}
$.extend($.easing, {
def: 'easeOutQuad',
swing: function (x) {
return $.easing[$.easing.def](x);
},
easeInQuad: function (x) {
return x * x;
},
easeOutQuad: function (x) {
return 1 - (1 - x) * (1 - x);
},
easeInOutQuad: function (x) {
return x < 0.5 ? 2 * x * x : 1 - pow(-2 * x + 2, 2) / 2;
},
easeInCubic: function (x) {
return x * x * x;
},
easeOutCubic: function (x) {
return 1 - pow(1 - x, 3);
},
easeInOutCubic: function (x) {
return x < 0.5 ? 4 * x * x * x : 1 - pow(-2 * x + 2, 3) / 2;
},
easeInQuart: function (x) {
return x * x * x * x;
},
easeOutQuart: function (x) {
return 1 - pow(1 - x, 4);
},
easeInOutQuart: function (x) {
return x < 0.5 ? 8 * x * x * x * x : 1 - pow(-2 * x + 2, 4) / 2;
},
easeInQuint: function (x) {
return x * x * x * x * x;
},
easeOutQuint: function (x) {
return 1 - pow(1 - x, 5);
},
easeInOutQuint: function (x) {
return x < 0.5 ? 16 * x * x * x * x * x : 1 - pow(-2 * x + 2, 5) / 2;
},
easeInSine: function (x) {
return 1 - cos(x * PI / 2);
},
easeOutSine: function (x) {
return sin(x * PI / 2);
},
easeInOutSine: function (x) {
return -(cos(PI * x) - 1) / 2;
},
easeInExpo: function (x) {
return x === 0 ? 0 : pow(2, 10 * x - 10);
},
easeOutExpo: function (x) {
return x === 1 ? 1 : 1 - pow(2, -10 * x);
},
easeInOutExpo: function (x) {
return x === 0 ? 0 : x === 1 ? 1 : x < 0.5 ? pow(2, 20 * x - 10) / 2 : (2 - pow(2, -20 * x + 10)) / 2;
},
easeInCirc: function (x) {
return 1 - sqrt(1 - pow(x, 2));
},
easeOutCirc: function (x) {
return sqrt(1 - pow(x - 1, 2));
},
easeInOutCirc: function (x) {
return x < 0.5 ? (1 - sqrt(1 - pow(2 * x, 2))) / 2 : (sqrt(1 - pow(-2 * x + 2, 2)) + 1) / 2;
},
easeInElastic: function (x) {
return x === 0 ? 0 : x === 1 ? 1 : -pow(2, 10 * x - 10) * sin((x * 10 - 10.75) * c4);
},
easeOutElastic: function (x) {
return x === 0 ? 0 : x === 1 ? 1 : pow(2, -10 * x) * sin((x * 10 - 0.75) * c4) + 1;
},
easeInOutElastic: function (x) {
return x === 0 ? 0 : x === 1 ? 1 : x < 0.5 ? -(pow(2, 20 * x - 10) * sin((20 * x - 11.125) * c5)) / 2 : pow(2, -20 * x + 10) * sin((20 * x - 11.125) * c5) / 2 + 1;
},
easeInBack: function (x) {
return c3 * x * x * x - c1 * x * x;
},
easeOutBack: function (x) {
return 1 + c3 * pow(x - 1, 3) + c1 * pow(x - 1, 2);
},
easeInOutBack: function (x) {
return x < 0.5 ? pow(2 * x, 2) * ((c2 + 1) * 2 * x - c2) / 2 : (pow(2 * x - 2, 2) * ((c2 + 1) * (x * 2 - 2) + c2) + 2) / 2;
},
easeInBounce: function (x) {
return 1 - bounceOut(1 - x);
},
easeOutBounce: bounceOut,
easeInOutBounce: function (x) {
return x < 0.5 ? (1 - bounceOut(1 - 2 * x)) / 2 : (1 + bounceOut(2 * x - 1)) / 2;
}
});
});; // Custom Easing
jQuery.extend(jQuery.easing, {
easeInOutMaterial: function (x, t, b, c, d) {
if ((t /= d / 2) < 1) return c / 2 * t * t + b;
return c / 4 * ((t -= 2) * t * t + 2) + b;
}
});; /*! VelocityJS.org (1.2.3). (C) 2014 Julian Shapiro. MIT @license: en.wikipedia.org/wiki/MIT_License */
/*! VelocityJS.org jQuery Shim (1.0.1). (C) 2014 The jQuery Foundation. MIT @license: en.wikipedia.org/wiki/MIT_License. */
/*! Note that this has been modified by Materialize to confirm that Velocity is not already being imported. */
jQuery.Velocity ? console.log("Velocity is already loaded. You may be needlessly importing Velocity again; note that Materialize includes Velocity.") : (!function (e) {
function t(e) {
var t = e.length,
a = r.type(e);return "function" === a || r.isWindow(e) ? !1 : 1 === e.nodeType && t ? !0 : "array" === a || 0 === t || "number" == typeof t && t > 0 && t - 1 in e;
}if (!e.jQuery) {
var r = function (e, t) {
return new r.fn.init(e, t);
};r.isWindow = function (e) {
return null != e && e == e.window;
}, r.type = function (e) {
return null == e ? e + "" : "object" == typeof e || "function" == typeof e ? n[i.call(e)] || "object" : typeof e;
}, r.isArray = Array.isArray || function (e) {
return "array" === r.type(e);
}, r.isPlainObject = function (e) {
var t;if (!e || "object" !== r.type(e) || e.nodeType || r.isWindow(e)) return !1;try {
if (e.constructor && !o.call(e, "constructor") && !o.call(e.constructor.prototype, "isPrototypeOf")) return !1;
} catch (a) {
return !1;
}for (t in e) {}return void 0 === t || o.call(e, t);
}, r.each = function (e, r, a) {
var n,
o = 0,
i = e.length,
s = t(e);if (a) {
if (s) for (; i > o && (n = r.apply(e[o], a), n !== !1); o++) {} else for (o in e) {
if (n = r.apply(e[o], a), n === !1) break;
}
} else if (s) for (; i > o && (n = r.call(e[o], o, e[o]), n !== !1); o++) {} else for (o in e) {
if (n = r.call(e[o], o, e[o]), n === !1) break;
}return e;
}, r.data = function (e, t, n) {
if (void 0 === n) {
var o = e[r.expando],
i = o && a[o];if (void 0 === t) return i;if (i && t in i) return i[t];
} else if (void 0 !== t) {
var o = e[r.expando] || (e[r.expando] = ++r.uuid);return a[o] = a[o] || {}, a[o][t] = n, n;
}
}, r.removeData = function (e, t) {
var n = e[r.expando],
o = n && a[n];o && r.each(t, function (e, t) {
delete o[t];
});
}, r.extend = function () {
var e,
t,
a,
n,
o,
i,
s = arguments[0] || {},
l = 1,
u = arguments.length,
c = !1;for ("boolean" == typeof s && (c = s, s = arguments[l] || {}, l++), "object" != typeof s && "function" !== r.type(s) && (s = {}), l === u && (s = this, l--); u > l; l++) {
if (null != (o = arguments[l])) for (n in o) {
e = s[n], a = o[n], s !== a && (c && a && (r.isPlainObject(a) || (t = r.isArray(a))) ? (t ? (t = !1, i = e && r.isArray(e) ? e : []) : i = e && r.isPlainObject(e) ? e : {}, s[n] = r.extend(c, i, a)) : void 0 !== a && (s[n] = a));
}
}return s;
}, r.queue = function (e, a, n) {
function o(e, r) {
var a = r || [];return null != e && (t(Object(e)) ? !function (e, t) {
for (var r = +t.length, a = 0, n = e.length; r > a;) {
e[n++] = t[a++];
}if (r !== r) for (; void 0 !== t[a];) {
e[n++] = t[a++];
}return e.length = n, e;
}(a, "string" == typeof e ? [e] : e) : [].push.call(a, e)), a;
}if (e) {
a = (a || "fx") + "queue";var i = r.data(e, a);return n ? (!i || r.isArray(n) ? i = r.data(e, a, o(n)) : i.push(n), i) : i || [];
}
}, r.dequeue = function (e, t) {
r.each(e.nodeType ? [e] : e, function (e, a) {
t = t || "fx";var n = r.queue(a, t),
o = n.shift();"inprogress" === o && (o = n.shift()), o && ("fx" === t && n.unshift("inprogress"), o.call(a, function () {
r.dequeue(a, t);
}));
});
}, r.fn = r.prototype = { init: function (e) {
if (e.nodeType) return this[0] = e, this;throw new Error("Not a DOM node.");
}, offset: function () {
var t = this[0].getBoundingClientRect ? this[0].getBoundingClientRect() : { top: 0, left: 0 };return { top: t.top + (e.pageYOffset || document.scrollTop || 0) - (document.clientTop || 0), left: t.left + (e.pageXOffset || document.scrollLeft || 0) - (document.clientLeft || 0) };
}, position: function () {
function e() {
for (var e = this.offsetParent || document; e && "html" === !e.nodeType.toLowerCase && "static" === e.style.position;) {
e = e.offsetParent;
}return e || document;
}var t = this[0],
e = e.apply(t),
a = this.offset(),
n = /^(?:body|html)$/i.test(e.nodeName) ? { top: 0, left: 0 } : r(e).offset();return a.top -= parseFloat(t.style.marginTop) || 0, a.left -= parseFloat(t.style.marginLeft) || 0, e.style && (n.top += parseFloat(e.style.borderTopWidth) || 0, n.left += parseFloat(e.style.borderLeftWidth) || 0), { top: a.top - n.top, left: a.left - n.left };
} };var a = {};r.expando = "velocity" + new Date().getTime(), r.uuid = 0;for (var n = {}, o = n.hasOwnProperty, i = n.toString, s = "Boolean Number String Function Array Date RegExp Object Error".split(" "), l = 0; l < s.length; l++) {
n["[object " + s[l] + "]"] = s[l].toLowerCase();
}r.fn.init.prototype = r.fn, e.Velocity = { Utilities: r };
}
}(window), function (e) {
"object" == typeof module && "object" == typeof module.exports ? module.exports = e() : "function" == typeof define && define.amd ? define(e) : e();
}(function () {
return function (e, t, r, a) {
function n(e) {
for (var t = -1, r = e ? e.length : 0, a = []; ++t < r;) {
var n = e[t];n && a.push(n);
}return a;
}function o(e) {
return m.isWrapped(e) ? e = [].slice.call(e) : m.isNode(e) && (e = [e]), e;
}function i(e) {
var t = f.data(e, "velocity");return null === t ? a : t;
}function s(e) {
return function (t) {
return Math.round(t * e) * (1 / e);
};
}function l(e, r, a, n) {
function o(e, t) {
return 1 - 3 * t + 3 * e;
}function i(e, t) {
return 3 * t - 6 * e;
}function s(e) {
return 3 * e;
}function l(e, t, r) {
return ((o(t, r) * e + i(t, r)) * e + s(t)) * e;
}function u(e, t, r) {
return 3 * o(t, r) * e * e + 2 * i(t, r) * e + s(t);
}function c(t, r) {
for (var n = 0; m > n; ++n) {
var o = u(r, e, a);if (0 === o) return r;var i = l(r, e, a) - t;r -= i / o;
}return r;
}function p() {
for (var t = 0; b > t; ++t) {
w[t] = l(t * x, e, a);
}
}function f(t, r, n) {
var o,
i,
s = 0;do {
i = r + (n - r) / 2, o = l(i, e, a) - t, o > 0 ? n = i : r = i;
} while (Math.abs(o) > h && ++s < v);return i;
}function d(t) {
for (var r = 0, n = 1, o = b - 1; n != o && w[n] <= t; ++n) {
r += x;
}--n;var i = (t - w[n]) / (w[n + 1] - w[n]),
s = r + i * x,
l = u(s, e, a);return l >= y ? c(t, s) : 0 == l ? s : f(t, r, r + x);
}function g() {
V = !0, (e != r || a != n) && p();
}var m = 4,
y = .001,
h = 1e-7,
v = 10,
b = 11,
x = 1 / (b - 1),
S = "Float32Array" in t;if (4 !== arguments.length) return !1;for (var P = 0; 4 > P; ++P) {
if ("number" != typeof arguments[P] || isNaN(arguments[P]) || !isFinite(arguments[P])) return !1;
}e = Math.min(e, 1), a = Math.min(a, 1), e = Math.max(e, 0), a = Math.max(a, 0);var w = S ? new Float32Array(b) : new Array(b),
V = !1,
C = function (t) {
return V || g(), e === r && a === n ? t : 0 === t ? 0 : 1 === t ? 1 : l(d(t), r, n);
};C.getControlPoints = function () {
return [{ x: e, y: r }, { x: a, y: n }];
};var T = "generateBezier(" + [e, r, a, n] + ")";return C.toString = function () {
return T;
}, C;
}function u(e, t) {
var r = e;return m.isString(e) ? b.Easings[e] || (r = !1) : r = m.isArray(e) && 1 === e.length ? s.apply(null, e) : m.isArray(e) && 2 === e.length ? x.apply(null, e.concat([t])) : m.isArray(e) && 4 === e.length ? l.apply(null, e) : !1, r === !1 && (r = b.Easings[b.defaults.easing] ? b.defaults.easing : v), r;
}function c(e) {
if (e) {
var t = new Date().getTime(),
r = b.State.calls.length;r > 1e4 && (b.State.calls = n(b.State.calls));for (var o = 0; r > o; o++) {
if (b.State.calls[o]) {
var s = b.State.calls[o],
l = s[0],
u = s[2],
d = s[3],
g = !!d,
y = null;d || (d = b.State.calls[o][3] = t - 16);for (var h = Math.min((t - d) / u.duration, 1), v = 0, x = l.length; x > v; v++) {
var P = l[v],
V = P.element;if (i(V)) {
var C = !1;if (u.display !== a && null !== u.display && "none" !== u.display) {
if ("flex" === u.display) {
var T = ["-webkit-box", "-moz-box", "-ms-flexbox", "-webkit-flex"];f.each(T, function (e, t) {
S.setPropertyValue(V, "display", t);
});
}S.setPropertyValue(V, "display", u.display);
}u.visibility !== a && "hidden" !== u.visibility && S.setPropertyValue(V, "visibility", u.visibility);for (var k in P) {
if ("element" !== k) {
var A,
F = P[k],
j = m.isString(F.easing) ? b.Easings[F.easing] : F.easing;if (1 === h) A = F.endValue;else {
var E = F.endValue - F.startValue;if (A = F.startValue + E * j(h, u, E), !g && A === F.currentValue) continue;
}if (F.currentValue = A, "tween" === k) y = A;else {
if (S.Hooks.registered[k]) {
var H = S.Hooks.getRoot(k),
N = i(V).rootPropertyValueCache[H];N && (F.rootPropertyValue = N);
}var L = S.setPropertyValue(V, k, F.currentValue + (0 === parseFloat(A) ? "" : F.unitType), F.rootPropertyValue, F.scrollData);S.Hooks.registered[k] && (i(V).rootPropertyValueCache[H] = S.Normalizations.registered[H] ? S.Normalizations.registered[H]("extract", null, L[1]) : L[1]), "transform" === L[0] && (C = !0);
}
}
}u.mobileHA && i(V).transformCache.translate3d === a && (i(V).transformCache.translate3d = "(0px, 0px, 0px)", C = !0), C && S.flushTransformCache(V);
}
}u.display !== a && "none" !== u.display && (b.State.calls[o][2].display = !1), u.visibility !== a && "hidden" !== u.visibility && (b.State.calls[o][2].visibility = !1), u.progress && u.progress.call(s[1], s[1], h, Math.max(0, d + u.duration - t), d, y), 1 === h && p(o);
}
}
}b.State.isTicking && w(c);
}function p(e, t) {
if (!b.State.calls[e]) return !1;for (var r = b.State.calls[e][0], n = b.State.calls[e][1], o = b.State.calls[e][2], s = b.State.calls[e][4], l = !1, u = 0, c = r.length; c > u; u++) {
var p = r[u].element;if (t || o.loop || ("none" === o.display && S.setPropertyValue(p, "display", o.display), "hidden" === o.visibility && S.setPropertyValue(p, "visibility", o.visibility)), o.loop !== !0 && (f.queue(p)[1] === a || !/\.velocityQueueEntryFlag/i.test(f.queue(p)[1])) && i(p)) {
i(p).isAnimating = !1, i(p).rootPropertyValueCache = {};var d = !1;f.each(S.Lists.transforms3D, function (e, t) {
var r = /^scale/.test(t) ? 1 : 0,
n = i(p).transformCache[t];i(p).transformCache[t] !== a && new RegExp("^\\(" + r + "[^.]").test(n) && (d = !0, delete i(p).transformCache[t]);
}), o.mobileHA && (d = !0, delete i(p).transformCache.translate3d), d && S.flushTransformCache(p), S.Values.removeClass(p, "velocity-animating");
}if (!t && o.complete && !o.loop && u === c - 1) try {
o.complete.call(n, n);
} catch (g) {
setTimeout(function () {
throw g;
}, 1);
}s && o.loop !== !0 && s(n), i(p) && o.loop === !0 && !t && (f.each(i(p).tweensContainer, function (e, t) {
/^rotate/.test(e) && 360 === parseFloat(t.endValue) && (t.endValue = 0, t.startValue = 360), /^backgroundPosition/.test(e) && 100 === parseFloat(t.endValue) && "%" === t.unitType && (t.endValue = 0, t.startValue = 100);
}), b(p, "reverse", { loop: !0, delay: o.delay })), o.queue !== !1 && f.dequeue(p, o.queue);
}b.State.calls[e] = !1;for (var m = 0, y = b.State.calls.length; y > m; m++) {
if (b.State.calls[m] !== !1) {
l = !0;break;
}
}l === !1 && (b.State.isTicking = !1, delete b.State.calls, b.State.calls = []);
}var f,
d = function () {
if (r.documentMode) return r.documentMode;for (var e = 7; e > 4; e--) {
var t = r.createElement("div");if (t.innerHTML = "<!--[if IE " + e + "]><span></span><![endif]-->", t.getElementsByTagName("span").length) return t = null, e;
}return a;
}(),
g = function () {
var e = 0;return t.webkitRequestAnimationFrame || t.mozRequestAnimationFrame || function (t) {
var r,
a = new Date().getTime();return r = Math.max(0, 16 - (a - e)), e = a + r, setTimeout(function () {
t(a + r);
}, r);
};
}(),
m = { isString: function (e) {
return "string" == typeof e;
}, isArray: Array.isArray || function (e) {
return "[object Array]" === Object.prototype.toString.call(e);
}, isFunction: function (e) {
return "[object Function]" === Object.prototype.toString.call(e);
}, isNode: function (e) {
return e && e.nodeType;
}, isNodeList: function (e) {
return "object" == typeof e && /^\[object (HTMLCollection|NodeList|Object)\]$/.test(Object.prototype.toString.call(e)) && e.length !== a && (0 === e.length || "object" == typeof e[0] && e[0].nodeType > 0);
}, isWrapped: function (e) {
return e && (e.jquery || t.Zepto && t.Zepto.zepto.isZ(e));
}, isSVG: function (e) {
return t.SVGElement && e instanceof t.SVGElement;
}, isEmptyObject: function (e) {
for (var t in e) {
return !1;
}return !0;
} },
y = !1;if (e.fn && e.fn.jquery ? (f = e, y = !0) : f = t.Velocity.Utilities, 8 >= d && !y) throw new Error("Velocity: IE8 and below require jQuery to be loaded before Velocity.");if (7 >= d) return void (jQuery.fn.velocity = jQuery.fn.animate);var h = 400,
v = "swing",
b = { State: { isMobile: /Android|webOS|iPhone|iPad|iPod|BlackBerry|IEMobile|Opera Mini/i.test(navigator.userAgent), isAndroid: /Android/i.test(navigator.userAgent), isGingerbread: /Android 2\.3\.[3-7]/i.test(navigator.userAgent), isChrome: t.chrome, isFirefox: /Firefox/i.test(navigator.userAgent), prefixElement: r.createElement("div"), prefixMatches: {}, scrollAnchor: null, scrollPropertyLeft: null, scrollPropertyTop: null, isTicking: !1, calls: [] }, CSS: {}, Utilities: f, Redirects: {}, Easings: {}, Promise: t.Promise, defaults: { queue: "", duration: h, easing: v, begin: a, complete: a, progress: a, display: a, visibility: a, loop: !1, delay: !1, mobileHA: !0, _cacheValues: !0 }, init: function (e) {
f.data(e, "velocity", { isSVG: m.isSVG(e), isAnimating: !1, computedStyle: null, tweensContainer: null, rootPropertyValueCache: {}, transformCache: {} });
}, hook: null, mock: !1, version: { major: 1, minor: 2, patch: 2 }, debug: !1 };t.pageYOffset !== a ? (b.State.scrollAnchor = t, b.State.scrollPropertyLeft = "pageXOffset", b.State.scrollPropertyTop = "pageYOffset") : (b.State.scrollAnchor = r.documentElement || r.body.parentNode || r.body, b.State.scrollPropertyLeft = "scrollLeft", b.State.scrollPropertyTop = "scrollTop");var x = function () {
function e(e) {
return -e.tension * e.x - e.friction * e.v;
}function t(t, r, a) {
var n = { x: t.x + a.dx * r, v: t.v + a.dv * r, tension: t.tension, friction: t.friction };return { dx: n.v, dv: e(n) };
}function r(r, a) {
var n = { dx: r.v, dv: e(r) },
o = t(r, .5 * a, n),
i = t(r, .5 * a, o),
s = t(r, a, i),
l = 1 / 6 * (n.dx + 2 * (o.dx + i.dx) + s.dx),
u = 1 / 6 * (n.dv + 2 * (o.dv + i.dv) + s.dv);return r.x = r.x + l * a, r.v = r.v + u * a, r;
}return function a(e, t, n) {
var o,
i,
s,
l = { x: -1, v: 0, tension: null, friction: null },
u = [0],
c = 0,
p = 1e-4,
f = .016;for (e = parseFloat(e) || 500, t = parseFloat(t) || 20, n = n || null, l.tension = e, l.friction = t, o = null !== n, o ? (c = a(e, t), i = c / n * f) : i = f; s = r(s || l, i), u.push(1 + s.x), c += 16, Math.abs(s.x) > p && Math.abs(s.v) > p;) {}return o ? function (e) {
return u[e * (u.length - 1) | 0];
} : c;
};
}();b.Easings = { linear: function (e) {
return e;
}, swing: function (e) {
return .5 - Math.cos(e * Math.PI) / 2;
}, spring: function (e) {
return 1 - Math.cos(4.5 * e * Math.PI) * Math.exp(6 * -e);
} }, f.each([["ease", [.25, .1, .25, 1]], ["ease-in", [.42, 0, 1, 1]], ["ease-out", [0, 0, .58, 1]], ["ease-in-out", [.42, 0, .58, 1]], ["easeInSine", [.47, 0, .745, .715]], ["easeOutSine", [.39, .575, .565, 1]], ["easeInOutSine", [.445, .05, .55, .95]], ["easeInQuad", [.55, .085, .68, .53]], ["easeOutQuad", [.25, .46, .45, .94]], ["easeInOutQuad", [.455, .03, .515, .955]], ["easeInCubic", [.55, .055, .675, .19]], ["easeOutCubic", [.215, .61, .355, 1]], ["easeInOutCubic", [.645, .045, .355, 1]], ["easeInQuart", [.895, .03, .685, .22]], ["easeOutQuart", [.165, .84, .44, 1]], ["easeInOutQuart", [.77, 0, .175, 1]], ["easeInQuint", [.755, .05, .855, .06]], ["easeOutQuint", [.23, 1, .32, 1]], ["easeInOutQuint", [.86, 0, .07, 1]], ["easeInExpo", [.95, .05, .795, .035]], ["easeOutExpo", [.19, 1, .22, 1]], ["easeInOutExpo", [1, 0, 0, 1]], ["easeInCirc", [.6, .04, .98, .335]], ["easeOutCirc", [.075, .82, .165, 1]], ["easeInOutCirc", [.785, .135, .15, .86]]], function (e, t) {
b.Easings[t[0]] = l.apply(null, t[1]);
});var S = b.CSS = { RegEx: { isHex: /^#([A-f\d]{3}){1,2}$/i, valueUnwrap: /^[A-z]+\((.*)\)$/i, wrappedValueAlreadyExtracted: /[0-9.]+ [0-9.]+ [0-9.]+( [0-9.]+)?/, valueSplit: /([A-z]+\(.+\))|(([A-z0-9#-.]+?)(?=\s|$))/gi }, Lists: { colors: ["fill", "stroke", "stopColor", "color", "backgroundColor", "borderColor", "borderTopColor", "borderRightColor", "borderBottomColor", "borderLeftColor", "outlineColor"], transformsBase: ["translateX", "translateY", "scale", "scaleX", "scaleY", "skewX", "skewY", "rotateZ"], transforms3D: ["transformPerspective", "translateZ", "scaleZ", "rotateX", "rotateY"] }, Hooks: { templates: { textShadow: ["Color X Y Blur", "black 0px 0px 0px"], boxShadow: ["Color X Y Blur Spread", "black 0px 0px 0px 0px"], clip: ["Top Right Bottom Left", "0px 0px 0px 0px"], backgroundPosition: ["X Y", "0% 0%"], transformOrigin: ["X Y Z", "50% 50% 0px"], perspectiveOrigin: ["X Y", "50% 50%"] }, registered: {}, register: function () {
for (var e = 0; e < S.Lists.colors.length; e++) {
var t = "color" === S.Lists.colors[e] ? "0 0 0 1" : "255 255 255 1";S.Hooks.templates[S.Lists.colors[e]] = ["Red Green Blue Alpha", t];
}var r, a, n;if (d) for (r in S.Hooks.templates) {
a = S.Hooks.templates[r], n = a[0].split(" ");var o = a[1].match(S.RegEx.valueSplit);"Color" === n[0] && (n.push(n.shift()), o.push(o.shift()), S.Hooks.templates[r] = [n.join(" "), o.join(" ")]);
}for (r in S.Hooks.templates) {
a = S.Hooks.templates[r], n = a[0].split(" ");for (var e in n) {
var i = r + n[e],
s = e;S.Hooks.registered[i] = [r, s];
}
}
}, getRoot: function (e) {
var t = S.Hooks.registered[e];return t ? t[0] : e;
}, cleanRootPropertyValue: function (e, t) {
return S.RegEx.valueUnwrap.test(t) && (t = t.match(S.RegEx.valueUnwrap)[1]), S.Values.isCSSNullValue(t) && (t = S.Hooks.templates[e][1]), t;
}, extractValue: function (e, t) {
var r = S.Hooks.registered[e];if (r) {
var a = r[0],
n = r[1];return t = S.Hooks.cleanRootPropertyValue(a, t), t.toString().match(S.RegEx.valueSplit)[n];
}return t;
}, injectValue: function (e, t, r) {
var a = S.Hooks.registered[e];if (a) {
var n,
o,
i = a[0],
s = a[1];return r = S.Hooks.cleanRootPropertyValue(i, r), n = r.toString().match(S.RegEx.valueSplit), n[s] = t, o = n.join(" ");
}return r;
} }, Normalizations: { registered: { clip: function (e, t, r) {
switch (e) {case "name":
return "clip";case "extract":
var a;return S.RegEx.wrappedValueAlreadyExtracted.test(r) ? a = r : (a = r.toString().match(S.RegEx.valueUnwrap), a = a ? a[1].replace(/,(\s+)?/g, " ") : r), a;case "inject":
return "rect(" + r + ")";}
}, blur: function (e, t, r) {
switch (e) {case "name":
return b.State.isFirefox ? "filter" : "-webkit-filter";case "extract":
var a = parseFloat(r);if (!a && 0 !== a) {
var n = r.toString().match(/blur\(([0-9]+[A-z]+)\)/i);a = n ? n[1] : 0;
}return a;case "inject":
return parseFloat(r) ? "blur(" + r + ")" : "none";}
}, opacity: function (e, t, r) {
if (8 >= d) switch (e) {case "name":
return "filter";case "extract":
var a = r.toString().match(/alpha\(opacity=(.*)\)/i);return r = a ? a[1] / 100 : 1;case "inject":
return t.style.zoom = 1, parseFloat(r) >= 1 ? "" : "alpha(opacity=" + parseInt(100 * parseFloat(r), 10) + ")";} else switch (e) {case "name":
return "opacity";case "extract":
return r;case "inject":
return r;}
} }, register: function () {
9 >= d || b.State.isGingerbread || (S.Lists.transformsBase = S.Lists.transformsBase.concat(S.Lists.transforms3D));for (var e = 0; e < S.Lists.transformsBase.length; e++) {
!function () {
var t = S.Lists.transformsBase[e];S.Normalizations.registered[t] = function (e, r, n) {
switch (e) {case "name":
return "transform";case "extract":
return i(r) === a || i(r).transformCache[t] === a ? /^scale/i.test(t) ? 1 : 0 : i(r).transformCache[t].replace(/[()]/g, "");case "inject":
var o = !1;switch (t.substr(0, t.length - 1)) {case "translate":
o = !/(%|px|em|rem|vw|vh|\d)$/i.test(n);break;case "scal":case "scale":
b.State.isAndroid && i(r).transformCache[t] === a && 1 > n && (n = 1), o = !/(\d)$/i.test(n);break;case "skew":
o = !/(deg|\d)$/i.test(n);break;case "rotate":
o = !/(deg|\d)$/i.test(n);}return o || (i(r).transformCache[t] = "(" + n + ")"), i(r).transformCache[t];}
};
}();
}for (var e = 0; e < S.Lists.colors.length; e++) {
!function () {
var t = S.Lists.colors[e];S.Normalizations.registered[t] = function (e, r, n) {
switch (e) {case "name":
return t;case "extract":
var o;if (S.RegEx.wrappedValueAlreadyExtracted.test(n)) o = n;else {
var i,
s = { black: "rgb(0, 0, 0)", blue: "rgb(0, 0, 255)", gray: "rgb(128, 128, 128)", green: "rgb(0, 128, 0)", red: "rgb(255, 0, 0)", white: "rgb(255, 255, 255)" };/^[A-z]+$/i.test(n) ? i = s[n] !== a ? s[n] : s.black : S.RegEx.isHex.test(n) ? i = "rgb(" + S.Values.hexToRgb(n).join(" ") + ")" : /^rgba?\(/i.test(n) || (i = s.black), o = (i || n).toString().match(S.RegEx.valueUnwrap)[1].replace(/,(\s+)?/g, " ");
}return 8 >= d || 3 !== o.split(" ").length || (o += " 1"), o;case "inject":
return 8 >= d ? 4 === n.split(" ").length && (n = n.split(/\s+/).slice(0, 3).join(" ")) : 3 === n.split(" ").length && (n += " 1"), (8 >= d ? "rgb" : "rgba") + "(" + n.replace(/\s+/g, ",").replace(/\.(\d)+(?=,)/g, "") + ")";}
};
}();
}
} }, Names: { camelCase: function (e) {
return e.replace(/-(\w)/g, function (e, t) {
return t.toUpperCase();
});
}, SVGAttribute: function (e) {
var t = "width|height|x|y|cx|cy|r|rx|ry|x1|x2|y1|y2";return (d || b.State.isAndroid && !b.State.isChrome) && (t += "|transform"), new RegExp("^(" + t + ")$", "i").test(e);
}, prefixCheck: function (e) {
if (b.State.prefixMatches[e]) return [b.State.prefixMatches[e], !0];for (var t = ["", "Webkit", "Moz", "ms", "O"], r = 0, a = t.length; a > r; r++) {
var n;if (n = 0 === r ? e : t[r] + e.replace(/^\w/, function (e) {
return e.toUpperCase();
}), m.isString(b.State.prefixElement.style[n])) return b.State.prefixMatches[e] = n, [n, !0];
}return [e, !1];
} }, Values: { hexToRgb: function (e) {
var t,
r = /^#?([a-f\d])([a-f\d])([a-f\d])$/i,
a = /^#?([a-f\d]{2})([a-f\d]{2})([a-f\d]{2})$/i;return e = e.replace(r, function (e, t, r, a) {
return t + t + r + r + a + a;
}), t = a.exec(e), t ? [parseInt(t[1], 16), parseInt(t[2], 16), parseInt(t[3], 16)] : [0, 0, 0];
}, isCSSNullValue: function (e) {
return 0 == e || /^(none|auto|transparent|(rgba\(0, ?0, ?0, ?0\)))$/i.test(e);
}, getUnitType: function (e) {
return (/^(rotate|skew)/i.test(e) ? "deg" : /(^(scale|scaleX|scaleY|scaleZ|alpha|flexGrow|flexHeight|zIndex|fontWeight)$)|((opacity|red|green|blue|alpha)$)/i.test(e) ? "" : "px"
);
}, getDisplayType: function (e) {
var t = e && e.tagName.toString().toLowerCase();return (/^(b|big|i|small|tt|abbr|acronym|cite|code|dfn|em|kbd|strong|samp|var|a|bdo|br|img|map|object|q|script|span|sub|sup|button|input|label|select|textarea)$/i.test(t) ? "inline" : /^(li)$/i.test(t) ? "list-item" : /^(tr)$/i.test(t) ? "table-row" : /^(table)$/i.test(t) ? "table" : /^(tbody)$/i.test(t) ? "table-row-group" : "block"
);
}, addClass: function (e, t) {
e.classList ? e.classList.add(t) : e.className += (e.className.length ? " " : "") + t;
}, removeClass: function (e, t) {
e.classList ? e.classList.remove(t) : e.className = e.className.toString().replace(new RegExp("(^|\\s)" + t.split(" ").join("|") + "(\\s|$)", "gi"), " ");
} }, getPropertyValue: function (e, r, n, o) {
function s(e, r) {
function n() {
u && S.setPropertyValue(e, "display", "none");
}var l = 0;if (8 >= d) l = f.css(e, r);else {
var u = !1;if (/^(width|height)$/.test(r) && 0 === S.getPropertyValue(e, "display") && (u = !0, S.setPropertyValue(e, "display", S.Values.getDisplayType(e))), !o) {
if ("height" === r && "border-box" !== S.getPropertyValue(e, "boxSizing").toString().toLowerCase()) {
var c = e.offsetHeight - (parseFloat(S.getPropertyValue(e, "borderTopWidth")) || 0) - (parseFloat(S.getPropertyValue(e, "borderBottomWidth")) || 0) - (parseFloat(S.getPropertyValue(e, "paddingTop")) || 0) - (parseFloat(S.getPropertyValue(e, "paddingBottom")) || 0);return n(), c;
}if ("width" === r && "border-box" !== S.getPropertyValue(e, "boxSizing").toString().toLowerCase()) {
var p = e.offsetWidth - (parseFloat(S.getPropertyValue(e, "borderLeftWidth")) || 0) - (parseFloat(S.getPropertyValue(e, "borderRightWidth")) || 0) - (parseFloat(S.getPropertyValue(e, "paddingLeft")) || 0) - (parseFloat(S.getPropertyValue(e, "paddingRight")) || 0);return n(), p;
}
}var g;g = i(e) === a ? t.getComputedStyle(e, null) : i(e).computedStyle ? i(e).computedStyle : i(e).computedStyle = t.getComputedStyle(e, null), "borderColor" === r && (r = "borderTopColor"), l = 9 === d && "filter" === r ? g.getPropertyValue(r) : g[r], ("" === l || null === l) && (l = e.style[r]), n();
}if ("auto" === l && /^(top|right|bottom|left)$/i.test(r)) {
var m = s(e, "position");("fixed" === m || "absolute" === m && /top|left/i.test(r)) && (l = f(e).position()[r] + "px");
}return l;
}var l;if (S.Hooks.registered[r]) {
var u = r,
c = S.Hooks.getRoot(u);n === a && (n = S.getPropertyValue(e, S.Names.prefixCheck(c)[0])), S.Normalizations.registered[c] && (n = S.Normalizations.registered[c]("extract", e, n)), l = S.Hooks.extractValue(u, n);
} else if (S.Normalizations.registered[r]) {
var p, g;p = S.Normalizations.registered[r]("name", e), "transform" !== p && (g = s(e, S.Names.prefixCheck(p)[0]), S.Values.isCSSNullValue(g) && S.Hooks.templates[r] && (g = S.Hooks.templates[r][1])), l = S.Normalizations.registered[r]("extract", e, g);
}if (!/^[\d-]/.test(l)) if (i(e) && i(e).isSVG && S.Names.SVGAttribute(r)) {
if (/^(height|width)$/i.test(r)) try {
l = e.getBBox()[r];
} catch (m) {
l = 0;
} else l = e.getAttribute(r);
} else l = s(e, S.Names.prefixCheck(r)[0]);return S.Values.isCSSNullValue(l) && (l = 0), b.debug >= 2 && console.log("Get " + r + ": " + l), l;
}, setPropertyValue: function (e, r, a, n, o) {
var s = r;if ("scroll" === r) o.container ? o.container["scroll" + o.direction] = a : "Left" === o.direction ? t.scrollTo(a, o.alternateValue) : t.scrollTo(o.alternateValue, a);else if (S.Normalizations.registered[r] && "transform" === S.Normalizations.registered[r]("name", e)) S.Normalizations.registered[r]("inject", e, a), s = "transform", a = i(e).transformCache[r];else {
if (S.Hooks.registered[r]) {
var l = r,
u = S.Hooks.getRoot(r);n = n || S.getPropertyValue(e, u), a = S.Hooks.injectValue(l, a, n), r = u;
}if (S.Normalizations.registered[r] && (a = S.Normalizations.registered[r]("inject", e, a), r = S.Normalizations.registered[r]("name", e)), s = S.Names.prefixCheck(r)[0], 8 >= d) try {
e.style[s] = a;
} catch (c) {
b.debug && console.log("Browser does not support [" + a + "] for [" + s + "]");
} else i(e) && i(e).isSVG && S.Names.SVGAttribute(r) ? e.setAttribute(r, a) : e.style[s] = a;b.debug >= 2 && console.log("Set " + r + " (" + s + "): " + a);
}return [s, a];
}, flushTransformCache: function (e) {
function t(t) {
return parseFloat(S.getPropertyValue(e, t));
}var r = "";if ((d || b.State.isAndroid && !b.State.isChrome) && i(e).isSVG) {
var a = { translate: [t("translateX"), t("translateY")], skewX: [t("skewX")], skewY: [t("skewY")], scale: 1 !== t("scale") ? [t("scale"), t("scale")] : [t("scaleX"), t("scaleY")], rotate: [t("rotateZ"), 0, 0] };f.each(i(e).transformCache, function (e) {
/^translate/i.test(e) ? e = "translate" : /^scale/i.test(e) ? e = "scale" : /^rotate/i.test(e) && (e = "rotate"), a[e] && (r += e + "(" + a[e].join(" ") + ") ", delete a[e]);
});
} else {
var n, o;f.each(i(e).transformCache, function (t) {
return n = i(e).transformCache[t], "transformPerspective" === t ? (o = n, !0) : (9 === d && "rotateZ" === t && (t = "rotate"), void (r += t + n + " "));
}), o && (r = "perspective" + o + " " + r);
}S.setPropertyValue(e, "transform", r);
} };S.Hooks.register(), S.Normalizations.register(), b.hook = function (e, t, r) {
var n = a;return e = o(e), f.each(e, function (e, o) {
if (i(o) === a && b.init(o), r === a) n === a && (n = b.CSS.getPropertyValue(o, t));else {
var s = b.CSS.setPropertyValue(o, t, r);"transform" === s[0] && b.CSS.flushTransformCache(o), n = s;
}
}), n;
};var P = function () {
function e() {
return s ? k.promise || null : l;
}function n() {
function e(e) {
function p(e, t) {
var r = a,
n = a,
i = a;return m.isArray(e) ? (r = e[0], !m.isArray(e[1]) && /^[\d-]/.test(e[1]) || m.isFunction(e[1]) || S.RegEx.isHex.test(e[1]) ? i = e[1] : (m.isString(e[1]) && !S.RegEx.isHex.test(e[1]) || m.isArray(e[1])) && (n = t ? e[1] : u(e[1], s.duration), e[2] !== a && (i = e[2]))) : r = e, t || (n = n || s.easing), m.isFunction(r) && (r = r.call(o, V, w)), m.isFunction(i) && (i = i.call(o, V, w)), [r || 0, n, i];
}function d(e, t) {
var r, a;return a = (t || "0").toString().toLowerCase().replace(/[%A-z]+$/, function (e) {
return r = e, "";
}), r || (r = S.Values.getUnitType(e)), [a, r];
}function h() {
var e = { myParent: o.parentNode || r.body, position: S.getPropertyValue(o, "position"), fontSize: S.getPropertyValue(o, "fontSize") },
a = e.position === L.lastPosition && e.myParent === L.lastParent,
n = e.fontSize === L.lastFontSize;L.lastParent = e.myParent, L.lastPosition = e.position, L.lastFontSize = e.fontSize;var s = 100,
l = {};if (n && a) l.emToPx = L.lastEmToPx, l.percentToPxWidth = L.lastPercentToPxWidth, l.percentToPxHeight = L.lastPercentToPxHeight;else {
var u = i(o).isSVG ? r.createElementNS("http://www.w3.org/2000/svg", "rect") : r.createElement("div");b.init(u), e.myParent.appendChild(u), f.each(["overflow", "overflowX", "overflowY"], function (e, t) {
b.CSS.setPropertyValue(u, t, "hidden");
}), b.CSS.setPropertyValue(u, "position", e.position), b.CSS.setPropertyValue(u, "fontSize", e.fontSize), b.CSS.setPropertyValue(u, "boxSizing", "content-box"), f.each(["minWidth", "maxWidth", "width", "minHeight", "maxHeight", "height"], function (e, t) {
b.CSS.setPropertyValue(u, t, s + "%");
}), b.CSS.setPropertyValue(u, "paddingLeft", s + "em"), l.percentToPxWidth = L.lastPercentToPxWidth = (parseFloat(S.getPropertyValue(u, "width", null, !0)) || 1) / s, l.percentToPxHeight = L.lastPercentToPxHeight = (parseFloat(S.getPropertyValue(u, "height", null, !0)) || 1) / s, l.emToPx = L.lastEmToPx = (parseFloat(S.getPropertyValue(u, "paddingLeft")) || 1) / s, e.myParent.removeChild(u);
}return null === L.remToPx && (L.remToPx = parseFloat(S.getPropertyValue(r.body, "fontSize")) || 16), null === L.vwToPx && (L.vwToPx = parseFloat(t.innerWidth) / 100, L.vhToPx = parseFloat(t.innerHeight) / 100), l.remToPx = L.remToPx, l.vwToPx = L.vwToPx, l.vhToPx = L.vhToPx, b.debug >= 1 && console.log("Unit ratios: " + JSON.stringify(l), o), l;
}if (s.begin && 0 === V) try {
s.begin.call(g, g);
} catch (x) {
setTimeout(function () {
throw x;
}, 1);
}if ("scroll" === A) {
var P,
C,
T,
F = /^x$/i.test(s.axis) ? "Left" : "Top",
j = parseFloat(s.offset) || 0;s.container ? m.isWrapped(s.container) || m.isNode(s.container) ? (s.container = s.container[0] || s.container, P = s.container["scroll" + F], T = P + f(o).position()[F.toLowerCase()] + j) : s.container = null : (P = b.State.scrollAnchor[b.State["scrollProperty" + F]], C = b.State.scrollAnchor[b.State["scrollProperty" + ("Left" === F ? "Top" : "Left")]], T = f(o).offset()[F.toLowerCase()] + j), l = { scroll: { rootPropertyValue: !1, startValue: P, currentValue: P, endValue: T, unitType: "", easing: s.easing, scrollData: { container: s.container, direction: F, alternateValue: C } }, element: o }, b.debug && console.log("tweensContainer (scroll): ", l.scroll, o);
} else if ("reverse" === A) {
if (!i(o).tweensContainer) return void f.dequeue(o, s.queue);"none" === i(o).opts.display && (i(o).opts.display = "auto"), "hidden" === i(o).opts.visibility && (i(o).opts.visibility = "visible"), i(o).opts.loop = !1, i(o).opts.begin = null, i(o).opts.complete = null, v.easing || delete s.easing, v.duration || delete s.duration, s = f.extend({}, i(o).opts, s);var E = f.extend(!0, {}, i(o).tweensContainer);for (var H in E) {
if ("element" !== H) {
var N = E[H].startValue;E[H].startValue = E[H].currentValue = E[H].endValue, E[H].endValue = N, m.isEmptyObject(v) || (E[H].easing = s.easing), b.debug && console.log("reverse tweensContainer (" + H + "): " + JSON.stringify(E[H]), o);
}
}l = E;
} else if ("start" === A) {
var E;i(o).tweensContainer && i(o).isAnimating === !0 && (E = i(o).tweensContainer), f.each(y, function (e, t) {
if (RegExp("^" + S.Lists.colors.join("$|^") + "$").test(e)) {
var r = p(t, !0),
n = r[0],
o = r[1],
i = r[2];if (S.RegEx.isHex.test(n)) {
for (var s = ["Red", "Green", "Blue"], l = S.Values.hexToRgb(n), u = i ? S.Values.hexToRgb(i) : a, c = 0; c < s.length; c++) {
var f = [l[c]];o && f.push(o), u !== a && f.push(u[c]), y[e + s[c]] = f;
}delete y[e];
}
}
});for (var z in y) {
var O = p(y[z]),
q = O[0],
$ = O[1],
M = O[2];z = S.Names.camelCase(z);var I = S.Hooks.getRoot(z),
B = !1;if (i(o).isSVG || "tween" === I || S.Names.prefixCheck(I)[1] !== !1 || S.Normalizations.registered[I] !== a) {
(s.display !== a && null !== s.display && "none" !== s.display || s.visibility !== a && "hidden" !== s.visibility) && /opacity|filter/.test(z) && !M && 0 !== q && (M = 0), s._cacheValues && E && E[z] ? (M === a && (M = E[z].endValue + E[z].unitType), B = i(o).rootPropertyValueCache[I]) : S.Hooks.registered[z] ? M === a ? (B = S.getPropertyValue(o, I), M = S.getPropertyValue(o, z, B)) : B = S.Hooks.templates[I][1] : M === a && (M = S.getPropertyValue(o, z));var W,
G,
Y,
D = !1;if (W = d(z, M), M = W[0], Y = W[1], W = d(z, q), q = W[0].replace(/^([+-\/*])=/, function (e, t) {
return D = t, "";
}), G = W[1], M = parseFloat(M) || 0, q = parseFloat(q) || 0, "%" === G && (/^(fontSize|lineHeight)$/.test(z) ? (q /= 100, G = "em") : /^scale/.test(z) ? (q /= 100, G = "") : /(Red|Green|Blue)$/i.test(z) && (q = q / 100 * 255, G = "")), /[\/*]/.test(D)) G = Y;else if (Y !== G && 0 !== M) if (0 === q) G = Y;else {
n = n || h();var Q = /margin|padding|left|right|width|text|word|letter/i.test(z) || /X$/.test(z) || "x" === z ? "x" : "y";switch (Y) {case "%":
M *= "x" === Q ? n.percentToPxWidth : n.percentToPxHeight;break;case "px":
break;default:
M *= n[Y + "ToPx"];}switch (G) {case "%":
M *= 1 / ("x" === Q ? n.percentToPxWidth : n.percentToPxHeight);break;case "px":
break;default:
M *= 1 / n[G + "ToPx"];}
}switch (D) {case "+":
q = M + q;break;case "-":
q = M - q;break;case "*":
q = M * q;break;case "/":
q = M / q;}l[z] = { rootPropertyValue: B, startValue: M, currentValue: M, endValue: q, unitType: G, easing: $ }, b.debug && console.log("tweensContainer (" + z + "): " + JSON.stringify(l[z]), o);
} else b.debug && console.log("Skipping [" + I + "] due to a lack of browser support.");
}l.element = o;
}l.element && (S.Values.addClass(o, "velocity-animating"), R.push(l), "" === s.queue && (i(o).tweensContainer = l, i(o).opts = s), i(o).isAnimating = !0, V === w - 1 ? (b.State.calls.push([R, g, s, null, k.resolver]), b.State.isTicking === !1 && (b.State.isTicking = !0, c())) : V++);
}var n,
o = this,
s = f.extend({}, b.defaults, v),
l = {};switch (i(o) === a && b.init(o), parseFloat(s.delay) && s.queue !== !1 && f.queue(o, s.queue, function (e) {
b.velocityQueueEntryFlag = !0, i(o).delayTimer = { setTimeout: setTimeout(e, parseFloat(s.delay)), next: e };
}), s.duration.toString().toLowerCase()) {case "fast":
s.duration = 200;break;case "normal":
s.duration = h;break;case "slow":
s.duration = 600;break;default:
s.duration = parseFloat(s.duration) || 1;}b.mock !== !1 && (b.mock === !0 ? s.duration = s.delay = 1 : (s.duration *= parseFloat(b.mock) || 1, s.delay *= parseFloat(b.mock) || 1)), s.easing = u(s.easing, s.duration), s.begin && !m.isFunction(s.begin) && (s.begin = null), s.progress && !m.isFunction(s.progress) && (s.progress = null), s.complete && !m.isFunction(s.complete) && (s.complete = null), s.display !== a && null !== s.display && (s.display = s.display.toString().toLowerCase(), "auto" === s.display && (s.display = b.CSS.Values.getDisplayType(o))), s.visibility !== a && null !== s.visibility && (s.visibility = s.visibility.toString().toLowerCase()), s.mobileHA = s.mobileHA && b.State.isMobile && !b.State.isGingerbread, s.queue === !1 ? s.delay ? setTimeout(e, s.delay) : e() : f.queue(o, s.queue, function (t, r) {
return r === !0 ? (k.promise && k.resolver(g), !0) : (b.velocityQueueEntryFlag = !0, void e(t));
}), "" !== s.queue && "fx" !== s.queue || "inprogress" === f.queue(o)[0] || f.dequeue(o);
}var s,
l,
d,
g,
y,
v,
x = arguments[0] && (arguments[0].p || f.isPlainObject(arguments[0].properties) && !arguments[0].properties.names || m.isString(arguments[0].properties));if (m.isWrapped(this) ? (s = !1, d = 0, g = this, l = this) : (s = !0, d = 1, g = x ? arguments[0].elements || arguments[0].e : arguments[0]), g = o(g)) {
x ? (y = arguments[0].properties || arguments[0].p, v = arguments[0].options || arguments[0].o) : (y = arguments[d], v = arguments[d + 1]);var w = g.length,
V = 0;if (!/^(stop|finish)$/i.test(y) && !f.isPlainObject(v)) {
var C = d + 1;v = {};for (var T = C; T < arguments.length; T++) {
m.isArray(arguments[T]) || !/^(fast|normal|slow)$/i.test(arguments[T]) && !/^\d/.test(arguments[T]) ? m.isString(arguments[T]) || m.isArray(arguments[T]) ? v.easing = arguments[T] : m.isFunction(arguments[T]) && (v.complete = arguments[T]) : v.duration = arguments[T];
}
}var k = { promise: null, resolver: null, rejecter: null };s && b.Promise && (k.promise = new b.Promise(function (e, t) {
k.resolver = e, k.rejecter = t;
}));var A;switch (y) {case "scroll":
A = "scroll";break;case "reverse":
A = "reverse";break;case "finish":case "stop":
f.each(g, function (e, t) {
i(t) && i(t).delayTimer && (clearTimeout(i(t).delayTimer.setTimeout), i(t).delayTimer.next && i(t).delayTimer.next(), delete i(t).delayTimer);
});var F = [];return f.each(b.State.calls, function (e, t) {
t && f.each(t[1], function (r, n) {
var o = v === a ? "" : v;return o === !0 || t[2].queue === o || v === a && t[2].queue === !1 ? void f.each(g, function (r, a) {
a === n && ((v === !0 || m.isString(v)) && (f.each(f.queue(a, m.isString(v) ? v : ""), function (e, t) {
m.isFunction(t) && t(null, !0);
}), f.queue(a, m.isString(v) ? v : "", [])), "stop" === y ? (i(a) && i(a).tweensContainer && o !== !1 && f.each(i(a).tweensContainer, function (e, t) {
t.endValue = t.currentValue;
}), F.push(e)) : "finish" === y && (t[2].duration = 1));
}) : !0;
});
}), "stop" === y && (f.each(F, function (e, t) {
p(t, !0);
}), k.promise && k.resolver(g)), e();default:
if (!f.isPlainObject(y) || m.isEmptyObject(y)) {
if (m.isString(y) && b.Redirects[y]) {
var j = f.extend({}, v),
E = j.duration,
H = j.delay || 0;return j.backwards === !0 && (g = f.extend(!0, [], g).reverse()), f.each(g, function (e, t) {
parseFloat(j.stagger) ? j.delay = H + parseFloat(j.stagger) * e : m.isFunction(j.stagger) && (j.delay = H + j.stagger.call(t, e, w)), j.drag && (j.duration = parseFloat(E) || (/^(callout|transition)/.test(y) ? 1e3 : h), j.duration = Math.max(j.duration * (j.backwards ? 1 - e / w : (e + 1) / w), .75 * j.duration, 200)), b.Redirects[y].call(t, t, j || {}, e, w, g, k.promise ? k : a);
}), e();
}var N = "Velocity: First argument (" + y + ") was not a property map, a known action, or a registered redirect. Aborting.";return k.promise ? k.rejecter(new Error(N)) : console.log(N), e();
}A = "start";}var L = { lastParent: null, lastPosition: null, lastFontSize: null, lastPercentToPxWidth: null, lastPercentToPxHeight: null, lastEmToPx: null, remToPx: null, vwToPx: null, vhToPx: null },
R = [];f.each(g, function (e, t) {
m.isNode(t) && n.call(t);
});var z,
j = f.extend({}, b.defaults, v);if (j.loop = parseInt(j.loop), z = 2 * j.loop - 1, j.loop) for (var O = 0; z > O; O++) {
var q = { delay: j.delay, progress: j.progress };O === z - 1 && (q.display = j.display, q.visibility = j.visibility, q.complete = j.complete), P(g, "reverse", q);
}return e();
}
};b = f.extend(P, b), b.animate = P;var w = t.requestAnimationFrame || g;return b.State.isMobile || r.hidden === a || r.addEventListener("visibilitychange", function () {
r.hidden ? (w = function (e) {
return setTimeout(function () {
e(!0);
}, 16);
}, c()) : w = t.requestAnimationFrame || g;
}), e.Velocity = b, e !== t && (e.fn.velocity = P, e.fn.velocity.defaults = b.defaults), f.each(["Down", "Up"], function (e, t) {
b.Redirects["slide" + t] = function (e, r, n, o, i, s) {
var l = f.extend({}, r),
u = l.begin,
c = l.complete,
p = { height: "", marginTop: "", marginBottom: "", paddingTop: "", paddingBottom: "" },
d = {};l.display === a && (l.display = "Down" === t ? "inline" === b.CSS.Values.getDisplayType(e) ? "inline-block" : "block" : "none"), l.begin = function () {
u && u.call(i, i);for (var r in p) {
d[r] = e.style[r];var a = b.CSS.getPropertyValue(e, r);p[r] = "Down" === t ? [a, 0] : [0, a];
}d.overflow = e.style.overflow, e.style.overflow = "hidden";
}, l.complete = function () {
for (var t in d) {
e.style[t] = d[t];
}c && c.call(i, i), s && s.resolver(i);
}, b(e, p, l);
};
}), f.each(["In", "Out"], function (e, t) {
b.Redirects["fade" + t] = function (e, r, n, o, i, s) {
var l = f.extend({}, r),
u = { opacity: "In" === t ? 1 : 0 },
c = l.complete;l.complete = n !== o - 1 ? l.begin = null : function () {
c && c.call(i, i), s && s.resolver(i);
}, l.display === a && (l.display = "In" === t ? "auto" : "none"), b(this, u, l);
};
}), b;
}(window.jQuery || window.Zepto || window, window, document);
}));
;!function (a, b, c, d) {
"use strict";
function k(a, b, c) {
return setTimeout(q(a, c), b);
}function l(a, b, c) {
return Array.isArray(a) ? (m(a, c[b], c), !0) : !1;
}function m(a, b, c) {
var e;if (a) if (a.forEach) a.forEach(b, c);else if (a.length !== d) for (e = 0; e < a.length;) {
b.call(c, a[e], e, a), e++;
} else for (e in a) {
a.hasOwnProperty(e) && b.call(c, a[e], e, a);
}
}function n(a, b, c) {
for (var e = Object.keys(b), f = 0; f < e.length;) {
(!c || c && a[e[f]] === d) && (a[e[f]] = b[e[f]]), f++;
}return a;
}function o(a, b) {
return n(a, b, !0);
}function p(a, b, c) {
var e,
d = b.prototype;e = a.prototype = Object.create(d), e.constructor = a, e._super = d, c && n(e, c);
}function q(a, b) {
return function () {
return a.apply(b, arguments);
};
}function r(a, b) {
return typeof a == g ? a.apply(b ? b[0] || d : d, b) : a;
}function s(a, b) {
return a === d ? b : a;
}function t(a, b, c) {
m(x(b), function (b) {
a.addEventListener(b, c, !1);
});
}function u(a, b, c) {
m(x(b), function (b) {
a.removeEventListener(b, c, !1);
});
}function v(a, b) {
for (; a;) {
if (a == b) return !0;a = a.parentNode;
}return !1;
}function w(a, b) {
return a.indexOf(b) > -1;
}function x(a) {
return a.trim().split(/\s+/g);
}function y(a, b, c) {
if (a.indexOf && !c) return a.indexOf(b);for (var d = 0; d < a.length;) {
if (c && a[d][c] == b || !c && a[d] === b) return d;d++;
}return -1;
}function z(a) {
return Array.prototype.slice.call(a, 0);
}function A(a, b, c) {
for (var d = [], e = [], f = 0; f < a.length;) {
var g = b ? a[f][b] : a[f];y(e, g) < 0 && d.push(a[f]), e[f] = g, f++;
}return c && (d = b ? d.sort(function (a, c) {
return a[b] > c[b];
}) : d.sort()), d;
}function B(a, b) {
for (var c, f, g = b[0].toUpperCase() + b.slice(1), h = 0; h < e.length;) {
if (c = e[h], f = c ? c + g : b, f in a) return f;h++;
}return d;
}function D() {
return C++;
}function E(a) {
var b = a.ownerDocument;return b.defaultView || b.parentWindow;
}function ab(a, b) {
var c = this;this.manager = a, this.callback = b, this.element = a.element, this.target = a.options.inputTarget, this.domHandler = function (b) {
r(a.options.enable, [a]) && c.handler(b);
}, this.init();
}function bb(a) {
var b,
c = a.options.inputClass;return b = c ? c : H ? wb : I ? Eb : G ? Gb : rb, new b(a, cb);
}function cb(a, b, c) {
var d = c.pointers.length,
e = c.changedPointers.length,
f = b & O && 0 === d - e,
g = b & (Q | R) && 0 === d - e;c.isFirst = !!f, c.isFinal = !!g, f && (a.session = {}), c.eventType = b, db(a, c), a.emit("hammer.input", c), a.recognize(c), a.session.prevInput = c;
}function db(a, b) {
var c = a.session,
d = b.pointers,
e = d.length;c.firstInput || (c.firstInput = gb(b)), e > 1 && !c.firstMultiple ? c.firstMultiple = gb(b) : 1 === e && (c.firstMultiple = !1);var f = c.firstInput,
g = c.firstMultiple,
h = g ? g.center : f.center,
i = b.center = hb(d);b.timeStamp = j(), b.deltaTime = b.timeStamp - f.timeStamp, b.angle = lb(h, i), b.distance = kb(h, i), eb(c, b), b.offsetDirection = jb(b.deltaX, b.deltaY), b.scale = g ? nb(g.pointers, d) : 1, b.rotation = g ? mb(g.pointers, d) : 0, fb(c, b);var k = a.element;v(b.srcEvent.target, k) && (k = b.srcEvent.target), b.target = k;
}function eb(a, b) {
var c = b.center,
d = a.offsetDelta || {},
e = a.prevDelta || {},
f = a.prevInput || {};(b.eventType === O || f.eventType === Q) && (e = a.prevDelta = { x: f.deltaX || 0, y: f.deltaY || 0 }, d = a.offsetDelta = { x: c.x, y: c.y }), b.deltaX = e.x + (c.x - d.x), b.deltaY = e.y + (c.y - d.y);
}function fb(a, b) {
var f,
g,
h,
j,
c = a.lastInterval || b,
e = b.timeStamp - c.timeStamp;if (b.eventType != R && (e > N || c.velocity === d)) {
var k = c.deltaX - b.deltaX,
l = c.deltaY - b.deltaY,
m = ib(e, k, l);g = m.x, h = m.y, f = i(m.x) > i(m.y) ? m.x : m.y, j = jb(k, l), a.lastInterval = b;
} else f = c.velocity, g = c.velocityX, h = c.velocityY, j = c.direction;b.velocity = f, b.velocityX = g, b.velocityY = h, b.direction = j;
}function gb(a) {
for (var b = [], c = 0; c < a.pointers.length;) {
b[c] = { clientX: h(a.pointers[c].clientX), clientY: h(a.pointers[c].clientY) }, c++;
}return { timeStamp: j(), pointers: b, center: hb(b), deltaX: a.deltaX, deltaY: a.deltaY };
}function hb(a) {
var b = a.length;if (1 === b) return { x: h(a[0].clientX), y: h(a[0].clientY) };for (var c = 0, d = 0, e = 0; b > e;) {
c += a[e].clientX, d += a[e].clientY, e++;
}return { x: h(c / b), y: h(d / b) };
}function ib(a, b, c) {
return { x: b / a || 0, y: c / a || 0 };
}function jb(a, b) {
return a === b ? S : i(a) >= i(b) ? a > 0 ? T : U : b > 0 ? V : W;
}function kb(a, b, c) {
c || (c = $);var d = b[c[0]] - a[c[0]],
e = b[c[1]] - a[c[1]];return Math.sqrt(d * d + e * e);
}function lb(a, b, c) {
c || (c = $);var d = b[c[0]] - a[c[0]],
e = b[c[1]] - a[c[1]];return 180 * Math.atan2(e, d) / Math.PI;
}function mb(a, b) {
return lb(b[1], b[0], _) - lb(a[1], a[0], _);
}function nb(a, b) {
return kb(b[0], b[1], _) / kb(a[0], a[1], _);
}function rb() {
this.evEl = pb, this.evWin = qb, this.allow = !0, this.pressed = !1, ab.apply(this, arguments);
}function wb() {
this.evEl = ub, this.evWin = vb, ab.apply(this, arguments), this.store = this.manager.session.pointerEvents = [];
}function Ab() {
this.evTarget = yb, this.evWin = zb, this.started = !1, ab.apply(this, arguments);
}function Bb(a, b) {
var c = z(a.touches),
d = z(a.changedTouches);return b & (Q | R) && (c = A(c.concat(d), "identifier", !0)), [c, d];
}function Eb() {
this.evTarget = Db, this.targetIds = {}, ab.apply(this, arguments);
}function Fb(a, b) {
var c = z(a.touches),
d = this.targetIds;if (b & (O | P) && 1 === c.length) return d[c[0].identifier] = !0, [c, c];var e,
f,
g = z(a.changedTouches),
h = [],
i = this.target;if (f = c.filter(function (a) {
return v(a.target, i);
}), b === O) for (e = 0; e < f.length;) {
d[f[e].identifier] = !0, e++;
}for (e = 0; e < g.length;) {
d[g[e].identifier] && h.push(g[e]), b & (Q | R) && delete d[g[e].identifier], e++;
}return h.length ? [A(f.concat(h), "identifier", !0), h] : void 0;
}function Gb() {
ab.apply(this, arguments);var a = q(this.handler, this);this.touch = new Eb(this.manager, a), this.mouse = new rb(this.manager, a);
}function Pb(a, b) {
this.manager = a, this.set(b);
}function Qb(a) {
if (w(a, Mb)) return Mb;var b = w(a, Nb),
c = w(a, Ob);return b && c ? Nb + " " + Ob : b || c ? b ? Nb : Ob : w(a, Lb) ? Lb : Kb;
}function Yb(a) {
this.id = D(), this.manager = null, this.options = o(a || {}, this.defaults), this.options.enable = s(this.options.enable, !0), this.state = Rb, this.simultaneous = {}, this.requireFail = [];
}function Zb(a) {
return a & Wb ? "cancel" : a & Ub ? "end" : a & Tb ? "move" : a & Sb ? "start" : "";
}function $b(a) {
return a == W ? "down" : a == V ? "up" : a == T ? "left" : a == U ? "right" : "";
}function _b(a, b) {
var c = b.manager;return c ? c.get(a) : a;
}function ac() {
Yb.apply(this, arguments);
}function bc() {
ac.apply(this, arguments), this.pX = null, this.pY = null;
}function cc() {
ac.apply(this, arguments);
}function dc() {
Yb.apply(this, arguments), this._timer = null, this._input = null;
}function ec() {
ac.apply(this, arguments);
}function fc() {
ac.apply(this, arguments);
}function gc() {
Yb.apply(this, arguments), this.pTime = !1, this.pCenter = !1, this._timer = null, this._input = null, this.count = 0;
}function hc(a, b) {
return b = b || {}, b.recognizers = s(b.recognizers, hc.defaults.preset), new kc(a, b);
}function kc(a, b) {
b = b || {}, this.options = o(b, hc.defaults), this.options.inputTarget = this.options.inputTarget || a, this.handlers = {}, this.session = {}, this.recognizers = [], this.element = a, this.input = bb(this), this.touchAction = new Pb(this, this.options.touchAction), lc(this, !0), m(b.recognizers, function (a) {
var b = this.add(new a[0](a[1]));a[2] && b.recognizeWith(a[2]), a[3] && b.requireFailure(a[3]);
}, this);
}function lc(a, b) {
var c = a.element;m(a.options.cssProps, function (a, d) {
c.style[B(c.style, d)] = b ? a : "";
});
}function mc(a, c) {
var d = b.createEvent("Event");d.initEvent(a, !0, !0), d.gesture = c, c.target.dispatchEvent(d);
}var e = ["", "webkit", "moz", "MS", "ms", "o"],
f = b.createElement("div"),
g = "function",
h = Math.round,
i = Math.abs,
j = Date.now,
C = 1,
F = /mobile|tablet|ip(ad|hone|od)|android/i,
G = "ontouchstart" in a,
H = B(a, "PointerEvent") !== d,
I = G && F.test(navigator.userAgent),
J = "touch",
K = "pen",
L = "mouse",
M = "kinect",
N = 25,
O = 1,
P = 2,
Q = 4,
R = 8,
S = 1,
T = 2,
U = 4,
V = 8,
W = 16,
X = T | U,
Y = V | W,
Z = X | Y,
$ = ["x", "y"],
_ = ["clientX", "clientY"];ab.prototype = { handler: function () {}, init: function () {
this.evEl && t(this.element, this.evEl, this.domHandler), this.evTarget && t(this.target, this.evTarget, this.domHandler), this.evWin && t(E(this.element), this.evWin, this.domHandler);
}, destroy: function () {
this.evEl && u(this.element, this.evEl, this.domHandler), this.evTarget && u(this.target, this.evTarget, this.domHandler), this.evWin && u(E(this.element), this.evWin, this.domHandler);
} };var ob = { mousedown: O, mousemove: P, mouseup: Q },
pb = "mousedown",
qb = "mousemove mouseup";p(rb, ab, { handler: function (a) {
var b = ob[a.type];b & O && 0 === a.button && (this.pressed = !0), b & P && 1 !== a.which && (b = Q), this.pressed && this.allow && (b & Q && (this.pressed = !1), this.callback(this.manager, b, { pointers: [a], changedPointers: [a], pointerType: L, srcEvent: a }));
} });var sb = { pointerdown: O, pointermove: P, pointerup: Q, pointercancel: R, pointerout: R },
tb = { 2: J, 3: K, 4: L, 5: M },
ub = "pointerdown",
vb = "pointermove pointerup pointercancel";a.MSPointerEvent && (ub = "MSPointerDown", vb = "MSPointerMove MSPointerUp MSPointerCancel"), p(wb, ab, { handler: function (a) {
var b = this.store,
c = !1,
d = a.type.toLowerCase().replace("ms", ""),
e = sb[d],
f = tb[a.pointerType] || a.pointerType,
g = f == J,
h = y(b, a.pointerId, "pointerId");e & O && (0 === a.button || g) ? 0 > h && (b.push(a), h = b.length - 1) : e & (Q | R) && (c = !0), 0 > h || (b[h] = a, this.callback(this.manager, e, { pointers: b, changedPointers: [a], pointerType: f, srcEvent: a }), c && b.splice(h, 1));
} });var xb = { touchstart: O, touchmove: P, touchend: Q, touchcancel: R },
yb = "touchstart",
zb = "touchstart touchmove touchend touchcancel";p(Ab, ab, { handler: function (a) {
var b = xb[a.type];if (b === O && (this.started = !0), this.started) {
var c = Bb.call(this, a, b);b & (Q | R) && 0 === c[0].length - c[1].length && (this.started = !1), this.callback(this.manager, b, { pointers: c[0], changedPointers: c[1], pointerType: J, srcEvent: a });
}
} });var Cb = { touchstart: O, touchmove: P, touchend: Q, touchcancel: R },
Db = "touchstart touchmove touchend touchcancel";p(Eb, ab, { handler: function (a) {
var b = Cb[a.type],
c = Fb.call(this, a, b);c && this.callback(this.manager, b, { pointers: c[0], changedPointers: c[1], pointerType: J, srcEvent: a });
} }), p(Gb, ab, { handler: function (a, b, c) {
var d = c.pointerType == J,
e = c.pointerType == L;if (d) this.mouse.allow = !1;else if (e && !this.mouse.allow) return;b & (Q | R) && (this.mouse.allow = !0), this.callback(a, b, c);
}, destroy: function () {
this.touch.destroy(), this.mouse.destroy();
} });var Hb = B(f.style, "touchAction"),
Ib = Hb !== d,
Jb = "compute",
Kb = "auto",
Lb = "manipulation",
Mb = "none",
Nb = "pan-x",
Ob = "pan-y";Pb.prototype = { set: function (a) {
a == Jb && (a = this.compute()), Ib && (this.manager.element.style[Hb] = a), this.actions = a.toLowerCase().trim();
}, update: function () {
this.set(this.manager.options.touchAction);
}, compute: function () {
var a = [];return m(this.manager.recognizers, function (b) {
r(b.options.enable, [b]) && (a = a.concat(b.getTouchAction()));
}), Qb(a.join(" "));
}, preventDefaults: function (a) {
if (!Ib) {
var b = a.srcEvent,
c = a.offsetDirection;if (this.manager.session.prevented) return b.preventDefault(), void 0;var d = this.actions,
e = w(d, Mb),
f = w(d, Ob),
g = w(d, Nb);return e || f && c & X || g && c & Y ? this.preventSrc(b) : void 0;
}
}, preventSrc: function (a) {
this.manager.session.prevented = !0, a.preventDefault();
} };var Rb = 1,
Sb = 2,
Tb = 4,
Ub = 8,
Vb = Ub,
Wb = 16,
Xb = 32;Yb.prototype = { defaults: {}, set: function (a) {
return n(this.options, a), this.manager && this.manager.touchAction.update(), this;
}, recognizeWith: function (a) {
if (l(a, "recognizeWith", this)) return this;var b = this.simultaneous;return a = _b(a, this), b[a.id] || (b[a.id] = a, a.recognizeWith(this)), this;
}, dropRecognizeWith: function (a) {
return l(a, "dropRecognizeWith", this) ? this : (a = _b(a, this), delete this.simultaneous[a.id], this);
}, requireFailure: function (a) {
if (l(a, "requireFailure", this)) return this;var b = this.requireFail;return a = _b(a, this), -1 === y(b, a) && (b.push(a), a.requireFailure(this)), this;
}, dropRequireFailure: function (a) {
if (l(a, "dropRequireFailure", this)) return this;a = _b(a, this);var b = y(this.requireFail, a);return b > -1 && this.requireFail.splice(b, 1), this;
}, hasRequireFailures: function () {
return this.requireFail.length > 0;
}, canRecognizeWith: function (a) {
return !!this.simultaneous[a.id];
}, emit: function (a) {
function d(d) {
b.manager.emit(b.options.event + (d ? Zb(c) : ""), a);
}var b = this,
c = this.state;Ub > c && d(!0), d(), c >= Ub && d(!0);
}, tryEmit: function (a) {
return this.canEmit() ? this.emit(a) : (this.state = Xb, void 0);
}, canEmit: function () {
for (var a = 0; a < this.requireFail.length;) {
if (!(this.requireFail[a].state & (Xb | Rb))) return !1;a++;
}return !0;
}, recognize: function (a) {
var b = n({}, a);return r(this.options.enable, [this, b]) ? (this.state & (Vb | Wb | Xb) && (this.state = Rb), this.state = this.process(b), this.state & (Sb | Tb | Ub | Wb) && this.tryEmit(b), void 0) : (this.reset(), this.state = Xb, void 0);
}, process: function () {}, getTouchAction: function () {}, reset: function () {} }, p(ac, Yb, { defaults: { pointers: 1 }, attrTest: function (a) {
var b = this.options.pointers;return 0 === b || a.pointers.length === b;
}, process: function (a) {
var b = this.state,
c = a.eventType,
d = b & (Sb | Tb),
e = this.attrTest(a);return d && (c & R || !e) ? b | Wb : d || e ? c & Q ? b | Ub : b & Sb ? b | Tb : Sb : Xb;
} }), p(bc, ac, { defaults: { event: "pan", threshold: 10, pointers: 1, direction: Z }, getTouchAction: function () {
var a = this.options.direction,
b = [];return a & X && b.push(Ob), a & Y && b.push(Nb), b;
}, directionTest: function (a) {
var b = this.options,
c = !0,
d = a.distance,
e = a.direction,
f = a.deltaX,
g = a.deltaY;return e & b.direction || (b.direction & X ? (e = 0 === f ? S : 0 > f ? T : U, c = f != this.pX, d = Math.abs(a.deltaX)) : (e = 0 === g ? S : 0 > g ? V : W, c = g != this.pY, d = Math.abs(a.deltaY))), a.direction = e, c && d > b.threshold && e & b.direction;
}, attrTest: function (a) {
return ac.prototype.attrTest.call(this, a) && (this.state & Sb || !(this.state & Sb) && this.directionTest(a));
}, emit: function (a) {
this.pX = a.deltaX, this.pY = a.deltaY;var b = $b(a.direction);b && this.manager.emit(this.options.event + b, a), this._super.emit.call(this, a);
} }), p(cc, ac, { defaults: { event: "pinch", threshold: 0, pointers: 2 }, getTouchAction: function () {
return [Mb];
}, attrTest: function (a) {
return this._super.attrTest.call(this, a) && (Math.abs(a.scale - 1) > this.options.threshold || this.state & Sb);
}, emit: function (a) {
if (this._super.emit.call(this, a), 1 !== a.scale) {
var b = a.scale < 1 ? "in" : "out";this.manager.emit(this.options.event + b, a);
}
} }), p(dc, Yb, { defaults: { event: "press", pointers: 1, time: 500, threshold: 5 }, getTouchAction: function () {
return [Kb];
}, process: function (a) {
var b = this.options,
c = a.pointers.length === b.pointers,
d = a.distance < b.threshold,
e = a.deltaTime > b.time;if (this._input = a, !d || !c || a.eventType & (Q | R) && !e) this.reset();else if (a.eventType & O) this.reset(), this._timer = k(function () {
this.state = Vb, this.tryEmit();
}, b.time, this);else if (a.eventType & Q) return Vb;return Xb;
}, reset: function () {
clearTimeout(this._timer);
}, emit: function (a) {
this.state === Vb && (a && a.eventType & Q ? this.manager.emit(this.options.event + "up", a) : (this._input.timeStamp = j(), this.manager.emit(this.options.event, this._input)));
} }), p(ec, ac, { defaults: { event: "rotate", threshold: 0, pointers: 2 }, getTouchAction: function () {
return [Mb];
}, attrTest: function (a) {
return this._super.attrTest.call(this, a) && (Math.abs(a.rotation) > this.options.threshold || this.state & Sb);
} }), p(fc, ac, { defaults: { event: "swipe", threshold: 10, velocity: .65, direction: X | Y, pointers: 1 }, getTouchAction: function () {
return bc.prototype.getTouchAction.call(this);
}, attrTest: function (a) {
var c,
b = this.options.direction;return b & (X | Y) ? c = a.velocity : b & X ? c = a.velocityX : b & Y && (c = a.velocityY), this._super.attrTest.call(this, a) && b & a.direction && a.distance > this.options.threshold && i(c) > this.options.velocity && a.eventType & Q;
}, emit: function (a) {
var b = $b(a.direction);b && this.manager.emit(this.options.event + b, a), this.manager.emit(this.options.event, a);
} }), p(gc, Yb, { defaults: { event: "tap", pointers: 1, taps: 1, interval: 300, time: 250, threshold: 2, posThreshold: 10 }, getTouchAction: function () {
return [Lb];
}, process: function (a) {
var b = this.options,
c = a.pointers.length === b.pointers,
d = a.distance < b.threshold,
e = a.deltaTime < b.time;if (this.reset(), a.eventType & O && 0 === this.count) return this.failTimeout();if (d && e && c) {
if (a.eventType != Q) return this.failTimeout();var f = this.pTime ? a.timeStamp - this.pTime < b.interval : !0,
g = !this.pCenter || kb(this.pCenter, a.center) < b.posThreshold;this.pTime = a.timeStamp, this.pCenter = a.center, g && f ? this.count += 1 : this.count = 1, this._input = a;var h = this.count % b.taps;if (0 === h) return this.hasRequireFailures() ? (this._timer = k(function () {
this.state = Vb, this.tryEmit();
}, b.interval, this), Sb) : Vb;
}return Xb;
}, failTimeout: function () {
return this._timer = k(function () {
this.state = Xb;
}, this.options.interval, this), Xb;
}, reset: function () {
clearTimeout(this._timer);
}, emit: function () {
this.state == Vb && (this._input.tapCount = this.count, this.manager.emit(this.options.event, this._input));
} }), hc.VERSION = "2.0.4", hc.defaults = { domEvents: !1, touchAction: Jb, enable: !0, inputTarget: null, inputClass: null, preset: [[ec, { enable: !1 }], [cc, { enable: !1 }, ["rotate"]], [fc, { direction: X }], [bc, { direction: X }, ["swipe"]], [gc], [gc, { event: "doubletap", taps: 2 }, ["tap"]], [dc]], cssProps: { userSelect: "default", touchSelect: "none", touchCallout: "none", contentZooming: "none", userDrag: "none", tapHighlightColor: "rgba(0,0,0,0)" } };var ic = 1,
jc = 2;kc.prototype = { set: function (a) {
return n(this.options, a), a.touchAction && this.touchAction.update(), a.inputTarget && (this.input.destroy(), this.input.target = a.inputTarget, this.input.init()), this;
}, stop: function (a) {
this.session.stopped = a ? jc : ic;
}, recognize: function (a) {
var b = this.session;if (!b.stopped) {
this.touchAction.preventDefaults(a);var c,
d = this.recognizers,
e = b.curRecognizer;(!e || e && e.state & Vb) && (e = b.curRecognizer = null);for (var f = 0; f < d.length;) {
c = d[f], b.stopped === jc || e && c != e && !c.canRecognizeWith(e) ? c.reset() : c.recognize(a), !e && c.state & (Sb | Tb | Ub) && (e = b.curRecognizer = c), f++;
}
}
}, get: function (a) {
if (a instanceof Yb) return a;for (var b = this.recognizers, c = 0; c < b.length; c++) {
if (b[c].options.event == a) return b[c];
}return null;
}, add: function (a) {
if (l(a, "add", this)) return this;var b = this.get(a.options.event);return b && this.remove(b), this.recognizers.push(a), a.manager = this, this.touchAction.update(), a;
}, remove: function (a) {
if (l(a, "remove", this)) return this;var b = this.recognizers;return a = this.get(a), b.splice(y(b, a), 1), this.touchAction.update(), this;
}, on: function (a, b) {
var c = this.handlers;return m(x(a), function (a) {
c[a] = c[a] || [], c[a].push(b);
}), this;
}, off: function (a, b) {
var c = this.handlers;return m(x(a), function (a) {
b ? c[a].splice(y(c[a], b), 1) : delete c[a];
}), this;
}, emit: function (a, b) {
this.options.domEvents && mc(a, b);var c = this.handlers[a] && this.handlers[a].slice();if (c && c.length) {
b.type = a, b.preventDefault = function () {
b.srcEvent.preventDefault();
};for (var d = 0; d < c.length;) {
c[d](b), d++;
}
}
}, destroy: function () {
this.element && lc(this, !1), this.handlers = {}, this.session = {}, this.input.destroy(), this.element = null;
} }, n(hc, { INPUT_START: O, INPUT_MOVE: P, INPUT_END: Q, INPUT_CANCEL: R, STATE_POSSIBLE: Rb, STATE_BEGAN: Sb, STATE_CHANGED: Tb, STATE_ENDED: Ub, STATE_RECOGNIZED: Vb, STATE_CANCELLED: Wb, STATE_FAILED: Xb, DIRECTION_NONE: S, DIRECTION_LEFT: T, DIRECTION_RIGHT: U, DIRECTION_UP: V, DIRECTION_DOWN: W, DIRECTION_HORIZONTAL: X, DIRECTION_VERTICAL: Y, DIRECTION_ALL: Z, Manager: kc, Input: ab, TouchAction: Pb, TouchInput: Eb, MouseInput: rb, PointerEventInput: wb, TouchMouseInput: Gb, SingleTouchInput: Ab, Recognizer: Yb, AttrRecognizer: ac, Tap: gc, Pan: bc, Swipe: fc, Pinch: cc, Rotate: ec, Press: dc, on: t, off: u, each: m, merge: o, extend: n, inherit: p, bindFn: q, prefixed: B }), typeof define == g && define.amd ? define(function () {
return hc;
}) : "undefined" != typeof module && module.exports ? module.exports = hc : a[c] = hc;
}(window, document, "Hammer");;(function (factory) {
if (typeof define === 'function' && define.amd) {
define(['jquery', 'hammerjs'], factory);
} else if (typeof exports === 'object') {
factory(require('jquery'), require('hammerjs'));
} else {
factory(jQuery, Hammer);
}
})(function ($, Hammer) {
function hammerify(el, options) {
var $el = $(el);
if (!$el.data("hammer")) {
$el.data("hammer", new Hammer($el[0], options));
}
}
$.fn.hammer = function (options) {
return this.each(function () {
hammerify(this, options);
});
};
// extend the emit method to also trigger jQuery events
Hammer.Manager.prototype.emit = function (originalEmit) {
return function (type, data) {
originalEmit.call(this, type, data);
$(this.element).trigger({
type: type,
gesture: data
});
};
}(Hammer.Manager.prototype.emit);
});
; // Required for Meteor package, the use of window prevents export by Meteor
(function (window) {
if (window.Package) {
Materialize = {};
} else {
window.Materialize = {};
}
})(window);
if (typeof exports !== 'undefined' && !exports.nodeType) {
if (typeof module !== 'undefined' && !module.nodeType && module.exports) {
exports = module.exports = Materialize;
}
exports.default = Materialize;
}
/*
* raf.js
* https://github.com/ngryman/raf.js
*
* original requestAnimationFrame polyfill by Erik Möller
* inspired from paul_irish gist and post
*
* Copyright (c) 2013 ngryman
* Licensed under the MIT license.
*/
(function (window) {
var lastTime = 0,
vendors = ['webkit', 'moz'],
requestAnimationFrame = window.requestAnimationFrame,
cancelAnimationFrame = window.cancelAnimationFrame,
i = vendors.length;
// try to un-prefix existing raf
while (--i >= 0 && !requestAnimationFrame) {
requestAnimationFrame = window[vendors[i] + 'RequestAnimationFrame'];
cancelAnimationFrame = window[vendors[i] + 'CancelRequestAnimationFrame'];
}
// polyfill with setTimeout fallback
// heavily inspired from @darius gist mod: https://gist.github.com/paulirish/1579671#comment-837945
if (!requestAnimationFrame || !cancelAnimationFrame) {
requestAnimationFrame = function (callback) {
var now = +Date.now(),
nextTime = Math.max(lastTime + 16, now);
return setTimeout(function () {
callback(lastTime = nextTime);
}, nextTime - now);
};
cancelAnimationFrame = clearTimeout;
}
// export to window
window.requestAnimationFrame = requestAnimationFrame;
window.cancelAnimationFrame = cancelAnimationFrame;
})(window);
/**
* Generate approximated selector string for a jQuery object
* @param {jQuery} obj jQuery object to be parsed
* @returns {string}
*/
Materialize.objectSelectorString = function (obj) {
var tagStr = obj.prop('tagName') || '';
var idStr = obj.attr('id') || '';
var classStr = obj.attr('class') || '';
return (tagStr + idStr + classStr).replace(/\s/g, '');
};
// Unique Random ID
Materialize.guid = function () {
function s4() {
return Math.floor((1 + Math.random()) * 0x10000).toString(16).substring(1);
}
return function () {
return s4() + s4() + '-' + s4() + '-' + s4() + '-' + s4() + '-' + s4() + s4() + s4();
};
}();
/**
* Escapes hash from special characters
* @param {string} hash String returned from this.hash
* @returns {string}
*/
Materialize.escapeHash = function (hash) {
return hash.replace(/(:|\.|\[|\]|,|=)/g, "\\$1");
};
Materialize.elementOrParentIsFixed = function (element) {
var $element = $(element);
var $checkElements = $element.add($element.parents());
var isFixed = false;
$checkElements.each(function () {
if ($(this).css("position") === "fixed") {
isFixed = true;
return false;
}
});
return isFixed;
};
/**
* Get time in ms
* @license https://raw.github.com/jashkenas/underscore/master/LICENSE
* @type {function}
* @return {number}
*/
var getTime = Date.now || function () {
return new Date().getTime();
};
/**
* Returns a function, that, when invoked, will only be triggered at most once
* during a given window of time. Normally, the throttled function will run
* as much as it can, without ever going more than once per `wait` duration;
* but if you'd like to disable the execution on the leading edge, pass
* `{leading: false}`. To disable execution on the trailing edge, ditto.
* @license https://raw.github.com/jashkenas/underscore/master/LICENSE
* @param {function} func
* @param {number} wait
* @param {Object=} options
* @returns {Function}
*/
Materialize.throttle = function (func, wait, options) {
var context, args, result;
var timeout = null;
var previous = 0;
options || (options = {});
var later = function () {
previous = options.leading === false ? 0 : getTime();
timeout = null;
result = func.apply(context, args);
context = args = null;
};
return function () {
var now = getTime();
if (!previous && options.leading === false) previous = now;
var remaining = wait - (now - previous);
context = this;
args = arguments;
if (remaining <= 0) {
clearTimeout(timeout);
timeout = null;
previous = now;
result = func.apply(context, args);
context = args = null;
} else if (!timeout && options.trailing !== false) {
timeout = setTimeout(later, remaining);
}
return result;
};
};
// Velocity has conflicts when loaded with jQuery, this will check for it
// First, check if in noConflict mode
var Vel;
if (jQuery) {
Vel = jQuery.Velocity;
} else if ($) {
Vel = $.Velocity;
} else {
Vel = Velocity;
}
if (Vel) {
Materialize.Vel = Vel;
} else {
Materialize.Vel = Velocity;
}
;(function ($) {
$.fn.collapsible = function (options, methodParam) {
var defaults = {
accordion: undefined,
onOpen: undefined,
onClose: undefined
};
var methodName = options;
options = $.extend(defaults, options);
return this.each(function () {
var $this = $(this);
var $panel_headers = $(this).find('> li > .collapsible-header');
var collapsible_type = $this.data("collapsible");
/****************
Helper Functions
****************/
// Accordion Open
function accordionOpen(object) {
$panel_headers = $this.find('> li > .collapsible-header');
if (object.hasClass('active')) {
object.parent().addClass('active');
} else {
object.parent().removeClass('active');
}
if (object.parent().hasClass('active')) {
object.siblings('.collapsible-body').stop(true, false).slideDown({ duration: 350, easing: "easeOutQuart", queue: false, complete: function () {
$(this).css('height', '');
} });
} else {
object.siblings('.collapsible-body').stop(true, false).slideUp({ duration: 350, easing: "easeOutQuart", queue: false, complete: function () {
$(this).css('height', '');
} });
}
$panel_headers.not(object).removeClass('active').parent().removeClass('active');
// Close previously open accordion elements.
$panel_headers.not(object).parent().children('.collapsible-body').stop(true, false).each(function () {
if ($(this).is(':visible')) {
$(this).slideUp({
duration: 350,
easing: "easeOutQuart",
queue: false,
complete: function () {
$(this).css('height', '');
execCallbacks($(this).siblings('.collapsible-header'));
}
});
}
});
}
// Expandable Open
function expandableOpen(object) {
if (object.hasClass('active')) {
object.parent().addClass('active');
} else {
object.parent().removeClass('active');
}
if (object.parent().hasClass('active')) {
object.siblings('.collapsible-body').stop(true, false).slideDown({ duration: 350, easing: "easeOutQuart", queue: false, complete: function () {
$(this).css('height', '');
} });
} else {
object.siblings('.collapsible-body').stop(true, false).slideUp({ duration: 350, easing: "easeOutQuart", queue: false, complete: function () {
$(this).css('height', '');
} });
}
}
// Open collapsible. object: .collapsible-header
function collapsibleOpen(object, noToggle) {
if (!noToggle) {
object.toggleClass('active');
}
if (options.accordion || collapsible_type === "accordion" || collapsible_type === undefined) {
// Handle Accordion
accordionOpen(object);
} else {
// Handle Expandables
expandableOpen(object);
}
execCallbacks(object);
}
// Handle callbacks
function execCallbacks(object) {
if (object.hasClass('active')) {
if (typeof options.onOpen === "function") {
options.onOpen.call(this, object.parent());
}
} else {
if (typeof options.onClose === "function") {
options.onClose.call(this, object.parent());
}
}
}
/**
* Check if object is children of panel header
* @param {Object} object Jquery object
* @return {Boolean} true if it is children
*/
function isChildrenOfPanelHeader(object) {
var panelHeader = getPanelHeader(object);
return panelHeader.length > 0;
}
/**
* Get panel header from a children element
* @param {Object} object Jquery object
* @return {Object} panel header object
*/
function getPanelHeader(object) {
return object.closest('li > .collapsible-header');
}
// Turn off any existing event handlers
function removeEventHandlers() {
$this.off('click.collapse', '> li > .collapsible-header');
}
/***** End Helper Functions *****/
// Methods
if (methodName === 'destroy') {
removeEventHandlers();
return;
} else if (methodParam >= 0 && methodParam < $panel_headers.length) {
var $curr_header = $panel_headers.eq(methodParam);
if ($curr_header.length && (methodName === 'open' || methodName === 'close' && $curr_header.hasClass('active'))) {
collapsibleOpen($curr_header);
}
return;
}
removeEventHandlers();
// Add click handler to only direct collapsible header children
$this.on('click.collapse', '> li > .collapsible-header', function (e) {
var element = $(e.target);
if (isChildrenOfPanelHeader(element)) {
element = getPanelHeader(element);
}
collapsibleOpen(element);
});
// Open first active
if (options.accordion || collapsible_type === "accordion" || collapsible_type === undefined) {
// Handle Accordion
collapsibleOpen($panel_headers.filter('.active').first(), true);
} else {
// Handle Expandables
$panel_headers.filter('.active').each(function () {
collapsibleOpen($(this), true);
});
}
});
};
$(document).ready(function () {
$('.collapsible').collapsible();
});
})(jQuery);;(function ($) {
// Add posibility to scroll to selected option
// usefull for select for example
$.fn.scrollTo = function (elem) {
$(this).scrollTop($(this).scrollTop() - $(this).offset().top + $(elem).offset().top);
return this;
};
$.fn.dropdown = function (options) {
var defaults = {
inDuration: 300,
outDuration: 225,
constrainWidth: true, // Constrains width of dropdown to the activator
hover: false,
gutter: 0, // Spacing from edge
belowOrigin: false,
alignment: 'left',
stopPropagation: false
};
// Open dropdown.
if (options === "open") {
this.each(function () {
$(this).trigger('open');
});
return false;
}
// Close dropdown.
if (options === "close") {
this.each(function () {
$(this).trigger('close');
});
return false;
}
this.each(function () {
var origin = $(this);
var curr_options = $.extend({}, defaults, options);
var isFocused = false;
// Dropdown menu
var activates = $("#" + origin.attr('data-activates'));
function updateOptions() {
if (origin.data('induration') !== undefined) curr_options.inDuration = origin.data('induration');
if (origin.data('outduration') !== undefined) curr_options.outDuration = origin.data('outduration');
if (origin.data('constrainwidth') !== undefined) curr_options.constrainWidth = origin.data('constrainwidth');
if (origin.data('hover') !== undefined) curr_options.hover = origin.data('hover');
if (origin.data('gutter') !== undefined) curr_options.gutter = origin.data('gutter');
if (origin.data('beloworigin') !== undefined) curr_options.belowOrigin = origin.data('beloworigin');
if (origin.data('alignment') !== undefined) curr_options.alignment = origin.data('alignment');
if (origin.data('stoppropagation') !== undefined) curr_options.stopPropagation = origin.data('stoppropagation');
}
updateOptions();
// Attach dropdown to its activator
origin.after(activates);
/*
Helper function to position and resize dropdown.
Used in hover and click handler.
*/
function placeDropdown(eventType) {
// Check for simultaneous focus and click events.
if (eventType === 'focus') {
isFocused = true;
}
// Check html data attributes
updateOptions();
// Set Dropdown state
activates.addClass('active');
origin.addClass('active');
var originWidth = origin[0].getBoundingClientRect().width;
// Constrain width
if (curr_options.constrainWidth === true) {
activates.css('width', originWidth);
} else {
activates.css('white-space', 'nowrap');
}
// Offscreen detection
var windowHeight = window.innerHeight;
var originHeight = origin.innerHeight();
var offsetLeft = origin.offset().left;
var offsetTop = origin.offset().top - $(window).scrollTop();
var currAlignment = curr_options.alignment;
var gutterSpacing = 0;
var leftPosition = 0;
// Below Origin
var verticalOffset = 0;
if (curr_options.belowOrigin === true) {
verticalOffset = originHeight;
}
// Check for scrolling positioned container.
var scrollYOffset = 0;
var scrollXOffset = 0;
var wrapper = origin.parent();
if (!wrapper.is('body')) {
if (wrapper[0].scrollHeight > wrapper[0].clientHeight) {
scrollYOffset = wrapper[0].scrollTop;
}
if (wrapper[0].scrollWidth > wrapper[0].clientWidth) {
scrollXOffset = wrapper[0].scrollLeft;
}
}
if (offsetLeft + activates.innerWidth() > $(window).width()) {
// Dropdown goes past screen on right, force right alignment
currAlignment = 'right';
} else if (offsetLeft - activates.innerWidth() + origin.innerWidth() < 0) {
// Dropdown goes past screen on left, force left alignment
currAlignment = 'left';
}
// Vertical bottom offscreen detection
if (offsetTop + activates.innerHeight() > windowHeight) {
// If going upwards still goes offscreen, just crop height of dropdown.
if (offsetTop + originHeight - activates.innerHeight() < 0) {
var adjustedHeight = windowHeight - offsetTop - verticalOffset;
activates.css('max-height', adjustedHeight);
} else {
// Flow upwards.
if (!verticalOffset) {
verticalOffset += originHeight;
}
verticalOffset -= activates.innerHeight();
}
}
// Handle edge alignment
if (currAlignment === 'left') {
gutterSpacing = curr_options.gutter;
leftPosition = origin.position().left + gutterSpacing;
} else if (currAlignment === 'right') {
// Material icons fix
activates.stop(true, true).css({
opacity: 0,
left: 0
});
var offsetRight = origin.position().left + originWidth - activates.width();
gutterSpacing = -curr_options.gutter;
leftPosition = offsetRight + gutterSpacing;
}
// Position dropdown
activates.css({
position: 'absolute',
top: origin.position().top + verticalOffset + scrollYOffset,
left: leftPosition + scrollXOffset
});
// Show dropdown
activates.slideDown({
queue: false,
duration: curr_options.inDuration,
easing: 'easeOutCubic',
complete: function () {
$(this).css('height', '');
}
}).animate({ opacity: 1 }, { queue: false, duration: curr_options.inDuration, easing: 'easeOutSine' });
// Add click close handler to document
setTimeout(function () {
$(document).on('click.' + activates.attr('id'), function (e) {
hideDropdown();
$(document).off('click.' + activates.attr('id'));
});
}, 0);
}
function hideDropdown() {
// Check for simultaneous focus and click events.
isFocused = false;
activates.fadeOut(curr_options.outDuration);
activates.removeClass('active');
origin.removeClass('active');
$(document).off('click.' + activates.attr('id'));
setTimeout(function () {
activates.css('max-height', '');
}, curr_options.outDuration);
}
// Hover
if (curr_options.hover) {
var open = false;
origin.off('click.' + origin.attr('id'));
// Hover handler to show dropdown
origin.on('mouseenter', function (e) {
// Mouse over
if (open === false) {
placeDropdown();
open = true;
}
});
origin.on('mouseleave', function (e) {
// If hover on origin then to something other than dropdown content, then close
var toEl = e.toElement || e.relatedTarget; // added browser compatibility for target element
if (!$(toEl).closest('.dropdown-content').is(activates)) {
activates.stop(true, true);
hideDropdown();
open = false;
}
});
activates.on('mouseleave', function (e) {
// Mouse out
var toEl = e.toElement || e.relatedTarget;
if (!$(toEl).closest('.dropdown-button').is(origin)) {
activates.stop(true, true);
hideDropdown();
open = false;
}
});
// Click
} else {
// Click handler to show dropdown
origin.off('click.' + origin.attr('id'));
origin.on('click.' + origin.attr('id'), function (e) {
if (!isFocused) {
if (origin[0] == e.currentTarget && !origin.hasClass('active') && $(e.target).closest('.dropdown-content').length === 0) {
e.preventDefault(); // Prevents button click from moving window
if (curr_options.stopPropagation) {
e.stopPropagation();
}
placeDropdown('click');
}
// If origin is clicked and menu is open, close menu
else if (origin.hasClass('active')) {
hideDropdown();
$(document).off('click.' + activates.attr('id'));
}
}
});
} // End else
// Listen to open and close event - useful for select component
origin.on('open', function (e, eventType) {
placeDropdown(eventType);
});
origin.on('close', hideDropdown);
});
}; // End dropdown plugin
$(document).ready(function () {
$('.dropdown-button').dropdown();
});
})(jQuery);
;(function ($, Vel) {
'use strict';
var _defaults = {
opacity: 0.5,
inDuration: 250,
outDuration: 250,
ready: undefined,
complete: undefined,
dismissible: true,
startingTop: '4%',
endingTop: '10%'
};
/**
* @class
*
*/
var Modal = function () {
/**
* Construct Modal instance and set up overlay
* @constructor
* @param {jQuery} $el
* @param {Object} options
*/
function Modal($el, options) {
_classCallCheck(this, Modal);
// If exists, destroy and reinitialize
if (!!$el[0].M_Modal) {
$el[0].M_Modal.destroy();
}
/**
* The jQuery element
* @type {jQuery}
*/
this.$el = $el;
/**
* Options for the modal
* @member Modal#options
* @prop {Number} [opacity=0.5] - Opacity of the modal overlay
* @prop {Number} [inDuration=250] - Length in ms of enter transition
* @prop {Number} [outDuration=250] - Length in ms of exit transition
* @prop {Function} ready - Callback function called when modal is finished entering
* @prop {Function} complete - Callback function called when modal is finished exiting
* @prop {Boolean} [dismissible=true] - Allow modal to be dismissed by keyboard or overlay click
* @prop {String} [startingTop='4%'] - startingTop
* @prop {String} [endingTop='10%'] - endingTop
*/
this.options = $.extend({}, Modal.defaults, options);
/**
* Describes open/close state of modal
* @type {Boolean}
*/
this.isOpen = false;
this.$el[0].M_Modal = this;
this.id = $el.attr('id');
this.openingTrigger = undefined;
this.$overlay = $('<div class="modal-overlay"></div>');
Modal._increment++;
Modal._count++;
this.$overlay[0].style.zIndex = 1000 + Modal._increment * 2;
this.$el[0].style.zIndex = 1000 + Modal._increment * 2 + 1;
this.setupEventHandlers();
}
_createClass(Modal, [{
key: 'getInstance',
/**
* Get Instance
*/
value: function getInstance() {
return this;
}
/**
* Teardown component
*/
}, {
key: 'destroy',
value: function destroy() {
this.removeEventHandlers();
this.$el[0].removeAttribute('style');
if (!!this.$overlay[0].parentNode) {
this.$overlay[0].parentNode.removeChild(this.$overlay[0]);
}
this.$el[0].M_Modal = undefined;
Modal._count--;
}
/**
* Setup Event Handlers
*/
}, {
key: 'setupEventHandlers',
value: function setupEventHandlers() {
this.handleOverlayClickBound = this.handleOverlayClick.bind(this);
this.handleModalCloseClickBound = this.handleModalCloseClick.bind(this);
if (Modal._count === 1) {
document.body.addEventListener('click', this.handleTriggerClick);
}
this.$overlay[0].addEventListener('click', this.handleOverlayClickBound);
this.$el[0].addEventListener('click', this.handleModalCloseClickBound);
}
/**
* Remove Event Handlers
*/
}, {
key: 'removeEventHandlers',
value: function removeEventHandlers() {
if (Modal._count === 0) {
document.body.removeEventListener('click', this.handleTriggerClick);
}
this.$overlay[0].removeEventListener('click', this.handleOverlayClickBound);
this.$el[0].removeEventListener('click', this.handleModalCloseClickBound);
}
/**
* Handle Trigger Click
* @param {Event} e
*/
}, {
key: 'handleTriggerClick',
value: function handleTriggerClick(e) {
var $trigger = $(e.target).closest('.modal-trigger');
if (e.target && $trigger.length) {
var modalId = $trigger[0].getAttribute('href');
if (modalId) {
modalId = modalId.slice(1);
} else {
modalId = $trigger[0].getAttribute('data-target');
}
var modalInstance = document.getElementById(modalId).M_Modal;
if (modalInstance) {
modalInstance.open($trigger);
}
e.preventDefault();
}
}
/**
* Handle Overlay Click
*/
}, {
key: 'handleOverlayClick',
value: function handleOverlayClick() {
if (this.options.dismissible) {
this.close();
}
}
/**
* Handle Modal Close Click
* @param {Event} e
*/
}, {
key: 'handleModalCloseClick',
value: function handleModalCloseClick(e) {
var $closeTrigger = $(e.target).closest('.modal-close');
if (e.target && $closeTrigger.length) {
this.close();
}
}
/**
* Handle Keydown
* @param {Event} e
*/
}, {
key: 'handleKeydown',
value: function handleKeydown(e) {
// ESC key
if (e.keyCode === 27 && this.options.dismissible) {
this.close();
}
}
/**
* Animate in modal
*/
}, {
key: 'animateIn',
value: function animateIn() {
var _this = this;
// Set initial styles
$.extend(this.$el[0].style, {
display: 'block',
opacity: 0
});
$.extend(this.$overlay[0].style, {
display: 'block',
opacity: 0
});
// Animate overlay
Vel(this.$overlay[0], { opacity: this.options.opacity }, { duration: this.options.inDuration, queue: false, ease: 'easeOutCubic' });
// Define modal animation options
var enterVelocityOptions = {
duration: this.options.inDuration,
queue: false,
ease: 'easeOutCubic',
// Handle modal ready callback
complete: function () {
if (typeof _this.options.ready === 'function') {
_this.options.ready.call(_this, _this.$el, _this.openingTrigger);
}
}
};
// Bottom sheet animation
if (this.$el[0].classList.contains('bottom-sheet')) {
Vel(this.$el[0], { bottom: 0, opacity: 1 }, enterVelocityOptions);
// Normal modal animation
} else {
Vel.hook(this.$el[0], 'scaleX', 0.7);
this.$el[0].style.top = this.options.startingTop;
Vel(this.$el[0], { top: this.options.endingTop, opacity: 1, scaleX: 1 }, enterVelocityOptions);
}
}
/**
* Animate out modal
*/
}, {
key: 'animateOut',
value: function animateOut() {
var _this2 = this;
// Animate overlay
Vel(this.$overlay[0], { opacity: 0 }, { duration: this.options.outDuration, queue: false, ease: 'easeOutQuart' });
// Define modal animation options
var exitVelocityOptions = {
duration: this.options.outDuration,
queue: false,
ease: 'easeOutCubic',
// Handle modal ready callback
complete: function () {
_this2.$el[0].style.display = 'none';
// Call complete callback
if (typeof _this2.options.complete === 'function') {
_this2.options.complete.call(_this2, _this2.$el);
}
_this2.$overlay[0].parentNode.removeChild(_this2.$overlay[0]);
}
};
// Bottom sheet animation
if (this.$el[0].classList.contains('bottom-sheet')) {
Vel(this.$el[0], { bottom: '-100%', opacity: 0 }, exitVelocityOptions);
// Normal modal animation
} else {
Vel(this.$el[0], { top: this.options.startingTop, opacity: 0, scaleX: 0.7 }, exitVelocityOptions);
}
}
/**
* Open Modal
* @param {jQuery} [$trigger]
*/
}, {
key: 'open',
value: function open($trigger) {
if (this.isOpen) {
return;
}
this.isOpen = true;
var body = document.body;
body.style.overflow = 'hidden';
this.$el[0].classList.add('open');
body.appendChild(this.$overlay[0]);
// Set opening trigger, undefined indicates modal was opened by javascript
this.openingTrigger = !!$trigger ? $trigger : undefined;
if (this.options.dismissible) {
this.handleKeydownBound = this.handleKeydown.bind(this);
document.addEventListener('keydown', this.handleKeydownBound);
}
this.animateIn();
return this;
}
/**
* Close Modal
*/
}, {
key: 'close',
value: function close() {
if (!this.isOpen) {
return;
}
this.isOpen = false;
this.$el[0].classList.remove('open');
document.body.style.overflow = '';
if (this.options.dismissible) {
document.removeEventListener('keydown', this.handleKeydownBound);
}
this.animateOut();
return this;
}
}], [{
key: 'init',
value: function init($els, options) {
var arr = [];
$els.each(function () {
arr.push(new Modal($(this), options));
});
return arr;
}
}, {
key: 'defaults',
get: function () {
return _defaults;
}
}]);
return Modal;
}();
/**
* @static
* @memberof Modal
*/
Modal._increment = 0;
/**
* @static
* @memberof Modal
*/
Modal._count = 0;
Materialize.Modal = Modal;
$.fn.modal = function (methodOrOptions) {
// Call plugin method if valid method name is passed in
if (Modal.prototype[methodOrOptions]) {
// Getter methods
if (methodOrOptions.slice(0, 3) === 'get') {
return this.first()[0].M_Modal[methodOrOptions]();
// Void methods
} else {
return this.each(function () {
this.M_Modal[methodOrOptions]();
});
}
// Initialize plugin if options or no argument is passed in
} else if (typeof methodOrOptions === 'object' || !methodOrOptions) {
Modal.init(this, arguments[0]);
return this;
// Return error if an unrecognized method name is passed in
} else {
$.error('Method ' + methodOrOptions + ' does not exist on jQuery.modal');
}
};
})(jQuery, Materialize.Vel);
;(function ($) {
$.fn.materialbox = function () {
return this.each(function () {
if ($(this).hasClass('initialized')) {
return;
}
$(this).addClass('initialized');
var overlayActive = false;
var doneAnimating = true;
var inDuration = 275;
var outDuration = 200;
var origin = $(this);
var placeholder = $('<div></div>').addClass('material-placeholder');
var originalWidth = 0;
var originalHeight = 0;
var ancestorsChanged;
var ancestor;
var originInlineStyles = origin.attr('style');
origin.wrap(placeholder);
// Start click handler
origin.on('click', function () {
var placeholder = origin.parent('.material-placeholder');
var windowWidth = window.innerWidth;
var windowHeight = window.innerHeight;
var originalWidth = origin.width();
var originalHeight = origin.height();
// If already modal, return to original
if (doneAnimating === false) {
returnToOriginal();
return false;
} else if (overlayActive && doneAnimating === true) {
returnToOriginal();
return false;
}
// Set states
doneAnimating = false;
origin.addClass('active');
overlayActive = true;
// Set positioning for placeholder
placeholder.css({
width: placeholder[0].getBoundingClientRect().width,
height: placeholder[0].getBoundingClientRect().height,
position: 'relative',
top: 0,
left: 0
});
// Find ancestor with overflow: hidden; and remove it
ancestorsChanged = undefined;
ancestor = placeholder[0].parentNode;
var count = 0;
while (ancestor !== null && !$(ancestor).is(document)) {
var curr = $(ancestor);
if (curr.css('overflow') !== 'visible') {
curr.css('overflow', 'visible');
if (ancestorsChanged === undefined) {
ancestorsChanged = curr;
} else {
ancestorsChanged = ancestorsChanged.add(curr);
}
}
ancestor = ancestor.parentNode;
}
// Set css on origin
origin.css({
position: 'absolute',
'z-index': 1000,
'will-change': 'left, top, width, height'
}).data('width', originalWidth).data('height', originalHeight);
// Add overlay
var overlay = $('<div id="materialbox-overlay"></div>').css({
opacity: 0
}).click(function () {
if (doneAnimating === true) returnToOriginal();
});
// Put before in origin image to preserve z-index layering.
origin.before(overlay);
// Set dimensions if needed
var overlayOffset = overlay[0].getBoundingClientRect();
overlay.css({
width: windowWidth,
height: windowHeight,
left: -1 * overlayOffset.left,
top: -1 * overlayOffset.top
});
// Animate Overlay
overlay.velocity({ opacity: 1 }, { duration: inDuration, queue: false, easing: 'easeOutQuad' });
// Add and animate caption if it exists
if (origin.data('caption') !== "") {
var $photo_caption = $('<div class="materialbox-caption"></div>');
$photo_caption.text(origin.data('caption'));
$('body').append($photo_caption);
$photo_caption.css({ "display": "inline" });
$photo_caption.velocity({ opacity: 1 }, { duration: inDuration, queue: false, easing: 'easeOutQuad' });
}
// Resize Image
var ratio = 0;
var widthPercent = originalWidth / windowWidth;
var heightPercent = originalHeight / windowHeight;
var newWidth = 0;
var newHeight = 0;
if (widthPercent > heightPercent) {
ratio = originalHeight / originalWidth;
newWidth = windowWidth * 0.9;
newHeight = windowWidth * 0.9 * ratio;
} else {
ratio = originalWidth / originalHeight;
newWidth = windowHeight * 0.9 * ratio;
newHeight = windowHeight * 0.9;
}
// Animate image + set z-index
if (origin.hasClass('responsive-img')) {
origin.velocity({ 'max-width': newWidth, 'width': originalWidth }, { duration: 0, queue: false,
complete: function () {
origin.css({ left: 0, top: 0 }).velocity({
height: newHeight,
width: newWidth,
left: $(document).scrollLeft() + windowWidth / 2 - origin.parent('.material-placeholder').offset().left - newWidth / 2,
top: $(document).scrollTop() + windowHeight / 2 - origin.parent('.material-placeholder').offset().top - newHeight / 2
}, {
duration: inDuration,
queue: false,
easing: 'easeOutQuad',
complete: function () {
doneAnimating = true;
}
});
} // End Complete
}); // End Velocity
} else {
origin.css('left', 0).css('top', 0).velocity({
height: newHeight,
width: newWidth,
left: $(document).scrollLeft() + windowWidth / 2 - origin.parent('.material-placeholder').offset().left - newWidth / 2,
top: $(document).scrollTop() + windowHeight / 2 - origin.parent('.material-placeholder').offset().top - newHeight / 2
}, {
duration: inDuration,
queue: false,
easing: 'easeOutQuad',
complete: function () {
doneAnimating = true;
}
}); // End Velocity
}
// Handle Exit triggers
$(window).on('scroll.materialbox', function () {
if (overlayActive) {
returnToOriginal();
}
});
$(window).on('resize.materialbox', function () {
if (overlayActive) {
returnToOriginal();
}
});
$(document).on('keyup.materialbox', function (e) {
// ESC key
if (e.keyCode === 27 && doneAnimating === true && overlayActive) {
returnToOriginal();
}
});
}); // End click handler
// This function returns the modaled image to the original spot
function returnToOriginal() {
doneAnimating = false;
var placeholder = origin.parent('.material-placeholder');
var windowWidth = window.innerWidth;
var windowHeight = window.innerHeight;
var originalWidth = origin.data('width');
var originalHeight = origin.data('height');
origin.velocity("stop", true);
$('#materialbox-overlay').velocity("stop", true);
$('.materialbox-caption').velocity("stop", true);
// disable exit handlers
$(window).off('scroll.materialbox');
$(document).off('keyup.materialbox');
$(window).off('resize.materialbox');
$('#materialbox-overlay').velocity({ opacity: 0 }, {
duration: outDuration, // Delay prevents animation overlapping
queue: false, easing: 'easeOutQuad',
complete: function () {
// Remove Overlay
overlayActive = false;
$(this).remove();
}
});
// Resize Image
origin.velocity({
width: originalWidth,
height: originalHeight,
left: 0,
top: 0
}, {
duration: outDuration,
queue: false, easing: 'easeOutQuad',
complete: function () {
placeholder.css({
height: '',
width: '',
position: '',
top: '',
left: ''
});
origin.removeAttr('style');
origin.attr('style', originInlineStyles);
// Remove class
origin.removeClass('active');
doneAnimating = true;
// Remove overflow overrides on ancestors
if (ancestorsChanged) {
ancestorsChanged.css('overflow', '');
}
}
});
// Remove Caption + reset css settings on image
$('.materialbox-caption').velocity({ opacity: 0 }, {
duration: outDuration, // Delay prevents animation overlapping
queue: false, easing: 'easeOutQuad',
complete: function () {
$(this).remove();
}
});
}
});
};
$(document).ready(function () {
$('.materialboxed').materialbox();
});
})(jQuery);
;(function ($) {
$.fn.parallax = function () {
var window_width = $(window).width();
// Parallax Scripts
return this.each(function (i) {
var $this = $(this);
$this.addClass('parallax');
function updateParallax(initial) {
var container_height;
if (window_width < 601) {
container_height = $this.height() > 0 ? $this.height() : $this.children("img").height();
} else {
container_height = $this.height() > 0 ? $this.height() : 500;
}
var $img = $this.children("img").first();
var img_height = $img.height();
var parallax_dist = img_height - container_height;
var bottom = $this.offset().top + container_height;
var top = $this.offset().top;
var scrollTop = $(window).scrollTop();
var windowHeight = window.innerHeight;
var windowBottom = scrollTop + windowHeight;
var percentScrolled = (windowBottom - top) / (container_height + windowHeight);
var parallax = Math.round(parallax_dist * percentScrolled);
if (initial) {
$img.css('display', 'block');
}
if (bottom > scrollTop && top < scrollTop + windowHeight) {
$img.css('transform', "translate3D(-50%," + parallax + "px, 0)");
}
}
// Wait for image load
$this.children("img").one("load", function () {
updateParallax(true);
}).each(function () {
if (this.complete) $(this).trigger("load");
});
$(window).scroll(function () {
window_width = $(window).width();
updateParallax(false);
});
$(window).resize(function () {
window_width = $(window).width();
updateParallax(false);
});
});
};
})(jQuery);
;(function ($) {
var methods = {
init: function (options) {
var defaults = {
onShow: null,
swipeable: false,
responsiveThreshold: Infinity // breakpoint for swipeable
};
options = $.extend(defaults, options);
var namespace = Materialize.objectSelectorString($(this));
return this.each(function (i) {
var uniqueNamespace = namespace + i;
// For each set of tabs, we want to keep track of
// which tab is active and its associated content
var $this = $(this),
window_width = $(window).width();
var $active,
$content,
$links = $this.find('li.tab a'),
$tabs_width = $this.width(),
$tabs_content = $(),
$tabs_wrapper,
$tab_width = Math.max($tabs_width, $this[0].scrollWidth) / $links.length,
$indicator,
index = 0,
prev_index = 0,
clicked = false,
clickedTimeout,
transition = 300;
// Finds right attribute for indicator based on active tab.
// el: jQuery Object
var calcRightPos = function (el) {
return Math.ceil($tabs_width - el.position().left - el[0].getBoundingClientRect().width - $this.scrollLeft());
};
// Finds left attribute for indicator based on active tab.
// el: jQuery Object
var calcLeftPos = function (el) {
return Math.floor(el.position().left + $this.scrollLeft());
};
// Animates Indicator to active tab.
// prev_index: Number
var animateIndicator = function (prev_index) {
if (index - prev_index >= 0) {
$indicator.velocity({ "right": calcRightPos($active) }, { duration: transition, queue: false, easing: 'easeOutQuad' });
$indicator.velocity({ "left": calcLeftPos($active) }, { duration: transition, queue: false, easing: 'easeOutQuad', delay: 90 });
} else {
$indicator.velocity({ "left": calcLeftPos($active) }, { duration: transition, queue: false, easing: 'easeOutQuad' });
$indicator.velocity({ "right": calcRightPos($active) }, { duration: transition, queue: false, easing: 'easeOutQuad', delay: 90 });
}
};
// Change swipeable according to responsive threshold
if (options.swipeable) {
if (window_width > options.responsiveThreshold) {
options.swipeable = false;
}
}
// If the location.hash matches one of the links, use that as the active tab.
$active = $($links.filter('[href="' + location.hash + '"]'));
// If no match is found, use the first link or any with class 'active' as the initial active tab.
if ($active.length === 0) {
$active = $(this).find('li.tab a.active').first();
}
if ($active.length === 0) {
$active = $(this).find('li.tab a').first();
}
$active.addClass('active');
index = $links.index($active);
if (index < 0) {
index = 0;
}
if ($active[0] !== undefined) {
$content = $($active[0].hash);
$content.addClass('active');
}
// append indicator then set indicator width to tab width
if (!$this.find('.indicator').length) {
$this.append('<li class="indicator"></li>');
}
$indicator = $this.find('.indicator');
// we make sure that the indicator is at the end of the tabs
$this.append($indicator);
if ($this.is(":visible")) {
// $indicator.css({"right": $tabs_width - ((index + 1) * $tab_width)});
// $indicator.css({"left": index * $tab_width});
setTimeout(function () {
$indicator.css({ "right": calcRightPos($active) });
$indicator.css({ "left": calcLeftPos($active) });
}, 0);
}
$(window).off('resize.tabs-' + uniqueNamespace).on('resize.tabs-' + uniqueNamespace, function () {
$tabs_width = $this.width();
$tab_width = Math.max($tabs_width, $this[0].scrollWidth) / $links.length;
if (index < 0) {
index = 0;
}
if ($tab_width !== 0 && $tabs_width !== 0) {
$indicator.css({ "right": calcRightPos($active) });
$indicator.css({ "left": calcLeftPos($active) });
}
});
// Initialize Tabs Content.
if (options.swipeable) {
// TODO: Duplicate calls with swipeable? handle multiple div wrapping.
$links.each(function () {
var $curr_content = $(Materialize.escapeHash(this.hash));
$curr_content.addClass('carousel-item');
$tabs_content = $tabs_content.add($curr_content);
});
$tabs_wrapper = $tabs_content.wrapAll('<div class="tabs-content carousel"></div>');
$tabs_content.css('display', '');
$('.tabs-content.carousel').carousel({
fullWidth: true,
noWrap: true,
onCycleTo: function (item) {
if (!clicked) {
var prev_index = index;
index = $tabs_wrapper.index(item);
$active.removeClass('active');
$active = $links.eq(index);
$active.addClass('active');
animateIndicator(prev_index);
if (typeof options.onShow === "function") {
options.onShow.call($this[0], $content);
}
}
}
});
} else {
// Hide the remaining content
$links.not($active).each(function () {
$(Materialize.escapeHash(this.hash)).hide();
});
}
// Bind the click event handler
$this.off('click.tabs').on('click.tabs', 'a', function (e) {
if ($(this).parent().hasClass('disabled')) {
e.preventDefault();
return;
}
// Act as regular link if target attribute is specified.
if (!!$(this).attr("target")) {
return;
}
clicked = true;
$tabs_width = $this.width();
$tab_width = Math.max($tabs_width, $this[0].scrollWidth) / $links.length;
// Make the old tab inactive.
$active.removeClass('active');
var $oldContent = $content;
// Update the variables with the new link and content
$active = $(this);
$content = $(Materialize.escapeHash(this.hash));
$links = $this.find('li.tab a');
var activeRect = $active.position();
// Make the tab active.
$active.addClass('active');
prev_index = index;
index = $links.index($(this));
if (index < 0) {
index = 0;
}
// Change url to current tab
// window.location.hash = $active.attr('href');
// Swap content
if (options.swipeable) {
if ($tabs_content.length) {
$tabs_content.carousel('set', index, function () {
if (typeof options.onShow === "function") {
options.onShow.call($this[0], $content);
}
});
}
} else {
if ($content !== undefined) {
$content.show();
$content.addClass('active');
if (typeof options.onShow === "function") {
options.onShow.call(this, $content);
}
}
if ($oldContent !== undefined && !$oldContent.is($content)) {
$oldContent.hide();
$oldContent.removeClass('active');
}
}
// Reset clicked state
clickedTimeout = setTimeout(function () {
clicked = false;
}, transition);
// Update indicator
animateIndicator(prev_index);
// Prevent the anchor's default click action
e.preventDefault();
});
});
},
select_tab: function (id) {
this.find('a[href="#' + id + '"]').trigger('click');
}
};
$.fn.tabs = function (methodOrOptions) {
if (methods[methodOrOptions]) {
return methods[methodOrOptions].apply(this, Array.prototype.slice.call(arguments, 1));
} else if (typeof methodOrOptions === 'object' || !methodOrOptions) {
// Default to "init"
return methods.init.apply(this, arguments);
} else {
$.error('Method ' + methodOrOptions + ' does not exist on jQuery.tabs');
}
};
$(document).ready(function () {
$('ul.tabs').tabs();
});
})(jQuery);
;(function ($) {
$.fn.tooltip = function (options) {
var timeout = null,
margin = 5;
// Defaults
var defaults = {
delay: 350,
tooltip: '',
position: 'bottom',
html: false
};
// Remove tooltip from the activator
if (options === "remove") {
this.each(function () {
$('#' + $(this).attr('data-tooltip-id')).remove();
$(this).removeAttr('data-tooltip-id');
$(this).off('mouseenter.tooltip mouseleave.tooltip');
});
return false;
}
options = $.extend(defaults, options);
return this.each(function () {
var tooltipId = Materialize.guid();
var origin = $(this);
// Destroy old tooltip
if (origin.attr('data-tooltip-id')) {
$('#' + origin.attr('data-tooltip-id')).remove();
}
origin.attr('data-tooltip-id', tooltipId);
// Get attributes.
var allowHtml, tooltipDelay, tooltipPosition, tooltipText, tooltipEl, backdrop;
var setAttributes = function () {
allowHtml = origin.attr('data-html') ? origin.attr('data-html') === 'true' : options.html;
tooltipDelay = origin.attr('data-delay');
tooltipDelay = tooltipDelay === undefined || tooltipDelay === '' ? options.delay : tooltipDelay;
tooltipPosition = origin.attr('data-position');
tooltipPosition = tooltipPosition === undefined || tooltipPosition === '' ? options.position : tooltipPosition;
tooltipText = origin.attr('data-tooltip');
tooltipText = tooltipText === undefined || tooltipText === '' ? options.tooltip : tooltipText;
};
setAttributes();
var renderTooltipEl = function () {
var tooltip = $('<div class="material-tooltip"></div>');
// Create Text span
if (allowHtml) {
tooltipText = $('<span></span>').html(tooltipText);
} else {
tooltipText = $('<span></span>').text(tooltipText);
}
// Create tooltip
tooltip.append(tooltipText).appendTo($('body')).attr('id', tooltipId);
// Create backdrop
backdrop = $('<div class="backdrop"></div>');
backdrop.appendTo(tooltip);
return tooltip;
};
tooltipEl = renderTooltipEl();
// Destroy previously binded events
origin.off('mouseenter.tooltip mouseleave.tooltip');
// Mouse In
var started = false,
timeoutRef;
origin.on({ 'mouseenter.tooltip': function (e) {
var showTooltip = function () {
setAttributes();
started = true;
tooltipEl.velocity('stop');
backdrop.velocity('stop');
tooltipEl.css({ visibility: 'visible', left: '0px', top: '0px' });
// Tooltip positioning
var originWidth = origin.outerWidth();
var originHeight = origin.outerHeight();
var tooltipHeight = tooltipEl.outerHeight();
var tooltipWidth = tooltipEl.outerWidth();
var tooltipVerticalMovement = '0px';
var tooltipHorizontalMovement = '0px';
var backdropOffsetWidth = backdrop[0].offsetWidth;
var backdropOffsetHeight = backdrop[0].offsetHeight;
var scaleXFactor = 8;
var scaleYFactor = 8;
var scaleFactor = 0;
var targetTop, targetLeft, newCoordinates;
if (tooltipPosition === "top") {
// Top Position
targetTop = origin.offset().top - tooltipHeight - margin;
targetLeft = origin.offset().left + originWidth / 2 - tooltipWidth / 2;
newCoordinates = repositionWithinScreen(targetLeft, targetTop, tooltipWidth, tooltipHeight);
tooltipVerticalMovement = '-10px';
backdrop.css({
bottom: 0,
left: 0,
borderRadius: '14px 14px 0 0',
transformOrigin: '50% 100%',
marginTop: tooltipHeight,
marginLeft: tooltipWidth / 2 - backdropOffsetWidth / 2
});
}
// Left Position
else if (tooltipPosition === "left") {
targetTop = origin.offset().top + originHeight / 2 - tooltipHeight / 2;
targetLeft = origin.offset().left - tooltipWidth - margin;
newCoordinates = repositionWithinScreen(targetLeft, targetTop, tooltipWidth, tooltipHeight);
tooltipHorizontalMovement = '-10px';
backdrop.css({
top: '-7px',
right: 0,
width: '14px',
height: '14px',
borderRadius: '14px 0 0 14px',
transformOrigin: '95% 50%',
marginTop: tooltipHeight / 2,
marginLeft: tooltipWidth
});
}
// Right Position
else if (tooltipPosition === "right") {
targetTop = origin.offset().top + originHeight / 2 - tooltipHeight / 2;
targetLeft = origin.offset().left + originWidth + margin;
newCoordinates = repositionWithinScreen(targetLeft, targetTop, tooltipWidth, tooltipHeight);
tooltipHorizontalMovement = '+10px';
backdrop.css({
top: '-7px',
left: 0,
width: '14px',
height: '14px',
borderRadius: '0 14px 14px 0',
transformOrigin: '5% 50%',
marginTop: tooltipHeight / 2,
marginLeft: '0px'
});
} else {
// Bottom Position
targetTop = origin.offset().top + origin.outerHeight() + margin;
targetLeft = origin.offset().left + originWidth / 2 - tooltipWidth / 2;
newCoordinates = repositionWithinScreen(targetLeft, targetTop, tooltipWidth, tooltipHeight);
tooltipVerticalMovement = '+10px';
backdrop.css({
top: 0,
left: 0,
marginLeft: tooltipWidth / 2 - backdropOffsetWidth / 2
});
}
// Set tooptip css placement
tooltipEl.css({
top: newCoordinates.y,
left: newCoordinates.x
});
// Calculate Scale to fill
scaleXFactor = Math.SQRT2 * tooltipWidth / parseInt(backdropOffsetWidth);
scaleYFactor = Math.SQRT2 * tooltipHeight / parseInt(backdropOffsetHeight);
scaleFactor = Math.max(scaleXFactor, scaleYFactor);
tooltipEl.velocity({ translateY: tooltipVerticalMovement, translateX: tooltipHorizontalMovement }, { duration: 350, queue: false }).velocity({ opacity: 1 }, { duration: 300, delay: 50, queue: false });
backdrop.css({ visibility: 'visible' }).velocity({ opacity: 1 }, { duration: 55, delay: 0, queue: false }).velocity({ scaleX: scaleFactor, scaleY: scaleFactor }, { duration: 300, delay: 0, queue: false, easing: 'easeInOutQuad' });
};
timeoutRef = setTimeout(showTooltip, tooltipDelay); // End Interval
// Mouse Out
},
'mouseleave.tooltip': function () {
// Reset State
started = false;
clearTimeout(timeoutRef);
// Animate back
setTimeout(function () {
if (started !== true) {
tooltipEl.velocity({
opacity: 0, translateY: 0, translateX: 0 }, { duration: 225, queue: false });
backdrop.velocity({ opacity: 0, scaleX: 1, scaleY: 1 }, {
duration: 225,
queue: false,
complete: function () {
backdrop.css({ visibility: 'hidden' });
tooltipEl.css({ visibility: 'hidden' });
started = false;
}
});
}
}, 225);
}
});
});
};
var repositionWithinScreen = function (x, y, width, height) {
var newX = x;
var newY = y;
if (newX < 0) {
newX = 4;
} else if (newX + width > window.innerWidth) {
newX -= newX + width - window.innerWidth;
}
if (newY < 0) {
newY = 4;
} else if (newY + height > window.innerHeight + $(window).scrollTop) {
newY -= newY + height - window.innerHeight;
}
return { x: newX, y: newY };
};
$(document).ready(function () {
$('.tooltipped').tooltip();
});
})(jQuery);
; /*!
* Waves v0.6.4
* http://fian.my.id/Waves
*
* Copyright 2014 Alfiana E. Sibuea and other contributors
* Released under the MIT license
* https://github.com/fians/Waves/blob/master/LICENSE
*/
;(function (window) {
'use strict';
var Waves = Waves || {};
var $$ = document.querySelectorAll.bind(document);
// Find exact position of element
function isWindow(obj) {
return obj !== null && obj === obj.window;
}
function getWindow(elem) {
return isWindow(elem) ? elem : elem.nodeType === 9 && elem.defaultView;
}
function offset(elem) {
var docElem,
win,
box = { top: 0, left: 0 },
doc = elem && elem.ownerDocument;
docElem = doc.documentElement;
if (typeof elem.getBoundingClientRect !== typeof undefined) {
box = elem.getBoundingClientRect();
}
win = getWindow(doc);
return {
top: box.top + win.pageYOffset - docElem.clientTop,
left: box.left + win.pageXOffset - docElem.clientLeft
};
}
function convertStyle(obj) {
var style = '';
for (var a in obj) {
if (obj.hasOwnProperty(a)) {
style += a + ':' + obj[a] + ';';
}
}
return style;
}
var Effect = {
// Effect delay
duration: 750,
show: function (e, element) {
// Disable right click
if (e.button === 2) {
return false;
}
var el = element || this;
// Create ripple
var ripple = document.createElement('div');
ripple.className = 'waves-ripple';
el.appendChild(ripple);
// Get click coordinate and element witdh
var pos = offset(el);
var relativeY = e.pageY - pos.top;
var relativeX = e.pageX - pos.left;
var scale = 'scale(' + el.clientWidth / 100 * 10 + ')';
// Support for touch devices
if ('touches' in e) {
relativeY = e.touches[0].pageY - pos.top;
relativeX = e.touches[0].pageX - pos.left;
}
// Attach data to element
ripple.setAttribute('data-hold', Date.now());
ripple.setAttribute('data-scale', scale);
ripple.setAttribute('data-x', relativeX);
ripple.setAttribute('data-y', relativeY);
// Set ripple position
var rippleStyle = {
'top': relativeY + 'px',
'left': relativeX + 'px'
};
ripple.className = ripple.className + ' waves-notransition';
ripple.setAttribute('style', convertStyle(rippleStyle));
ripple.className = ripple.className.replace('waves-notransition', '');
// Scale the ripple
rippleStyle['-webkit-transform'] = scale;
rippleStyle['-moz-transform'] = scale;
rippleStyle['-ms-transform'] = scale;
rippleStyle['-o-transform'] = scale;
rippleStyle.transform = scale;
rippleStyle.opacity = '1';
rippleStyle['-webkit-transition-duration'] = Effect.duration + 'ms';
rippleStyle['-moz-transition-duration'] = Effect.duration + 'ms';
rippleStyle['-o-transition-duration'] = Effect.duration + 'ms';
rippleStyle['transition-duration'] = Effect.duration + 'ms';
rippleStyle['-webkit-transition-timing-function'] = 'cubic-bezier(0.250, 0.460, 0.450, 0.940)';
rippleStyle['-moz-transition-timing-function'] = 'cubic-bezier(0.250, 0.460, 0.450, 0.940)';
rippleStyle['-o-transition-timing-function'] = 'cubic-bezier(0.250, 0.460, 0.450, 0.940)';
rippleStyle['transition-timing-function'] = 'cubic-bezier(0.250, 0.460, 0.450, 0.940)';
ripple.setAttribute('style', convertStyle(rippleStyle));
},
hide: function (e) {
TouchHandler.touchup(e);
var el = this;
var width = el.clientWidth * 1.4;
// Get first ripple
var ripple = null;
var ripples = el.getElementsByClassName('waves-ripple');
if (ripples.length > 0) {
ripple = ripples[ripples.length - 1];
} else {
return false;
}
var relativeX = ripple.getAttribute('data-x');
var relativeY = ripple.getAttribute('data-y');
var scale = ripple.getAttribute('data-scale');
// Get delay beetween mousedown and mouse leave
var diff = Date.now() - Number(ripple.getAttribute('data-hold'));
var delay = 350 - diff;
if (delay < 0) {
delay = 0;
}
// Fade out ripple after delay
setTimeout(function () {
var style = {
'top': relativeY + 'px',
'left': relativeX + 'px',
'opacity': '0',
// Duration
'-webkit-transition-duration': Effect.duration + 'ms',
'-moz-transition-duration': Effect.duration + 'ms',
'-o-transition-duration': Effect.duration + 'ms',
'transition-duration': Effect.duration + 'ms',
'-webkit-transform': scale,
'-moz-transform': scale,
'-ms-transform': scale,
'-o-transform': scale,
'transform': scale
};
ripple.setAttribute('style', convertStyle(style));
setTimeout(function () {
try {
el.removeChild(ripple);
} catch (e) {
return false;
}
}, Effect.duration);
}, delay);
},
// Little hack to make <input> can perform waves effect
wrapInput: function (elements) {
for (var a = 0; a < elements.length; a++) {
var el = elements[a];
if (el.tagName.toLowerCase() === 'input') {
var parent = el.parentNode;
// If input already have parent just pass through
if (parent.tagName.toLowerCase() === 'i' && parent.className.indexOf('waves-effect') !== -1) {
continue;
}
// Put element class and style to the specified parent
var wrapper = document.createElement('i');
wrapper.className = el.className + ' waves-input-wrapper';
var elementStyle = el.getAttribute('style');
if (!elementStyle) {
elementStyle = '';
}
wrapper.setAttribute('style', elementStyle);
el.className = 'waves-button-input';
el.removeAttribute('style');
// Put element as child
parent.replaceChild(wrapper, el);
wrapper.appendChild(el);
}
}
}
};
/**
* Disable mousedown event for 500ms during and after touch
*/
var TouchHandler = {
/* uses an integer rather than bool so there's no issues with
* needing to clear timeouts if another touch event occurred
* within the 500ms. Cannot mouseup between touchstart and
* touchend, nor in the 500ms after touchend. */
touches: 0,
allowEvent: function (e) {
var allow = true;
if (e.type === 'touchstart') {
TouchHandler.touches += 1; //push
} else if (e.type === 'touchend' || e.type === 'touchcancel') {
setTimeout(function () {
if (TouchHandler.touches > 0) {
TouchHandler.touches -= 1; //pop after 500ms
}
}, 500);
} else if (e.type === 'mousedown' && TouchHandler.touches > 0) {
allow = false;
}
return allow;
},
touchup: function (e) {
TouchHandler.allowEvent(e);
}
};
/**
* Delegated click handler for .waves-effect element.
* returns null when .waves-effect element not in "click tree"
*/
function getWavesEffectElement(e) {
if (TouchHandler.allowEvent(e) === false) {
return null;
}
var element = null;
var target = e.target || e.srcElement;
while (target.parentNode !== null) {
if (!(target instanceof SVGElement) && target.className.indexOf('waves-effect') !== -1) {
element = target;
break;
}
target = target.parentNode;
}
return element;
}
/**
* Bubble the click and show effect if .waves-effect elem was found
*/
function showEffect(e) {
var element = getWavesEffectElement(e);
if (element !== null) {
Effect.show(e, element);
if ('ontouchstart' in window) {
element.addEventListener('touchend', Effect.hide, false);
element.addEventListener('touchcancel', Effect.hide, false);
}
element.addEventListener('mouseup', Effect.hide, false);
element.addEventListener('mouseleave', Effect.hide, false);
element.addEventListener('dragend', Effect.hide, false);
}
}
Waves.displayEffect = function (options) {
options = options || {};
if ('duration' in options) {
Effect.duration = options.duration;
}
//Wrap input inside <i> tag
Effect.wrapInput($$('.waves-effect'));
if ('ontouchstart' in window) {
document.body.addEventListener('touchstart', showEffect, false);
}
document.body.addEventListener('mousedown', showEffect, false);
};
/**
* Attach Waves to an input element (or any element which doesn't
* bubble mouseup/mousedown events).
* Intended to be used with dynamically loaded forms/inputs, or
* where the user doesn't want a delegated click handler.
*/
Waves.attach = function (element) {
//FUTURE: automatically add waves classes and allow users
// to specify them with an options param? Eg. light/classic/button
if (element.tagName.toLowerCase() === 'input') {
Effect.wrapInput([element]);
element = element.parentNode;
}
if ('ontouchstart' in window) {
element.addEventListener('touchstart', showEffect, false);
}
element.addEventListener('mousedown', showEffect, false);
};
window.Waves = Waves;
document.addEventListener('DOMContentLoaded', function () {
Waves.displayEffect();
}, false);
})(window);
;(function ($, Vel) {
'use strict';
var _defaults = {
displayLength: Infinity,
inDuration: 300,
outDuration: 375,
className: undefined,
completeCallback: undefined,
activationPercent: 0.8
};
var Toast = function () {
function Toast(message, displayLength, className, completeCallback) {
_classCallCheck(this, Toast);
if (!message) {
return;
}
/**
* Options for the toast
* @member Toast#options
*/
this.options = {
displayLength: displayLength,
className: className,
completeCallback: completeCallback
};
this.options = $.extend({}, Toast.defaults, this.options);
this.message = message;
/**
* Describes current pan state toast
* @type {Boolean}
*/
this.panning = false;
/**
* Time remaining until toast is removed
*/
this.timeRemaining = this.options.displayLength;
if (Toast._toasts.length === 0) {
Toast._createContainer();
}
// Create new toast
Toast._toasts.push(this);
var toastElement = this.createToast();
toastElement.M_Toast = this;
this.el = toastElement;
this._animateIn();
this.setTimer();
}
_createClass(Toast, [{
key: 'createToast',
/**
* Create toast and append it to toast container
*/
value: function createToast() {
var toast = document.createElement('div');
toast.classList.add('toast');
// Add custom classes onto toast
if (this.options.className) {
var classes = this.options.className.split(' ');
var i = void 0,
count = void 0;
for (i = 0, count = classes.length; i < count; i++) {
toast.classList.add(classes[i]);
}
}
// Set content
if (typeof HTMLElement === 'object' ? this.message instanceof HTMLElement : this.message && typeof this.message === 'object' && this.message !== null && this.message.nodeType === 1 && typeof this.message.nodeName === 'string') {
toast.appendChild(this.message);
// Check if it is jQuery object
} else if (this.message instanceof jQuery) {
$(toast).append(this.message);
// Insert as text;
} else {
toast.innerHTML = this.message;
}
// Append toasft
Toast._container.appendChild(toast);
return toast;
}
/**
* Animate in toast
*/
}, {
key: '_animateIn',
value: function _animateIn() {
// Animate toast in
Vel(this.el, { top: 0, opacity: 1 }, {
duration: 300,
easing: 'easeOutCubic',
queue: false
});
}
/**
* Create setInterval which automatically removes toast when timeRemaining >= 0
* has been reached
*/
}, {
key: 'setTimer',
value: function setTimer() {
var _this3 = this;
if (this.timeRemaining !== Infinity) {
this.counterInterval = setInterval(function () {
// If toast is not being dragged, decrease its time remaining
if (!_this3.panning) {
_this3.timeRemaining -= 20;
}
// Animate toast out
if (_this3.timeRemaining <= 0) {
_this3.remove();
}
}, 20);
}
}
/**
* Dismiss toast with animation
*/
}, {
key: 'remove',
value: function remove() {
var _this4 = this;
window.clearInterval(this.counterInterval);
var activationDistance = this.el.offsetWidth * this.options.activationPercent;
if (this.wasSwiped) {
this.el.style.transition = 'transform .05s, opacity .05s';
this.el.style.transform = 'translateX(' + activationDistance + 'px)';
this.el.style.opacity = 0;
}
Vel(this.el, { opacity: 0, marginTop: '-40px' }, {
duration: this.options.outDuration,
easing: 'easeOutExpo',
queue: false,
complete: function () {
// Call the optional callback
if (typeof _this4.options.completeCallback === 'function') {
_this4.options.completeCallback();
}
// Remove toast from DOM
_this4.el.parentNode.removeChild(_this4.el);
Toast._toasts.splice(Toast._toasts.indexOf(_this4), 1);
if (Toast._toasts.length === 0) {
Toast._removeContainer();
}
}
});
}
}], [{
key: '_createContainer',
/**
* Append toast container and add event handlers
*/
value: function _createContainer() {
var container = document.createElement('div');
container.setAttribute('id', 'toast-container');
// Add event handler
container.addEventListener('touchstart', Toast._onDragStart);
container.addEventListener('touchmove', Toast._onDragMove);
container.addEventListener('touchend', Toast._onDragEnd);
container.addEventListener('mousedown', Toast._onDragStart);
document.addEventListener('mousemove', Toast._onDragMove);
document.addEventListener('mouseup', Toast._onDragEnd);
document.body.appendChild(container);
Toast._container = container;
}
/**
* Remove toast container and event handlers
*/
}, {
key: '_removeContainer',
value: function _removeContainer() {
// Add event handler
document.removeEventListener('mousemove', Toast._onDragMove);
document.removeEventListener('mouseup', Toast._onDragEnd);
Toast._container.parentNode.removeChild(Toast._container);
Toast._container = null;
}
/**
* Begin drag handler
* @param {Event} e
*/
}, {
key: '_onDragStart',
value: function _onDragStart(e) {
if (e.target && $(e.target).closest('.toast').length) {
var $toast = $(e.target).closest('.toast');
var toast = $toast[0].M_Toast;
toast.panning = true;
Toast._draggedToast = toast;
toast.el.classList.add('panning');
toast.el.style.transition = '';
toast.startingXPos = Toast._xPos(e);
toast.time = Date.now();
toast.xPos = Toast._xPos(e);
}
}
/**
* Drag move handler
* @param {Event} e
*/
}, {
key: '_onDragMove',
value: function _onDragMove(e) {
if (!!Toast._draggedToast) {
e.preventDefault();
var toast = Toast._draggedToast;
toast.deltaX = Math.abs(toast.xPos - Toast._xPos(e));
toast.xPos = Toast._xPos(e);
toast.velocityX = toast.deltaX / (Date.now() - toast.time);
toast.time = Date.now();
var totalDeltaX = toast.xPos - toast.startingXPos;
var activationDistance = toast.el.offsetWidth * toast.options.activationPercent;
toast.el.style.transform = 'translateX(' + totalDeltaX + 'px)';
toast.el.style.opacity = 1 - Math.abs(totalDeltaX / activationDistance);
}
}
/**
* End drag handler
* @param {Event} e
*/
}, {
key: '_onDragEnd',
value: function _onDragEnd(e) {
if (!!Toast._draggedToast) {
var toast = Toast._draggedToast;
toast.panning = false;
toast.el.classList.remove('panning');
var totalDeltaX = toast.xPos - toast.startingXPos;
var activationDistance = toast.el.offsetWidth * toast.options.activationPercent;
var shouldBeDismissed = Math.abs(totalDeltaX) > activationDistance || toast.velocityX > 1;
// Remove toast
if (shouldBeDismissed) {
toast.wasSwiped = true;
toast.remove();
// Animate toast back to original position
} else {
toast.el.style.transition = 'transform .2s, opacity .2s';
toast.el.style.transform = '';
toast.el.style.opacity = '';
}
Toast._draggedToast = null;
}
}
/**
* Get x position of mouse or touch event
* @param {Event} e
*/
}, {
key: '_xPos',
value: function _xPos(e) {
if (e.targetTouches && e.targetTouches.length >= 1) {
return e.targetTouches[0].clientX;
}
// mouse event
return e.clientX;
}
/**
* Remove all toasts
*/
}, {
key: 'removeAll',
value: function removeAll() {
for (var toastIndex in Toast._toasts) {
Toast._toasts[toastIndex].remove();
}
}
}, {
key: 'defaults',
get: function () {
return _defaults;
}
}]);
return Toast;
}();
/**
* @static
* @memberof Toast
* @type {Array.<Toast>}
*/
Toast._toasts = [];
/**
* @static
* @memberof Toast
*/
Toast._container = null;
/**
* @static
* @memberof Toast
* @type {Toast}
*/
Toast._draggedToast = null;
Materialize.Toast = Toast;
Materialize.toast = function (message, displayLength, className, completeCallback) {
return new Toast(message, displayLength, className, completeCallback);
};
})(jQuery, Materialize.Vel);
;(function ($) {
var methods = {
init: function (options) {
var defaults = {
menuWidth: 300,
edge: 'left',
closeOnClick: false,
draggable: true,
onOpen: null,
onClose: null
};
options = $.extend(defaults, options);
$(this).each(function () {
var $this = $(this);
var menuId = $this.attr('data-activates');
var menu = $("#" + menuId);
// Set to width
if (options.menuWidth != 300) {
menu.css('width', options.menuWidth);
}
// Add Touch Area
var $dragTarget = $('.drag-target[data-sidenav="' + menuId + '"]');
if (options.draggable) {
// Regenerate dragTarget
if ($dragTarget.length) {
$dragTarget.remove();
}
$dragTarget = $('<div class="drag-target"></div>').attr('data-sidenav', menuId);
$('body').append($dragTarget);
} else {
$dragTarget = $();
}
if (options.edge == 'left') {
menu.css('transform', 'translateX(-100%)');
$dragTarget.css({ 'left': 0 }); // Add Touch Area
} else {
menu.addClass('right-aligned') // Change text-alignment to right
.css('transform', 'translateX(100%)');
$dragTarget.css({ 'right': 0 }); // Add Touch Area
}
// If fixed sidenav, bring menu out
if (menu.hasClass('fixed')) {
if (window.innerWidth > 992) {
menu.css('transform', 'translateX(0)');
}
}
// Window resize to reset on large screens fixed
if (menu.hasClass('fixed')) {
$(window).resize(function () {
if (window.innerWidth > 992) {
// Close menu if window is resized bigger than 992 and user has fixed sidenav
if ($('#sidenav-overlay').length !== 0 && menuOut) {
removeMenu(true);
} else {
// menu.removeAttr('style');
menu.css('transform', 'translateX(0%)');
// menu.css('width', options.menuWidth);
}
} else if (menuOut === false) {
if (options.edge === 'left') {
menu.css('transform', 'translateX(-100%)');
} else {
menu.css('transform', 'translateX(100%)');
}
}
});
}
// if closeOnClick, then add close event for all a tags in side sideNav
if (options.closeOnClick === true) {
menu.on("click.itemclick", "a:not(.collapsible-header)", function () {
if (!(window.innerWidth > 992 && menu.hasClass('fixed'))) {
removeMenu();
}
});
}
var removeMenu = function (restoreNav) {
panning = false;
menuOut = false;
// Reenable scrolling
$('body').css({
overflow: '',
width: ''
});
$('#sidenav-overlay').velocity({ opacity: 0 }, { duration: 200,
queue: false, easing: 'easeOutQuad',
complete: function () {
$(this).remove();
} });
if (options.edge === 'left') {
// Reset phantom div
$dragTarget.css({ width: '', right: '', left: '0' });
menu.velocity({ 'translateX': '-100%' }, { duration: 200,
queue: false,
easing: 'easeOutCubic',
complete: function () {
if (restoreNav === true) {
// Restore Fixed sidenav
menu.removeAttr('style');
menu.css('width', options.menuWidth);
}
}
});
} else {
// Reset phantom div
$dragTarget.css({ width: '', right: '0', left: '' });
menu.velocity({ 'translateX': '100%' }, { duration: 200,
queue: false,
easing: 'easeOutCubic',
complete: function () {
if (restoreNav === true) {
// Restore Fixed sidenav
menu.removeAttr('style');
menu.css('width', options.menuWidth);
}
}
});
}
// Callback
if (typeof options.onClose === 'function') {
options.onClose.call(this, menu);
}
};
// Touch Event
var panning = false;
var menuOut = false;
if (options.draggable) {
$dragTarget.on('click', function () {
if (menuOut) {
removeMenu();
}
});
$dragTarget.hammer({
prevent_default: false
}).on('pan', function (e) {
if (e.gesture.pointerType == "touch") {
var direction = e.gesture.direction;
var x = e.gesture.center.x;
var y = e.gesture.center.y;
var velocityX = e.gesture.velocityX;
// Vertical scroll bugfix
if (x === 0 && y === 0) {
return;
}
// Disable Scrolling
var $body = $('body');
var $overlay = $('#sidenav-overlay');
var oldWidth = $body.innerWidth();
$body.css('overflow', 'hidden');
$body.width(oldWidth);
// If overlay does not exist, create one and if it is clicked, close menu
if ($overlay.length === 0) {
$overlay = $('<div id="sidenav-overlay"></div>');
$overlay.css('opacity', 0).click(function () {
removeMenu();
});
// Run 'onOpen' when sidenav is opened via touch/swipe if applicable
if (typeof options.onOpen === 'function') {
options.onOpen.call(this, menu);
}
$('body').append($overlay);
}
// Keep within boundaries
if (options.edge === 'left') {
if (x > options.menuWidth) {
x = options.menuWidth;
} else if (x < 0) {
x = 0;
}
}
if (options.edge === 'left') {
// Left Direction
if (x < options.menuWidth / 2) {
menuOut = false;
}
// Right Direction
else if (x >= options.menuWidth / 2) {
menuOut = true;
}
menu.css('transform', 'translateX(' + (x - options.menuWidth) + 'px)');
} else {
// Left Direction
if (x < window.innerWidth - options.menuWidth / 2) {
menuOut = true;
}
// Right Direction
else if (x >= window.innerWidth - options.menuWidth / 2) {
menuOut = false;
}
var rightPos = x - options.menuWidth / 2;
if (rightPos < 0) {
rightPos = 0;
}
menu.css('transform', 'translateX(' + rightPos + 'px)');
}
// Percentage overlay
var overlayPerc;
if (options.edge === 'left') {
overlayPerc = x / options.menuWidth;
$overlay.velocity({ opacity: overlayPerc }, { duration: 10, queue: false, easing: 'easeOutQuad' });
} else {
overlayPerc = Math.abs((x - window.innerWidth) / options.menuWidth);
$overlay.velocity({ opacity: overlayPerc }, { duration: 10, queue: false, easing: 'easeOutQuad' });
}
}
}).on('panend', function (e) {
if (e.gesture.pointerType == "touch") {
var $overlay = $('#sidenav-overlay');
var velocityX = e.gesture.velocityX;
var x = e.gesture.center.x;
var leftPos = x - options.menuWidth;
var rightPos = x - options.menuWidth / 2;
if (leftPos > 0) {
leftPos = 0;
}
if (rightPos < 0) {
rightPos = 0;
}
panning = false;
if (options.edge === 'left') {
// If velocityX <= 0.3 then the user is flinging the menu closed so ignore menuOut
if (menuOut && velocityX <= 0.3 || velocityX < -0.5) {
// Return menu to open
if (leftPos !== 0) {
menu.velocity({ 'translateX': [0, leftPos] }, { duration: 300, queue: false, easing: 'easeOutQuad' });
}
$overlay.velocity({ opacity: 1 }, { duration: 50, queue: false, easing: 'easeOutQuad' });
$dragTarget.css({ width: '50%', right: 0, left: '' });
menuOut = true;
} else if (!menuOut || velocityX > 0.3) {
// Enable Scrolling
$('body').css({
overflow: '',
width: ''
});
// Slide menu closed
menu.velocity({ 'translateX': [-1 * options.menuWidth - 10, leftPos] }, { duration: 200, queue: false, easing: 'easeOutQuad' });
$overlay.velocity({ opacity: 0 }, { duration: 200, queue: false, easing: 'easeOutQuad',
complete: function () {
// Run 'onClose' when sidenav is closed via touch/swipe if applicable
if (typeof options.onClose === 'function') {
options.onClose.call(this, menu);
}
$(this).remove();
} });
$dragTarget.css({ width: '10px', right: '', left: 0 });
}
} else {
if (menuOut && velocityX >= -0.3 || velocityX > 0.5) {
// Return menu to open
if (rightPos !== 0) {
menu.velocity({ 'translateX': [0, rightPos] }, { duration: 300, queue: false, easing: 'easeOutQuad' });
}
$overlay.velocity({ opacity: 1 }, { duration: 50, queue: false, easing: 'easeOutQuad' });
$dragTarget.css({ width: '50%', right: '', left: 0 });
menuOut = true;
} else if (!menuOut || velocityX < -0.3) {
// Enable Scrolling
$('body').css({
overflow: '',
width: ''
});
// Slide menu closed
menu.velocity({ 'translateX': [options.menuWidth + 10, rightPos] }, { duration: 200, queue: false, easing: 'easeOutQuad' });
$overlay.velocity({ opacity: 0 }, { duration: 200, queue: false, easing: 'easeOutQuad',
complete: function () {
// Run 'onClose' when sidenav is closed via touch/swipe if applicable
if (typeof options.onClose === 'function') {
options.onClose.call(this, menu);
}
$(this).remove();
} });
$dragTarget.css({ width: '10px', right: 0, left: '' });
}
}
}
});
}
$this.off('click.sidenav').on('click.sidenav', function () {
if (menuOut === true) {
menuOut = false;
panning = false;
removeMenu();
} else {
// Disable Scrolling
var $body = $('body');
var $overlay = $('<div id="sidenav-overlay"></div>');
var oldWidth = $body.innerWidth();
$body.css('overflow', 'hidden');
$body.width(oldWidth);
// Push current drag target on top of DOM tree
$('body').append($dragTarget);
if (options.edge === 'left') {
$dragTarget.css({ width: '50%', right: 0, left: '' });
menu.velocity({ 'translateX': [0, -1 * options.menuWidth] }, { duration: 300, queue: false, easing: 'easeOutQuad' });
} else {
$dragTarget.css({ width: '50%', right: '', left: 0 });
menu.velocity({ 'translateX': [0, options.menuWidth] }, { duration: 300, queue: false, easing: 'easeOutQuad' });
}
// Overlay close on click
$overlay.css('opacity', 0).click(function () {
menuOut = false;
panning = false;
removeMenu();
$overlay.velocity({ opacity: 0 }, { duration: 300, queue: false, easing: 'easeOutQuad',
complete: function () {
$(this).remove();
}
});
});
// Append body
$('body').append($overlay);
$overlay.velocity({ opacity: 1 }, { duration: 300, queue: false, easing: 'easeOutQuad',
complete: function () {
menuOut = true;
panning = false;
}
});
// Callback
if (typeof options.onOpen === 'function') {
options.onOpen.call(this, menu);
}
}
return false;
});
});
},
destroy: function () {
var $overlay = $('#sidenav-overlay');
var $dragTarget = $('.drag-target[data-sidenav="' + $(this).attr('data-activates') + '"]');
$overlay.trigger('click');
$dragTarget.remove();
$(this).off('click');
$overlay.remove();
},
show: function () {
this.trigger('click');
},
hide: function () {
$('#sidenav-overlay').trigger('click');
}
};
$.fn.sideNav = function (methodOrOptions) {
if (methods[methodOrOptions]) {
return methods[methodOrOptions].apply(this, Array.prototype.slice.call(arguments, 1));
} else if (typeof methodOrOptions === 'object' || !methodOrOptions) {
// Default to "init"
return methods.init.apply(this, arguments);
} else {
$.error('Method ' + methodOrOptions + ' does not exist on jQuery.sideNav');
}
}; // Plugin end
})(jQuery);
; /**
* Extend jquery with a scrollspy plugin.
* This watches the window scroll and fires events when elements are scrolled into viewport.
*
* throttle() and getTime() taken from Underscore.js
* https://github.com/jashkenas/underscore
*
* @author Copyright 2013 John Smart
* @license https://raw.github.com/thesmart/jquery-scrollspy/master/LICENSE
* @see https://github.com/thesmart
* @version 0.1.2
*/
(function ($) {
var jWindow = $(window);
var elements = [];
var elementsInView = [];
var isSpying = false;
var ticks = 0;
var unique_id = 1;
var offset = {
top: 0,
right: 0,
bottom: 0,
left: 0
/**
* Find elements that are within the boundary
* @param {number} top
* @param {number} right
* @param {number} bottom
* @param {number} left
* @return {jQuery} A collection of elements
*/
};function findElements(top, right, bottom, left) {
var hits = $();
$.each(elements, function (i, element) {
if (element.height() > 0) {
var elTop = element.offset().top,
elLeft = element.offset().left,
elRight = elLeft + element.width(),
elBottom = elTop + element.height();
var isIntersect = !(elLeft > right || elRight < left || elTop > bottom || elBottom < top);
if (isIntersect) {
hits.push(element);
}
}
});
return hits;
}
/**
* Called when the user scrolls the window
*/
function onScroll(scrollOffset) {
// unique tick id
++ticks;
// viewport rectangle
var top = jWindow.scrollTop(),
left = jWindow.scrollLeft(),
right = left + jWindow.width(),
bottom = top + jWindow.height();
// determine which elements are in view
var intersections = findElements(top + offset.top + scrollOffset || 200, right + offset.right, bottom + offset.bottom, left + offset.left);
$.each(intersections, function (i, element) {
var lastTick = element.data('scrollSpy:ticks');
if (typeof lastTick != 'number') {
// entered into view
element.triggerHandler('scrollSpy:enter');
}
// update tick id
element.data('scrollSpy:ticks', ticks);
});
// determine which elements are no longer in view
$.each(elementsInView, function (i, element) {
var lastTick = element.data('scrollSpy:ticks');
if (typeof lastTick == 'number' && lastTick !== ticks) {
// exited from view
element.triggerHandler('scrollSpy:exit');
element.data('scrollSpy:ticks', null);
}
});
// remember elements in view for next tick
elementsInView = intersections;
}
/**
* Called when window is resized
*/
function onWinSize() {
jWindow.trigger('scrollSpy:winSize');
}
/**
* Enables ScrollSpy using a selector
* @param {jQuery|string} selector The elements collection, or a selector
* @param {Object=} options Optional.
throttle : number -> scrollspy throttling. Default: 100 ms
offsetTop : number -> offset from top. Default: 0
offsetRight : number -> offset from right. Default: 0
offsetBottom : number -> offset from bottom. Default: 0
offsetLeft : number -> offset from left. Default: 0
activeClass : string -> Class name to be added to the active link. Default: active
* @returns {jQuery}
*/
$.scrollSpy = function (selector, options) {
var defaults = {
throttle: 100,
scrollOffset: 200, // offset - 200 allows elements near bottom of page to scroll
activeClass: 'active',
getActiveElement: function (id) {
return 'a[href="#' + id + '"]';
}
};
options = $.extend(defaults, options);
var visible = [];
selector = $(selector);
selector.each(function (i, element) {
elements.push($(element));
$(element).data("scrollSpy:id", i);
// Smooth scroll to section
$('a[href="#' + $(element).attr('id') + '"]').click(function (e) {
e.preventDefault();
var offset = $(Materialize.escapeHash(this.hash)).offset().top + 1;
$('html, body').animate({ scrollTop: offset - options.scrollOffset }, { duration: 400, queue: false, easing: 'easeOutCubic' });
});
});
offset.top = options.offsetTop || 0;
offset.right = options.offsetRight || 0;
offset.bottom = options.offsetBottom || 0;
offset.left = options.offsetLeft || 0;
var throttledScroll = Materialize.throttle(function () {
onScroll(options.scrollOffset);
}, options.throttle || 100);
var readyScroll = function () {
$(document).ready(throttledScroll);
};
if (!isSpying) {
jWindow.on('scroll', readyScroll);
jWindow.on('resize', readyScroll);
isSpying = true;
}
// perform a scan once, after current execution context, and after dom is ready
setTimeout(readyScroll, 0);
selector.on('scrollSpy:enter', function () {
visible = $.grep(visible, function (value) {
return value.height() != 0;
});
var $this = $(this);
if (visible[0]) {
$(options.getActiveElement(visible[0].attr('id'))).removeClass(options.activeClass);
if ($this.data('scrollSpy:id') < visible[0].data('scrollSpy:id')) {
visible.unshift($(this));
} else {
visible.push($(this));
}
} else {
visible.push($(this));
}
$(options.getActiveElement(visible[0].attr('id'))).addClass(options.activeClass);
});
selector.on('scrollSpy:exit', function () {
visible = $.grep(visible, function (value) {
return value.height() != 0;
});
if (visible[0]) {
$(options.getActiveElement(visible[0].attr('id'))).removeClass(options.activeClass);
var $this = $(this);
visible = $.grep(visible, function (value) {
return value.attr('id') != $this.attr('id');
});
if (visible[0]) {
// Check if empty
$(options.getActiveElement(visible[0].attr('id'))).addClass(options.activeClass);
}
}
});
return selector;
};
/**
* Listen for window resize events
* @param {Object=} options Optional. Set { throttle: number } to change throttling. Default: 100 ms
* @returns {jQuery} $(window)
*/
$.winSizeSpy = function (options) {
$.winSizeSpy = function () {
return jWindow;
}; // lock from multiple calls
options = options || {
throttle: 100
};
return jWindow.on('resize', Materialize.throttle(onWinSize, options.throttle || 100));
};
/**
* Enables ScrollSpy on a collection of elements
* e.g. $('.scrollSpy').scrollSpy()
* @param {Object=} options Optional.
throttle : number -> scrollspy throttling. Default: 100 ms
offsetTop : number -> offset from top. Default: 0
offsetRight : number -> offset from right. Default: 0
offsetBottom : number -> offset from bottom. Default: 0
offsetLeft : number -> offset from left. Default: 0
* @returns {jQuery}
*/
$.fn.scrollSpy = function (options) {
return $.scrollSpy($(this), options);
};
})(jQuery);
;(function ($) {
$(document).ready(function () {
// Function to update labels of text fields
Materialize.updateTextFields = function () {
var input_selector = 'input[type=text], input[type=password], input[type=email], input[type=url], input[type=tel], input[type=number], input[type=search], textarea';
$(input_selector).each(function (index, element) {
var $this = $(this);
if ($(element).val().length > 0 || $(element).is(':focus') || element.autofocus || $this.attr('placeholder') !== undefined) {
$this.siblings('label').addClass('active');
} else if ($(element)[0].validity) {
$this.siblings('label').toggleClass('active', $(element)[0].validity.badInput === true);
} else {
$this.siblings('label').removeClass('active');
}
});
};
// Text based inputs
var input_selector = 'input[type=text], input[type=password], input[type=email], input[type=url], input[type=tel], input[type=number], input[type=search], textarea';
// Add active if form auto complete
$(document).on('change', input_selector, function () {
if ($(this).val().length !== 0 || $(this).attr('placeholder') !== undefined) {
$(this).siblings('label').addClass('active');
}
validate_field($(this));
});
// Add active if input element has been pre-populated on document ready
$(document).ready(function () {
Materialize.updateTextFields();
});
// HTML DOM FORM RESET handling
$(document).on('reset', function (e) {
var formReset = $(e.target);
if (formReset.is('form')) {
formReset.find(input_selector).removeClass('valid').removeClass('invalid');
formReset.find(input_selector).each(function () {
if ($(this).attr('value') === '') {
$(this).siblings('label').removeClass('active');
}
});
// Reset select
formReset.find('select.initialized').each(function () {
var reset_text = formReset.find('option[selected]').text();
formReset.siblings('input.select-dropdown').val(reset_text);
});
}
});
// Add active when element has focus
$(document).on('focus', input_selector, function () {
$(this).siblings('label, .prefix').addClass('active');
});
$(document).on('blur', input_selector, function () {
var $inputElement = $(this);
var selector = ".prefix";
if ($inputElement.val().length === 0 && $inputElement[0].validity.badInput !== true && $inputElement.attr('placeholder') === undefined) {
selector += ", label";
}
$inputElement.siblings(selector).removeClass('active');
validate_field($inputElement);
});
window.validate_field = function (object) {
var hasLength = object.attr('data-length') !== undefined;
var lenAttr = parseInt(object.attr('data-length'));
var len = object.val().length;
if (object.val().length === 0 && object[0].validity.badInput === false && !object.is(':required')) {
if (object.hasClass('validate')) {
object.removeClass('valid');
object.removeClass('invalid');
}
} else {
if (object.hasClass('validate')) {
// Check for character counter attributes
if (object.is(':valid') && hasLength && len <= lenAttr || object.is(':valid') && !hasLength) {
object.removeClass('invalid');
object.addClass('valid');
} else {
object.removeClass('valid');
object.addClass('invalid');
}
}
}
};
// Radio and Checkbox focus class
var radio_checkbox = 'input[type=radio], input[type=checkbox]';
$(document).on('keyup.radio', radio_checkbox, function (e) {
// TAB, check if tabbing to radio or checkbox.
if (e.which === 9) {
$(this).addClass('tabbed');
var $this = $(this);
$this.one('blur', function (e) {
$(this).removeClass('tabbed');
});
return;
}
});
// Textarea Auto Resize
var hiddenDiv = $('.hiddendiv').first();
if (!hiddenDiv.length) {
hiddenDiv = $('<div class="hiddendiv common"></div>');
$('body').append(hiddenDiv);
}
var text_area_selector = '.materialize-textarea';
function textareaAutoResize($textarea) {
// Set font properties of hiddenDiv
var fontFamily = $textarea.css('font-family');
var fontSize = $textarea.css('font-size');
var lineHeight = $textarea.css('line-height');
var padding = $textarea.css('padding');
if (fontSize) {
hiddenDiv.css('font-size', fontSize);
}
if (fontFamily) {
hiddenDiv.css('font-family', fontFamily);
}
if (lineHeight) {
hiddenDiv.css('line-height', lineHeight);
}
if (padding) {
hiddenDiv.css('padding', padding);
}
// Set original-height, if none
if (!$textarea.data('original-height')) {
$textarea.data('original-height', $textarea.height());
}
if ($textarea.attr('wrap') === 'off') {
hiddenDiv.css('overflow-wrap', 'normal').css('white-space', 'pre');
}
hiddenDiv.text($textarea.val() + '\n');
var content = hiddenDiv.html().replace(/\n/g, '<br>');
hiddenDiv.html(content);
// When textarea is hidden, width goes crazy.
// Approximate with half of window size
if ($textarea.is(':visible')) {
hiddenDiv.css('width', $textarea.width());
} else {
hiddenDiv.css('width', $(window).width() / 2);
}
/**
* Resize if the new height is greater than the
* original height of the textarea
*/
if ($textarea.data('original-height') <= hiddenDiv.height()) {
$textarea.css('height', hiddenDiv.height());
} else if ($textarea.val().length < $textarea.data('previous-length')) {
/**
* In case the new height is less than original height, it
* means the textarea has less text than before
* So we set the height to the original one
*/
$textarea.css('height', $textarea.data('original-height'));
}
$textarea.data('previous-length', $textarea.val().length);
}
$(text_area_selector).each(function () {
var $textarea = $(this);
/**
* Instead of resizing textarea on document load,
* store the original height and the original length
*/
$textarea.data('original-height', $textarea.height());
$textarea.data('previous-length', $textarea.val().length);
});
$('body').on('keyup keydown autoresize', text_area_selector, function () {
textareaAutoResize($(this));
});
// File Input Path
$(document).on('change', '.file-field input[type="file"]', function () {
var file_field = $(this).closest('.file-field');
var path_input = file_field.find('input.file-path');
var files = $(this)[0].files;
var file_names = [];
for (var i = 0; i < files.length; i++) {
file_names.push(files[i].name);
}
path_input.val(file_names.join(", "));
path_input.trigger('change');
});
/****************
* Range Input *
****************/
var range_type = 'input[type=range]';
var range_mousedown = false;
var left;
$(range_type).each(function () {
var thumb = $('<span class="thumb"><span class="value"></span></span>');
$(this).after(thumb);
});
var showRangeBubble = function (thumb) {
var paddingLeft = parseInt(thumb.parent().css('padding-left'));
var marginLeft = -7 + paddingLeft + 'px';
thumb.velocity({ height: "30px", width: "30px", top: "-30px", marginLeft: marginLeft }, { duration: 300, easing: 'easeOutExpo' });
};
var calcRangeOffset = function (range) {
var width = range.width() - 15;
var max = parseFloat(range.attr('max'));
var min = parseFloat(range.attr('min'));
var percent = (parseFloat(range.val()) - min) / (max - min);
return percent * width;
};
var range_wrapper = '.range-field';
$(document).on('change', range_type, function (e) {
var thumb = $(this).siblings('.thumb');
thumb.find('.value').html($(this).val());
if (!thumb.hasClass('active')) {
showRangeBubble(thumb);
}
var offsetLeft = calcRangeOffset($(this));
thumb.addClass('active').css('left', offsetLeft);
});
$(document).on('mousedown touchstart', range_type, function (e) {
var thumb = $(this).siblings('.thumb');
// If thumb indicator does not exist yet, create it
if (thumb.length <= 0) {
thumb = $('<span class="thumb"><span class="value"></span></span>');
$(this).after(thumb);
}
// Set indicator value
thumb.find('.value').html($(this).val());
range_mousedown = true;
$(this).addClass('active');
if (!thumb.hasClass('active')) {
showRangeBubble(thumb);
}
if (e.type !== 'input') {
var offsetLeft = calcRangeOffset($(this));
thumb.addClass('active').css('left', offsetLeft);
}
});
$(document).on('mouseup touchend', range_wrapper, function () {
range_mousedown = false;
$(this).removeClass('active');
});
$(document).on('input mousemove touchmove', range_wrapper, function (e) {
var thumb = $(this).children('.thumb');
var left;
var input = $(this).find(range_type);
if (range_mousedown) {
if (!thumb.hasClass('active')) {
showRangeBubble(thumb);
}
var offsetLeft = calcRangeOffset(input);
thumb.addClass('active').css('left', offsetLeft);
thumb.find('.value').html(thumb.siblings(range_type).val());
}
});
$(document).on('mouseout touchleave', range_wrapper, function () {
if (!range_mousedown) {
var thumb = $(this).children('.thumb');
var paddingLeft = parseInt($(this).css('padding-left'));
var marginLeft = 7 + paddingLeft + 'px';
if (thumb.hasClass('active')) {
thumb.velocity({ height: '0', width: '0', top: '10px', marginLeft: marginLeft }, { duration: 100 });
}
thumb.removeClass('active');
}
});
/**************************
* Auto complete plugin *
*************************/
$.fn.autocomplete = function (options) {
// Defaults
var defaults = {
data: {},
limit: Infinity,
onAutocomplete: null,
minLength: 1
};
options = $.extend(defaults, options);
return this.each(function () {
var $input = $(this);
var data = options.data,
count = 0,
activeIndex = -1,
oldVal,
$inputDiv = $input.closest('.input-field'); // Div to append on
// Check if data isn't empty
if (!$.isEmptyObject(data)) {
var $autocomplete = $('<ul class="autocomplete-content dropdown-content"></ul>');
var $oldAutocomplete;
// Append autocomplete element.
// Prevent double structure init.
if ($inputDiv.length) {
$oldAutocomplete = $inputDiv.children('.autocomplete-content.dropdown-content').first();
if (!$oldAutocomplete.length) {
$inputDiv.append($autocomplete); // Set ul in body
}
} else {
$oldAutocomplete = $input.next('.autocomplete-content.dropdown-content');
if (!$oldAutocomplete.length) {
$input.after($autocomplete);
}
}
if ($oldAutocomplete.length) {
$autocomplete = $oldAutocomplete;
}
// Highlight partial match.
var highlight = function (string, $el) {
var img = $el.find('img');
var matchStart = $el.text().toLowerCase().indexOf("" + string.toLowerCase() + ""),
matchEnd = matchStart + string.length - 1,
beforeMatch = $el.text().slice(0, matchStart),
matchText = $el.text().slice(matchStart, matchEnd + 1),
afterMatch = $el.text().slice(matchEnd + 1);
$el.html("<span>" + beforeMatch + "<span class='highlight'>" + matchText + "</span>" + afterMatch + "</span>");
if (img.length) {
$el.prepend(img);
}
};
// Reset current element position
var resetCurrentElement = function () {
activeIndex = -1;
$autocomplete.find('.active').removeClass('active');
};
// Remove autocomplete elements
var removeAutocomplete = function () {
$autocomplete.empty();
resetCurrentElement();
oldVal = undefined;
};
$input.off('blur.autocomplete').on('blur.autocomplete', function () {
removeAutocomplete();
});
// Perform search
$input.off('keyup.autocomplete focus.autocomplete').on('keyup.autocomplete focus.autocomplete', function (e) {
// Reset count.
count = 0;
var val = $input.val().toLowerCase();
// Don't capture enter or arrow key usage.
if (e.which === 13 || e.which === 38 || e.which === 40) {
return;
}
// Check if the input isn't empty
if (oldVal !== val) {
removeAutocomplete();
if (val.length >= options.minLength) {
for (var key in data) {
if (data.hasOwnProperty(key) && key.toLowerCase().indexOf(val) !== -1) {
// Break if past limit
if (count >= options.limit) {
break;
}
var autocompleteOption = $('<li></li>');
if (!!data[key]) {
autocompleteOption.append('<img src="' + data[key] + '" class="right circle"><span>' + key + '</span>');
} else {
autocompleteOption.append('<span>' + key + '</span>');
}
$autocomplete.append(autocompleteOption);
highlight(val, autocompleteOption);
count++;
}
}
}
}
// Update oldVal
oldVal = val;
});
$input.off('keydown.autocomplete').on('keydown.autocomplete', function (e) {
// Arrow keys and enter key usage
var keyCode = e.which,
liElement,
numItems = $autocomplete.children('li').length,
$active = $autocomplete.children('.active').first();
// select element on Enter
if (keyCode === 13 && activeIndex >= 0) {
liElement = $autocomplete.children('li').eq(activeIndex);
if (liElement.length) {
liElement.trigger('mousedown.autocomplete');
e.preventDefault();
}
return;
}
// Capture up and down key
if (keyCode === 38 || keyCode === 40) {
e.preventDefault();
if (keyCode === 38 && activeIndex > 0) {
activeIndex--;
}
if (keyCode === 40 && activeIndex < numItems - 1) {
activeIndex++;
}
$active.removeClass('active');
if (activeIndex >= 0) {
$autocomplete.children('li').eq(activeIndex).addClass('active');
}
}
});
// Set input value
$autocomplete.off('mousedown.autocomplete touchstart.autocomplete').on('mousedown.autocomplete touchstart.autocomplete', 'li', function () {
var text = $(this).text().trim();
$input.val(text);
$input.trigger('change');
removeAutocomplete();
// Handle onAutocomplete callback.
if (typeof options.onAutocomplete === "function") {
options.onAutocomplete.call(this, text);
}
});
// Empty data
} else {
$input.off('keyup.autocomplete focus.autocomplete');
}
});
};
}); // End of $(document).ready
/*******************
* Select Plugin *
******************/
$.fn.material_select = function (callback) {
$(this).each(function () {
var $select = $(this);
if ($select.hasClass('browser-default')) {
return; // Continue to next (return false breaks out of entire loop)
}
var multiple = $select.attr('multiple') ? true : false,
lastID = $select.attr('data-select-id'); // Tear down structure if Select needs to be rebuilt
if (lastID) {
$select.parent().find('span.caret').remove();
$select.parent().find('input').remove();
$select.unwrap();
$('ul#select-options-' + lastID).remove();
}
// If destroying the select, remove the selelct-id and reset it to it's uninitialized state.
if (callback === 'destroy') {
$select.removeAttr('data-select-id').removeClass('initialized');
$(window).off('click.select');
return;
}
var uniqueID = Materialize.guid();
$select.attr('data-select-id', uniqueID);
var wrapper = $('<div class="select-wrapper"></div>');
wrapper.addClass($select.attr('class'));
if ($select.is(':disabled')) wrapper.addClass('disabled');
var options = $('<ul id="select-options-' + uniqueID + '" class="dropdown-content select-dropdown ' + (multiple ? 'multiple-select-dropdown' : '') + '"></ul>'),
selectChildren = $select.children('option, optgroup'),
valuesSelected = [],
optionsHover = false;
var label = $select.find('option:selected').html() || $select.find('option:first').html() || "";
// Function that renders and appends the option taking into
// account type and possible image icon.
var appendOptionWithIcon = function (select, option, type) {
// Add disabled attr if disabled
var disabledClass = option.is(':disabled') ? 'disabled ' : '';
var optgroupClass = type === 'optgroup-option' ? 'optgroup-option ' : '';
var multipleCheckbox = multiple ? '<input type="checkbox"' + disabledClass + '/><label></label>' : '';
// add icons
var icon_url = option.data('icon');
var classes = option.attr('class');
if (!!icon_url) {
var classString = '';
if (!!classes) classString = ' class="' + classes + '"';
// Check for multiple type.
options.append($('<li class="' + disabledClass + optgroupClass + '"><img alt="" src="' + icon_url + '"' + classString + '><span>' + multipleCheckbox + option.html() + '</span></li>'));
return true;
}
// Check for multiple type.
options.append($('<li class="' + disabledClass + optgroupClass + '"><span>' + multipleCheckbox + option.html() + '</span></li>'));
};
/* Create dropdown structure. */
if (selectChildren.length) {
selectChildren.each(function () {
if ($(this).is('option')) {
// Direct descendant option.
if (multiple) {
appendOptionWithIcon($select, $(this), 'multiple');
} else {
appendOptionWithIcon($select, $(this));
}
} else if ($(this).is('optgroup')) {
// Optgroup.
var selectOptions = $(this).children('option');
options.append($('<li class="optgroup"><span>' + $(this).attr('label') + '</span></li>'));
selectOptions.each(function () {
appendOptionWithIcon($select, $(this), 'optgroup-option');
});
}
});
}
options.find('li:not(.optgroup)').each(function (i) {
$(this).click(function (e) {
// Check if option element is disabled
if (!$(this).hasClass('disabled') && !$(this).hasClass('optgroup')) {
var selected = true;
if (multiple) {
$('input[type="checkbox"]', this).prop('checked', function (i, v) {
return !v;
});
selected = toggleEntryFromArray(valuesSelected, i, $select);
$newSelect.trigger('focus');
} else {
options.find('li').removeClass('active');
$(this).toggleClass('active');
$newSelect.val($(this).text());
}
activateOption(options, $(this));
$select.find('option').eq(i).prop('selected', selected);
// Trigger onchange() event
$select.trigger('change');
if (typeof callback !== 'undefined') callback();
}
e.stopPropagation();
});
});
// Wrap Elements
$select.wrap(wrapper);
// Add Select Display Element
var dropdownIcon = $('<span class="caret">&#9660;</span>');
// escape double quotes
var sanitizedLabelHtml = label.replace(/"/g, '&quot;');
var $newSelect = $('<input type="text" class="select-dropdown" readonly="true" ' + ($select.is(':disabled') ? 'disabled' : '') + ' data-activates="select-options-' + uniqueID + '" value="' + sanitizedLabelHtml + '"/>');
$select.before($newSelect);
$newSelect.before(dropdownIcon);
$newSelect.after(options);
// Check if section element is disabled
if (!$select.is(':disabled')) {
$newSelect.dropdown({ 'hover': false });
}
// Copy tabindex
if ($select.attr('tabindex')) {
$($newSelect[0]).attr('tabindex', $select.attr('tabindex'));
}
$select.addClass('initialized');
$newSelect.on({
'focus': function () {
if ($('ul.select-dropdown').not(options[0]).is(':visible')) {
$('input.select-dropdown').trigger('close');
$(window).off('click.select');
}
if (!options.is(':visible')) {
$(this).trigger('open', ['focus']);
var label = $(this).val();
if (multiple && label.indexOf(',') >= 0) {
label = label.split(',')[0];
}
var selectedOption = options.find('li').filter(function () {
return $(this).text().toLowerCase() === label.toLowerCase();
})[0];
activateOption(options, selectedOption, true);
$(window).off('click.select').on('click.select', function () {
multiple && (optionsHover || $newSelect.trigger('close'));
$(window).off('click.select');
});
}
},
'click': function (e) {
e.stopPropagation();
}
});
$newSelect.on('blur', function () {
if (!multiple) {
$(this).trigger('close');
$(window).off('click.select');
}
options.find('li.selected').removeClass('selected');
});
options.hover(function () {
optionsHover = true;
}, function () {
optionsHover = false;
});
// Add initial multiple selections.
if (multiple) {
$select.find("option:selected:not(:disabled)").each(function () {
var index = this.index;
toggleEntryFromArray(valuesSelected, index, $select);
options.find("li:not(.optgroup)").eq(index).find(":checkbox").prop("checked", true);
});
}
/**
* Make option as selected and scroll to selected position
* @param {jQuery} collection Select options jQuery element
* @param {Element} newOption element of the new option
* @param {Boolean} firstActivation If on first activation of select
*/
var activateOption = function (collection, newOption, firstActivation) {
if (newOption) {
collection.find('li.selected').removeClass('selected');
var option = $(newOption);
option.addClass('selected');
if (!multiple || !!firstActivation) {
options.scrollTo(option);
}
}
};
// Allow user to search by typing
// this array is cleared after 1 second
var filterQuery = [],
onKeyDown = function (e) {
// TAB - switch to another input
if (e.which == 9) {
$newSelect.trigger('close');
return;
}
// ARROW DOWN WHEN SELECT IS CLOSED - open select options
if (e.which == 40 && !options.is(':visible')) {
$newSelect.trigger('open');
return;
}
// ENTER WHEN SELECT IS CLOSED - submit form
if (e.which == 13 && !options.is(':visible')) {
return;
}
e.preventDefault();
// CASE WHEN USER TYPE LETTERS
var letter = String.fromCharCode(e.which).toLowerCase(),
nonLetters = [9, 13, 27, 38, 40];
if (letter && nonLetters.indexOf(e.which) === -1) {
filterQuery.push(letter);
var string = filterQuery.join(''),
newOption = options.find('li').filter(function () {
return $(this).text().toLowerCase().indexOf(string) === 0;
})[0];
if (newOption) {
activateOption(options, newOption);
}
}
// ENTER - select option and close when select options are opened
if (e.which == 13) {
var activeOption = options.find('li.selected:not(.disabled)')[0];
if (activeOption) {
$(activeOption).trigger('click');
if (!multiple) {
$newSelect.trigger('close');
}
}
}
// ARROW DOWN - move to next not disabled option
if (e.which == 40) {
if (options.find('li.selected').length) {
newOption = options.find('li.selected').next('li:not(.disabled)')[0];
} else {
newOption = options.find('li:not(.disabled)')[0];
}
activateOption(options, newOption);
}
// ESC - close options
if (e.which == 27) {
$newSelect.trigger('close');
}
// ARROW UP - move to previous not disabled option
if (e.which == 38) {
newOption = options.find('li.selected').prev('li:not(.disabled)')[0];
if (newOption) activateOption(options, newOption);
}
// Automaticaly clean filter query so user can search again by starting letters
setTimeout(function () {
filterQuery = [];
}, 1000);
};
$newSelect.on('keydown', onKeyDown);
});
function toggleEntryFromArray(entriesArray, entryIndex, select) {
var index = entriesArray.indexOf(entryIndex),
notAdded = index === -1;
if (notAdded) {
entriesArray.push(entryIndex);
} else {
entriesArray.splice(index, 1);
}
select.siblings('ul.dropdown-content').find('li:not(.optgroup)').eq(entryIndex).toggleClass('active');
// use notAdded instead of true (to detect if the option is selected or not)
select.find('option').eq(entryIndex).prop('selected', notAdded);
setValueToInput(entriesArray, select);
return notAdded;
}
function setValueToInput(entriesArray, select) {
var value = '';
for (var i = 0, count = entriesArray.length; i < count; i++) {
var text = select.find('option').eq(entriesArray[i]).text();
i === 0 ? value += text : value += ', ' + text;
}
if (value === '') {
value = select.find('option:disabled').eq(0).text();
}
select.siblings('input.select-dropdown').val(value);
}
};
})(jQuery);
;(function ($) {
var methods = {
init: function (options) {
var defaults = {
indicators: true,
height: 400,
transition: 500,
interval: 6000
};
options = $.extend(defaults, options);
return this.each(function () {
// For each slider, we want to keep track of
// which slide is active and its associated content
var $this = $(this);
var $slider = $this.find('ul.slides').first();
var $slides = $slider.find('> li');
var $active_index = $slider.find('.active').index();
var $active, $indicators, $interval;
if ($active_index != -1) {
$active = $slides.eq($active_index);
}
// Transitions the caption depending on alignment
function captionTransition(caption, duration) {
if (caption.hasClass("center-align")) {
caption.velocity({ opacity: 0, translateY: -100 }, { duration: duration, queue: false });
} else if (caption.hasClass("right-align")) {
caption.velocity({ opacity: 0, translateX: 100 }, { duration: duration, queue: false });
} else if (caption.hasClass("left-align")) {
caption.velocity({ opacity: 0, translateX: -100 }, { duration: duration, queue: false });
}
}
// This function will transition the slide to any index of the next slide
function moveToSlide(index) {
// Wrap around indices.
if (index >= $slides.length) index = 0;else if (index < 0) index = $slides.length - 1;
$active_index = $slider.find('.active').index();
// Only do if index changes
if ($active_index != index) {
$active = $slides.eq($active_index);
$caption = $active.find('.caption');
$active.removeClass('active');
$active.velocity({ opacity: 0 }, { duration: options.transition, queue: false, easing: 'easeOutQuad',
complete: function () {
$slides.not('.active').velocity({ opacity: 0, translateX: 0, translateY: 0 }, { duration: 0, queue: false });
} });
captionTransition($caption, options.transition);
// Update indicators
if (options.indicators) {
$indicators.eq($active_index).removeClass('active');
}
$slides.eq(index).velocity({ opacity: 1 }, { duration: options.transition, queue: false, easing: 'easeOutQuad' });
$slides.eq(index).find('.caption').velocity({ opacity: 1, translateX: 0, translateY: 0 }, { duration: options.transition, delay: options.transition, queue: false, easing: 'easeOutQuad' });
$slides.eq(index).addClass('active');
// Update indicators
if (options.indicators) {
$indicators.eq(index).addClass('active');
}
}
}
// Set height of slider
// If fullscreen, do nothing
if (!$this.hasClass('fullscreen')) {
if (options.indicators) {
// Add height if indicators are present
$this.height(options.height + 40);
} else {
$this.height(options.height);
}
$slider.height(options.height);
}
// Set initial positions of captions
$slides.find('.caption').each(function () {
captionTransition($(this), 0);
});
// Move img src into background-image
$slides.find('img').each(function () {
var placeholderBase64 = 'data:image/gif;base64,R0lGODlhAQABAIABAP///wAAACH5BAEKAAEALAAAAAABAAEAAAICTAEAOw==';
if ($(this).attr('src') !== placeholderBase64) {
$(this).css('background-image', 'url("' + $(this).attr('src') + '")');
$(this).attr('src', placeholderBase64);
}
});
// dynamically add indicators
if (options.indicators) {
$indicators = $('<ul class="indicators"></ul>');
$slides.each(function (index) {
var $indicator = $('<li class="indicator-item"></li>');
// Handle clicks on indicators
$indicator.click(function () {
var $parent = $slider.parent();
var curr_index = $parent.find($(this)).index();
moveToSlide(curr_index);
// reset interval
clearInterval($interval);
$interval = setInterval(function () {
$active_index = $slider.find('.active').index();
if ($slides.length == $active_index + 1) $active_index = 0; // loop to start
else $active_index += 1;
moveToSlide($active_index);
}, options.transition + options.interval);
});
$indicators.append($indicator);
});
$this.append($indicators);
$indicators = $this.find('ul.indicators').find('li.indicator-item');
}
if ($active) {
$active.show();
} else {
$slides.first().addClass('active').velocity({ opacity: 1 }, { duration: options.transition, queue: false, easing: 'easeOutQuad' });
$active_index = 0;
$active = $slides.eq($active_index);
// Update indicators
if (options.indicators) {
$indicators.eq($active_index).addClass('active');
}
}
// Adjust height to current slide
$active.find('img').each(function () {
$active.find('.caption').velocity({ opacity: 1, translateX: 0, translateY: 0 }, { duration: options.transition, queue: false, easing: 'easeOutQuad' });
});
// auto scroll
$interval = setInterval(function () {
$active_index = $slider.find('.active').index();
moveToSlide($active_index + 1);
}, options.transition + options.interval);
// HammerJS, Swipe navigation
// Touch Event
var panning = false;
var swipeLeft = false;
var swipeRight = false;
$this.hammer({
prevent_default: false
}).on('pan', function (e) {
if (e.gesture.pointerType === "touch") {
// reset interval
clearInterval($interval);
var direction = e.gesture.direction;
var x = e.gesture.deltaX;
var velocityX = e.gesture.velocityX;
var velocityY = e.gesture.velocityY;
$curr_slide = $slider.find('.active');
if (Math.abs(velocityX) > Math.abs(velocityY)) {
$curr_slide.velocity({ translateX: x
}, { duration: 50, queue: false, easing: 'easeOutQuad' });
}
// Swipe Left
if (direction === 4 && (x > $this.innerWidth() / 2 || velocityX < -0.65)) {
swipeRight = true;
}
// Swipe Right
else if (direction === 2 && (x < -1 * $this.innerWidth() / 2 || velocityX > 0.65)) {
swipeLeft = true;
}
// Make Slide Behind active slide visible
var next_slide;
if (swipeLeft) {
next_slide = $curr_slide.next();
if (next_slide.length === 0) {
next_slide = $slides.first();
}
next_slide.velocity({ opacity: 1
}, { duration: 300, queue: false, easing: 'easeOutQuad' });
}
if (swipeRight) {
next_slide = $curr_slide.prev();
if (next_slide.length === 0) {
next_slide = $slides.last();
}
next_slide.velocity({ opacity: 1
}, { duration: 300, queue: false, easing: 'easeOutQuad' });
}
}
}).on('panend', function (e) {
if (e.gesture.pointerType === "touch") {
$curr_slide = $slider.find('.active');
panning = false;
curr_index = $slider.find('.active').index();
if (!swipeRight && !swipeLeft || $slides.length <= 1) {
// Return to original spot
$curr_slide.velocity({ translateX: 0
}, { duration: 300, queue: false, easing: 'easeOutQuad' });
} else if (swipeLeft) {
moveToSlide(curr_index + 1);
$curr_slide.velocity({ translateX: -1 * $this.innerWidth() }, { duration: 300, queue: false, easing: 'easeOutQuad',
complete: function () {
$curr_slide.velocity({ opacity: 0, translateX: 0 }, { duration: 0, queue: false });
} });
} else if (swipeRight) {
moveToSlide(curr_index - 1);
$curr_slide.velocity({ translateX: $this.innerWidth() }, { duration: 300, queue: false, easing: 'easeOutQuad',
complete: function () {
$curr_slide.velocity({ opacity: 0, translateX: 0 }, { duration: 0, queue: false });
} });
}
swipeLeft = false;
swipeRight = false;
// Restart interval
clearInterval($interval);
$interval = setInterval(function () {
$active_index = $slider.find('.active').index();
if ($slides.length == $active_index + 1) $active_index = 0; // loop to start
else $active_index += 1;
moveToSlide($active_index);
}, options.transition + options.interval);
}
});
$this.on('sliderPause', function () {
clearInterval($interval);
});
$this.on('sliderStart', function () {
clearInterval($interval);
$interval = setInterval(function () {
$active_index = $slider.find('.active').index();
if ($slides.length == $active_index + 1) $active_index = 0; // loop to start
else $active_index += 1;
moveToSlide($active_index);
}, options.transition + options.interval);
});
$this.on('sliderNext', function () {
$active_index = $slider.find('.active').index();
moveToSlide($active_index + 1);
});
$this.on('sliderPrev', function () {
$active_index = $slider.find('.active').index();
moveToSlide($active_index - 1);
});
});
},
pause: function () {
$(this).trigger('sliderPause');
},
start: function () {
$(this).trigger('sliderStart');
},
next: function () {
$(this).trigger('sliderNext');
},
prev: function () {
$(this).trigger('sliderPrev');
}
};
$.fn.slider = function (methodOrOptions) {
if (methods[methodOrOptions]) {
return methods[methodOrOptions].apply(this, Array.prototype.slice.call(arguments, 1));
} else if (typeof methodOrOptions === 'object' || !methodOrOptions) {
// Default to "init"
return methods.init.apply(this, arguments);
} else {
$.error('Method ' + methodOrOptions + ' does not exist on jQuery.tooltip');
}
}; // Plugin end
})(jQuery);
;(function ($) {
$(document).ready(function () {
$(document).on('click.card', '.card', function (e) {
if ($(this).find('> .card-reveal').length) {
var $card = $(e.target).closest('.card');
if ($card.data('initialOverflow') === undefined) {
$card.data('initialOverflow', $card.css('overflow') === undefined ? '' : $card.css('overflow'));
}
if ($(e.target).is($('.card-reveal .card-title')) || $(e.target).is($('.card-reveal .card-title i'))) {
// Make Reveal animate down and display none
$(this).find('.card-reveal').velocity({ translateY: 0 }, {
duration: 225,
queue: false,
easing: 'easeInOutQuad',
complete: function () {
$(this).css({ display: 'none' });
$card.css('overflow', $card.data('initialOverflow'));
}
});
} else if ($(e.target).is($('.card .activator')) || $(e.target).is($('.card .activator i'))) {
$card.css('overflow', 'hidden');
$(this).find('.card-reveal').css({ display: 'block' }).velocity("stop", false).velocity({ translateY: '-100%' }, { duration: 300, queue: false, easing: 'easeInOutQuad' });
}
}
});
});
})(jQuery);
;(function ($) {
var materialChipsDefaults = {
data: [],
placeholder: '',
secondaryPlaceholder: '',
autocompleteOptions: {}
};
$(document).ready(function () {
// Handle removal of static chips.
$(document).on('click', '.chip .close', function (e) {
var $chips = $(this).closest('.chips');
if ($chips.attr('data-initialized')) {
return;
}
$(this).closest('.chip').remove();
});
});
$.fn.material_chip = function (options) {
var self = this;
this.$el = $(this);
this.$document = $(document);
this.SELS = {
CHIPS: '.chips',
CHIP: '.chip',
INPUT: 'input',
DELETE: '.material-icons',
SELECTED_CHIP: '.selected'
};
if ('data' === options) {
return this.$el.data('chips');
}
var curr_options = $.extend({}, materialChipsDefaults, options);
self.hasAutocomplete = !$.isEmptyObject(curr_options.autocompleteOptions.data);
// Initialize
this.init = function () {
var i = 0;
var chips;
self.$el.each(function () {
var $chips = $(this);
var chipId = Materialize.guid();
self.chipId = chipId;
if (!curr_options.data || !(curr_options.data instanceof Array)) {
curr_options.data = [];
}
$chips.data('chips', curr_options.data);
$chips.attr('data-index', i);
$chips.attr('data-initialized', true);
if (!$chips.hasClass(self.SELS.CHIPS)) {
$chips.addClass('chips');
}
self.chips($chips, chipId);
i++;
});
};
this.handleEvents = function () {
var SELS = self.SELS;
self.$document.off('click.chips-focus', SELS.CHIPS).on('click.chips-focus', SELS.CHIPS, function (e) {
$(e.target).find(SELS.INPUT).focus();
});
self.$document.off('click.chips-select', SELS.CHIP).on('click.chips-select', SELS.CHIP, function (e) {
var $chip = $(e.target);
if ($chip.length) {
var wasSelected = $chip.hasClass('selected');
var $chips = $chip.closest(SELS.CHIPS);
$(SELS.CHIP).removeClass('selected');
if (!wasSelected) {
self.selectChip($chip.index(), $chips);
}
}
});
self.$document.off('keydown.chips').on('keydown.chips', function (e) {
if ($(e.target).is('input, textarea')) {
return;
}
// delete
var $chip = self.$document.find(SELS.CHIP + SELS.SELECTED_CHIP);
var $chips = $chip.closest(SELS.CHIPS);
var length = $chip.siblings(SELS.CHIP).length;
var index;
if (!$chip.length) {
return;
}
if (e.which === 8 || e.which === 46) {
e.preventDefault();
index = $chip.index();
self.deleteChip(index, $chips);
var selectIndex = null;
if (index + 1 < length) {
selectIndex = index;
} else if (index === length || index + 1 === length) {
selectIndex = length - 1;
}
if (selectIndex < 0) selectIndex = null;
if (null !== selectIndex) {
self.selectChip(selectIndex, $chips);
}
if (!length) $chips.find('input').focus();
// left
} else if (e.which === 37) {
index = $chip.index() - 1;
if (index < 0) {
return;
}
$(SELS.CHIP).removeClass('selected');
self.selectChip(index, $chips);
// right
} else if (e.which === 39) {
index = $chip.index() + 1;
$(SELS.CHIP).removeClass('selected');
if (index > length) {
$chips.find('input').focus();
return;
}
self.selectChip(index, $chips);
}
});
self.$document.off('focusin.chips', SELS.CHIPS + ' ' + SELS.INPUT).on('focusin.chips', SELS.CHIPS + ' ' + SELS.INPUT, function (e) {
var $currChips = $(e.target).closest(SELS.CHIPS);
$currChips.addClass('focus');
$currChips.siblings('label, .prefix').addClass('active');
$(SELS.CHIP).removeClass('selected');
});
self.$document.off('focusout.chips', SELS.CHIPS + ' ' + SELS.INPUT).on('focusout.chips', SELS.CHIPS + ' ' + SELS.INPUT, function (e) {
var $currChips = $(e.target).closest(SELS.CHIPS);
$currChips.removeClass('focus');
// Remove active if empty
if ($currChips.data('chips') === undefined || !$currChips.data('chips').length) {
$currChips.siblings('label').removeClass('active');
}
$currChips.siblings('.prefix').removeClass('active');
});
self.$document.off('keydown.chips-add', SELS.CHIPS + ' ' + SELS.INPUT).on('keydown.chips-add', SELS.CHIPS + ' ' + SELS.INPUT, function (e) {
var $target = $(e.target);
var $chips = $target.closest(SELS.CHIPS);
var chipsLength = $chips.children(SELS.CHIP).length;
// enter
if (13 === e.which) {
// Override enter if autocompleting.
if (self.hasAutocomplete && $chips.find('.autocomplete-content.dropdown-content').length && $chips.find('.autocomplete-content.dropdown-content').children().length) {
return;
}
e.preventDefault();
self.addChip({ tag: $target.val() }, $chips);
$target.val('');
return;
}
// delete or left
if ((8 === e.keyCode || 37 === e.keyCode) && '' === $target.val() && chipsLength) {
e.preventDefault();
self.selectChip(chipsLength - 1, $chips);
$target.blur();
return;
}
});
// Click on delete icon in chip.
self.$document.off('click.chips-delete', SELS.CHIPS + ' ' + SELS.DELETE).on('click.chips-delete', SELS.CHIPS + ' ' + SELS.DELETE, function (e) {
var $target = $(e.target);
var $chips = $target.closest(SELS.CHIPS);
var $chip = $target.closest(SELS.CHIP);
e.stopPropagation();
self.deleteChip($chip.index(), $chips);
$chips.find('input').focus();
});
};
this.chips = function ($chips, chipId) {
$chips.empty();
$chips.data('chips').forEach(function (elem) {
$chips.append(self.renderChip(elem));
});
$chips.append($('<input id="' + chipId + '" class="input" placeholder="">'));
self.setPlaceholder($chips);
// Set for attribute for label
var label = $chips.next('label');
if (label.length) {
label.attr('for', chipId);
if ($chips.data('chips') !== undefined && $chips.data('chips').length) {
label.addClass('active');
}
}
// Setup autocomplete if needed.
var input = $('#' + chipId);
if (self.hasAutocomplete) {
curr_options.autocompleteOptions.onAutocomplete = function (val) {
self.addChip({ tag: val }, $chips);
input.val('');
input.focus();
};
input.autocomplete(curr_options.autocompleteOptions);
}
};
/**
* Render chip jQuery element.
* @param {Object} elem
* @return {jQuery}
*/
this.renderChip = function (elem) {
if (!elem.tag) return;
var $renderedChip = $('<div class="chip"></div>');
$renderedChip.text(elem.tag);
if (elem.image) {
$renderedChip.prepend($('<img />').attr('src', elem.image));
}
$renderedChip.append($('<i class="material-icons close">close</i>'));
return $renderedChip;
};
this.setPlaceholder = function ($chips) {
if ($chips.data('chips') !== undefined && !$chips.data('chips').length && curr_options.placeholder) {
$chips.find('input').prop('placeholder', curr_options.placeholder);
} else if (($chips.data('chips') === undefined || !!$chips.data('chips').length) && curr_options.secondaryPlaceholder) {
$chips.find('input').prop('placeholder', curr_options.secondaryPlaceholder);
}
};
this.isValid = function ($chips, elem) {
var chips = $chips.data('chips');
var exists = false;
for (var i = 0; i < chips.length; i++) {
if (chips[i].tag === elem.tag) {
exists = true;
return;
}
}
return '' !== elem.tag && !exists;
};
this.addChip = function (elem, $chips) {
if (!self.isValid($chips, elem)) {
return;
}
var $renderedChip = self.renderChip(elem);
var newData = [];
var oldData = $chips.data('chips');
for (var i = 0; i < oldData.length; i++) {
newData.push(oldData[i]);
}
newData.push(elem);
$chips.data('chips', newData);
$renderedChip.insertBefore($chips.find('input'));
$chips.trigger('chip.add', elem);
self.setPlaceholder($chips);
};
this.deleteChip = function (chipIndex, $chips) {
var chip = $chips.data('chips')[chipIndex];
$chips.find('.chip').eq(chipIndex).remove();
var newData = [];
var oldData = $chips.data('chips');
for (var i = 0; i < oldData.length; i++) {
if (i !== chipIndex) {
newData.push(oldData[i]);
}
}
$chips.data('chips', newData);
$chips.trigger('chip.delete', chip);
self.setPlaceholder($chips);
};
this.selectChip = function (chipIndex, $chips) {
var $chip = $chips.find('.chip').eq(chipIndex);
if ($chip && false === $chip.hasClass('selected')) {
$chip.addClass('selected');
$chips.trigger('chip.select', $chips.data('chips')[chipIndex]);
}
};
this.getChipsElement = function (index, $chips) {
return $chips.eq(index);
};
// init
this.init();
this.handleEvents();
};
})(jQuery);
;(function ($) {
$.fn.pushpin = function (options) {
// Defaults
var defaults = {
top: 0,
bottom: Infinity,
offset: 0
};
// Remove pushpin event and classes
if (options === "remove") {
this.each(function () {
if (id = $(this).data('pushpin-id')) {
$(window).off('scroll.' + id);
$(this).removeData('pushpin-id').removeClass('pin-top pinned pin-bottom').removeAttr('style');
}
});
return false;
}
options = $.extend(defaults, options);
$index = 0;
return this.each(function () {
var $uniqueId = Materialize.guid(),
$this = $(this),
$original_offset = $(this).offset().top;
function removePinClasses(object) {
object.removeClass('pin-top');
object.removeClass('pinned');
object.removeClass('pin-bottom');
}
function updateElements(objects, scrolled) {
objects.each(function () {
// Add position fixed (because its between top and bottom)
if (options.top <= scrolled && options.bottom >= scrolled && !$(this).hasClass('pinned')) {
removePinClasses($(this));
$(this).css('top', options.offset);
$(this).addClass('pinned');
}
// Add pin-top (when scrolled position is above top)
if (scrolled < options.top && !$(this).hasClass('pin-top')) {
removePinClasses($(this));
$(this).css('top', 0);
$(this).addClass('pin-top');
}
// Add pin-bottom (when scrolled position is below bottom)
if (scrolled > options.bottom && !$(this).hasClass('pin-bottom')) {
removePinClasses($(this));
$(this).addClass('pin-bottom');
$(this).css('top', options.bottom - $original_offset);
}
});
}
$(this).data('pushpin-id', $uniqueId);
updateElements($this, $(window).scrollTop());
$(window).on('scroll.' + $uniqueId, function () {
var $scrolled = $(window).scrollTop() + options.offset;
updateElements($this, $scrolled);
});
});
};
})(jQuery);;(function ($) {
$(document).ready(function () {
// jQuery reverse
$.fn.reverse = [].reverse;
// Hover behaviour: make sure this doesn't work on .click-to-toggle FABs!
$(document).on('mouseenter.fixedActionBtn', '.fixed-action-btn:not(.click-to-toggle):not(.toolbar)', function (e) {
var $this = $(this);
openFABMenu($this);
});
$(document).on('mouseleave.fixedActionBtn', '.fixed-action-btn:not(.click-to-toggle):not(.toolbar)', function (e) {
var $this = $(this);
closeFABMenu($this);
});
// Toggle-on-click behaviour.
$(document).on('click.fabClickToggle', '.fixed-action-btn.click-to-toggle > a', function (e) {
var $this = $(this);
var $menu = $this.parent();
if ($menu.hasClass('active')) {
closeFABMenu($menu);
} else {
openFABMenu($menu);
}
});
// Toolbar transition behaviour.
$(document).on('click.fabToolbar', '.fixed-action-btn.toolbar > a', function (e) {
var $this = $(this);
var $menu = $this.parent();
FABtoToolbar($menu);
});
});
$.fn.extend({
openFAB: function () {
openFABMenu($(this));
},
closeFAB: function () {
closeFABMenu($(this));
},
openToolbar: function () {
FABtoToolbar($(this));
},
closeToolbar: function () {
toolbarToFAB($(this));
}
});
var openFABMenu = function (btn) {
var $this = btn;
if ($this.hasClass('active') === false) {
// Get direction option
var horizontal = $this.hasClass('horizontal');
var offsetY, offsetX;
if (horizontal === true) {
offsetX = 40;
} else {
offsetY = 40;
}
$this.addClass('active');
$this.find('ul .btn-floating').velocity({ scaleY: ".4", scaleX: ".4", translateY: offsetY + 'px', translateX: offsetX + 'px' }, { duration: 0 });
var time = 0;
$this.find('ul .btn-floating').reverse().each(function () {
$(this).velocity({ opacity: "1", scaleX: "1", scaleY: "1", translateY: "0", translateX: '0' }, { duration: 80, delay: time });
time += 40;
});
}
};
var closeFABMenu = function (btn) {
var $this = btn;
// Get direction option
var horizontal = $this.hasClass('horizontal');
var offsetY, offsetX;
if (horizontal === true) {
offsetX = 40;
} else {
offsetY = 40;
}
$this.removeClass('active');
var time = 0;
$this.find('ul .btn-floating').velocity("stop", true);
$this.find('ul .btn-floating').velocity({ opacity: "0", scaleX: ".4", scaleY: ".4", translateY: offsetY + 'px', translateX: offsetX + 'px' }, { duration: 80 });
};
/**
* Transform FAB into toolbar
* @param {Object} object jQuery object
*/
var FABtoToolbar = function (btn) {
if (btn.attr('data-open') === "true") {
return;
}
var offsetX, offsetY, scaleFactor;
var windowWidth = window.innerWidth;
var windowHeight = window.innerHeight;
var btnRect = btn[0].getBoundingClientRect();
var anchor = btn.find('> a').first();
var menu = btn.find('> ul').first();
var backdrop = $('<div class="fab-backdrop"></div>');
var fabColor = anchor.css('background-color');
anchor.append(backdrop);
offsetX = btnRect.left - windowWidth / 2 + btnRect.width / 2;
offsetY = windowHeight - btnRect.bottom;
scaleFactor = windowWidth / backdrop.width();
btn.attr('data-origin-bottom', btnRect.bottom);
btn.attr('data-origin-left', btnRect.left);
btn.attr('data-origin-width', btnRect.width);
// Set initial state
btn.addClass('active');
btn.attr('data-open', true);
btn.css({
'text-align': 'center',
width: '100%',
bottom: 0,
left: 0,
transform: 'translateX(' + offsetX + 'px)',
transition: 'none'
});
anchor.css({
transform: 'translateY(' + -offsetY + 'px)',
transition: 'none'
});
backdrop.css({
'background-color': fabColor
});
setTimeout(function () {
btn.css({
transform: '',
transition: 'transform .2s cubic-bezier(0.550, 0.085, 0.680, 0.530), background-color 0s linear .2s'
});
anchor.css({
overflow: 'visible',
transform: '',
transition: 'transform .2s'
});
setTimeout(function () {
btn.css({
overflow: 'hidden',
'background-color': fabColor
});
backdrop.css({
transform: 'scale(' + scaleFactor + ')',
transition: 'transform .2s cubic-bezier(0.550, 0.055, 0.675, 0.190)'
});
menu.find('> li > a').css({
opacity: 1
});
// Scroll to close.
$(window).on('scroll.fabToolbarClose', function () {
toolbarToFAB(btn);
$(window).off('scroll.fabToolbarClose');
$(document).off('click.fabToolbarClose');
});
$(document).on('click.fabToolbarClose', function (e) {
if (!$(e.target).closest(menu).length) {
toolbarToFAB(btn);
$(window).off('scroll.fabToolbarClose');
$(document).off('click.fabToolbarClose');
}
});
}, 100);
}, 0);
};
/**
* Transform toolbar back into FAB
* @param {Object} object jQuery object
*/
var toolbarToFAB = function (btn) {
if (btn.attr('data-open') !== "true") {
return;
}
var offsetX, offsetY, scaleFactor;
var windowWidth = window.innerWidth;
var windowHeight = window.innerHeight;
var btnWidth = btn.attr('data-origin-width');
var btnBottom = btn.attr('data-origin-bottom');
var btnLeft = btn.attr('data-origin-left');
var anchor = btn.find('> .btn-floating').first();
var menu = btn.find('> ul').first();
var backdrop = btn.find('.fab-backdrop');
var fabColor = anchor.css('background-color');
offsetX = btnLeft - windowWidth / 2 + btnWidth / 2;
offsetY = windowHeight - btnBottom;
scaleFactor = windowWidth / backdrop.width();
// Hide backdrop
btn.removeClass('active');
btn.attr('data-open', false);
btn.css({
'background-color': 'transparent',
transition: 'none'
});
anchor.css({
transition: 'none'
});
backdrop.css({
transform: 'scale(0)',
'background-color': fabColor
});
menu.find('> li > a').css({
opacity: ''
});
setTimeout(function () {
backdrop.remove();
// Set initial state.
btn.css({
'text-align': '',
width: '',
bottom: '',
left: '',
overflow: '',
'background-color': '',
transform: 'translate3d(' + -offsetX + 'px,0,0)'
});
anchor.css({
overflow: '',
transform: 'translate3d(0,' + offsetY + 'px,0)'
});
setTimeout(function () {
btn.css({
transform: 'translate3d(0,0,0)',
transition: 'transform .2s'
});
anchor.css({
transform: 'translate3d(0,0,0)',
transition: 'transform .2s cubic-bezier(0.550, 0.055, 0.675, 0.190)'
});
}, 20);
}, 200);
};
})(jQuery);
;(function ($) {
// Image transition function
Materialize.fadeInImage = function (selectorOrEl) {
var element;
if (typeof selectorOrEl === 'string') {
element = $(selectorOrEl);
} else if (typeof selectorOrEl === 'object') {
element = selectorOrEl;
} else {
return;
}
element.css({ opacity: 0 });
$(element).velocity({ opacity: 1 }, {
duration: 650,
queue: false,
easing: 'easeOutSine'
});
$(element).velocity({ opacity: 1 }, {
duration: 1300,
queue: false,
easing: 'swing',
step: function (now, fx) {
fx.start = 100;
var grayscale_setting = now / 100;
var brightness_setting = 150 - (100 - now) / 1.75;
if (brightness_setting < 100) {
brightness_setting = 100;
}
if (now >= 0) {
$(this).css({
"-webkit-filter": "grayscale(" + grayscale_setting + ")" + "brightness(" + brightness_setting + "%)",
"filter": "grayscale(" + grayscale_setting + ")" + "brightness(" + brightness_setting + "%)"
});
}
}
});
};
// Horizontal staggered list
Materialize.showStaggeredList = function (selectorOrEl) {
var element;
if (typeof selectorOrEl === 'string') {
element = $(selectorOrEl);
} else if (typeof selectorOrEl === 'object') {
element = selectorOrEl;
} else {
return;
}
var time = 0;
element.find('li').velocity({ translateX: "-100px" }, { duration: 0 });
element.find('li').each(function () {
$(this).velocity({ opacity: "1", translateX: "0" }, { duration: 800, delay: time, easing: [60, 10] });
time += 120;
});
};
$(document).ready(function () {
// Hardcoded .staggered-list scrollFire
// var staggeredListOptions = [];
// $('ul.staggered-list').each(function (i) {
// var label = 'scrollFire-' + i;
// $(this).addClass(label);
// staggeredListOptions.push(
// {selector: 'ul.staggered-list.' + label,
// offset: 200,
// callback: 'showStaggeredList("ul.staggered-list.' + label + '")'});
// });
// scrollFire(staggeredListOptions);
// HammerJS, Swipe navigation
// Touch Event
var swipeLeft = false;
var swipeRight = false;
// Dismissible Collections
$('.dismissable').each(function () {
$(this).hammer({
prevent_default: false
}).on('pan', function (e) {
if (e.gesture.pointerType === "touch") {
var $this = $(this);
var direction = e.gesture.direction;
var x = e.gesture.deltaX;
var velocityX = e.gesture.velocityX;
$this.velocity({ translateX: x
}, { duration: 50, queue: false, easing: 'easeOutQuad' });
// Swipe Left
if (direction === 4 && (x > $this.innerWidth() / 2 || velocityX < -0.75)) {
swipeLeft = true;
}
// Swipe Right
if (direction === 2 && (x < -1 * $this.innerWidth() / 2 || velocityX > 0.75)) {
swipeRight = true;
}
}
}).on('panend', function (e) {
// Reset if collection is moved back into original position
if (Math.abs(e.gesture.deltaX) < $(this).innerWidth() / 2) {
swipeRight = false;
swipeLeft = false;
}
if (e.gesture.pointerType === "touch") {
var $this = $(this);
if (swipeLeft || swipeRight) {
var fullWidth;
if (swipeLeft) {
fullWidth = $this.innerWidth();
} else {
fullWidth = -1 * $this.innerWidth();
}
$this.velocity({ translateX: fullWidth
}, { duration: 100, queue: false, easing: 'easeOutQuad', complete: function () {
$this.css('border', 'none');
$this.velocity({ height: 0, padding: 0
}, { duration: 200, queue: false, easing: 'easeOutQuad', complete: function () {
$this.remove();
}
});
}
});
} else {
$this.velocity({ translateX: 0
}, { duration: 100, queue: false, easing: 'easeOutQuad' });
}
swipeLeft = false;
swipeRight = false;
}
});
});
// time = 0
// // Vertical Staggered list
// $('ul.staggered-list.vertical li').velocity(
// { translateY: "100px"},
// { duration: 0 });
// $('ul.staggered-list.vertical li').each(function() {
// $(this).velocity(
// { opacity: "1", translateY: "0"},
// { duration: 800, delay: time, easing: [60, 25] });
// time += 120;
// });
// // Fade in and Scale
// $('.fade-in.scale').velocity(
// { scaleX: .4, scaleY: .4, translateX: -600},
// { duration: 0});
// $('.fade-in').each(function() {
// $(this).velocity(
// { opacity: "1", scaleX: 1, scaleY: 1, translateX: 0},
// { duration: 800, easing: [60, 10] });
// });
});
})(jQuery);
;(function ($) {
var scrollFireEventsHandled = false;
// Input: Array of JSON objects {selector, offset, callback}
Materialize.scrollFire = function (options) {
var onScroll = function () {
var windowScroll = window.pageYOffset + window.innerHeight;
for (var i = 0; i < options.length; i++) {
// Get options from each line
var value = options[i];
var selector = value.selector,
offset = value.offset,
callback = value.callback;
var currentElement = document.querySelector(selector);
if (currentElement !== null) {
var elementOffset = currentElement.getBoundingClientRect().top + window.pageYOffset;
if (windowScroll > elementOffset + offset) {
if (value.done !== true) {
if (typeof callback === 'function') {
callback.call(this, currentElement);
} else if (typeof callback === 'string') {
var callbackFunc = new Function(callback);
callbackFunc(currentElement);
}
value.done = true;
}
}
}
}
};
var throttledScroll = Materialize.throttle(function () {
onScroll();
}, options.throttle || 100);
if (!scrollFireEventsHandled) {
window.addEventListener("scroll", throttledScroll);
window.addEventListener("resize", throttledScroll);
scrollFireEventsHandled = true;
}
// perform a scan once, after current execution context, and after dom is ready
setTimeout(throttledScroll, 0);
};
})(jQuery);
; /*!
* pickadate.js v3.5.0, 2014/04/13
* By Amsul, http://amsul.ca
* Hosted on http://amsul.github.io/pickadate.js
* Licensed under MIT
*/
(function (factory) {
Materialize.Picker = factory(jQuery);
})(function ($) {
var $window = $(window);
var $document = $(document);
var $html = $(document.documentElement);
/**
* The picker constructor that creates a blank picker.
*/
function PickerConstructor(ELEMENT, NAME, COMPONENT, OPTIONS) {
// If theres no element, return the picker constructor.
if (!ELEMENT) return PickerConstructor;
var IS_DEFAULT_THEME = false,
// The state of the picker.
STATE = {
id: ELEMENT.id || 'P' + Math.abs(~~(Math.random() * new Date()))
},
// Merge the defaults and options passed.
SETTINGS = COMPONENT ? $.extend(true, {}, COMPONENT.defaults, OPTIONS) : OPTIONS || {},
// Merge the default classes with the settings classes.
CLASSES = $.extend({}, PickerConstructor.klasses(), SETTINGS.klass),
// The element node wrapper into a jQuery object.
$ELEMENT = $(ELEMENT),
// Pseudo picker constructor.
PickerInstance = function () {
return this.start();
},
// The picker prototype.
P = PickerInstance.prototype = {
constructor: PickerInstance,
$node: $ELEMENT,
/**
* Initialize everything
*/
start: function () {
// If its already started, do nothing.
if (STATE && STATE.start) return P;
// Update the picker states.
STATE.methods = {};
STATE.start = true;
STATE.open = false;
STATE.type = ELEMENT.type;
// Confirm focus state, convert into text input to remove UA stylings,
// and set as readonly to prevent keyboard popup.
ELEMENT.autofocus = ELEMENT == getActiveElement();
ELEMENT.readOnly = !SETTINGS.editable;
ELEMENT.id = ELEMENT.id || STATE.id;
if (ELEMENT.type != 'text') {
ELEMENT.type = 'text';
}
// Create a new picker component with the settings.
P.component = new COMPONENT(P, SETTINGS);
// Create the picker root with a holder and then prepare it.
P.$root = $(PickerConstructor._.node('div', createWrappedComponent(), CLASSES.picker, 'id="' + ELEMENT.id + '_root" tabindex="0"'));
prepareElementRoot();
// If theres a format for the hidden input element, create the element.
if (SETTINGS.formatSubmit) {
prepareElementHidden();
}
// Prepare the input element.
prepareElement();
// Insert the root as specified in the settings.
if (SETTINGS.container) $(SETTINGS.container).append(P.$root);else $ELEMENT.before(P.$root);
// Bind the default component and settings events.
P.on({
start: P.component.onStart,
render: P.component.onRender,
stop: P.component.onStop,
open: P.component.onOpen,
close: P.component.onClose,
set: P.component.onSet
}).on({
start: SETTINGS.onStart,
render: SETTINGS.onRender,
stop: SETTINGS.onStop,
open: SETTINGS.onOpen,
close: SETTINGS.onClose,
set: SETTINGS.onSet
});
// Once were all set, check the theme in use.
IS_DEFAULT_THEME = isUsingDefaultTheme(P.$root.children()[0]);
// If the element has autofocus, open the picker.
if (ELEMENT.autofocus) {
P.open();
}
// Trigger queued the “start” and “render” events.
return P.trigger('start').trigger('render');
}, //start
/**
* Render a new picker
*/
render: function (entireComponent) {
// Insert a new component holder in the root or box.
if (entireComponent) P.$root.html(createWrappedComponent());else P.$root.find('.' + CLASSES.box).html(P.component.nodes(STATE.open));
// Trigger the queued “render” events.
return P.trigger('render');
}, //render
/**
* Destroy everything
*/
stop: function () {
// If its already stopped, do nothing.
if (!STATE.start) return P;
// Then close the picker.
P.close();
// Remove the hidden field.
if (P._hidden) {
P._hidden.parentNode.removeChild(P._hidden);
}
// Remove the root.
P.$root.remove();
// Remove the input class, remove the stored data, and unbind
// the events (after a tick for IE - see `P.close`).
$ELEMENT.removeClass(CLASSES.input).removeData(NAME);
setTimeout(function () {
$ELEMENT.off('.' + STATE.id);
}, 0);
// Restore the element state
ELEMENT.type = STATE.type;
ELEMENT.readOnly = false;
// Trigger the queued “stop” events.
P.trigger('stop');
// Reset the picker states.
STATE.methods = {};
STATE.start = false;
return P;
}, //stop
/**
* Open up the picker
*/
open: function (dontGiveFocus) {
// If its already open, do nothing.
if (STATE.open) return P;
// Add the “active” class.
$ELEMENT.addClass(CLASSES.active);
aria(ELEMENT, 'expanded', true);
// * A Firefox bug, when `html` has `overflow:hidden`, results in
// killing transitions :(. So add the “opened” state on the next tick.
// Bug: https://bugzilla.mozilla.org/show_bug.cgi?id=625289
setTimeout(function () {
// Add the “opened” class to the picker root.
P.$root.addClass(CLASSES.opened);
aria(P.$root[0], 'hidden', false);
}, 0);
// If we have to give focus, bind the element and doc events.
if (dontGiveFocus !== false) {
// Set it as open.
STATE.open = true;
// Prevent the page from scrolling.
if (IS_DEFAULT_THEME) {
$html.css('overflow', 'hidden').css('padding-right', '+=' + getScrollbarWidth());
}
// Pass focus to the root elements jQuery object.
// * Workaround for iOS8 to bring the pickers root into view.
P.$root.eq(0).focus();
// Bind the document events.
$document.on('click.' + STATE.id + ' focusin.' + STATE.id, function (event) {
var target = event.target;
// If the target of the event is not the element, close the picker picker.
// * Dont worry about clicks or focusins on the root because those dont bubble up.
// Also, for Firefox, a click on an `option` element bubbles up directly
// to the doc. So make sure the target wasn't the doc.
// * In Firefox stopPropagation() doesnt prevent right-click events from bubbling,
// which causes the picker to unexpectedly close when right-clicking it. So make
// sure the event wasnt a right-click.
if (target != ELEMENT && target != document && event.which != 3) {
// If the target was the holder that covers the screen,
// keep the element focused to maintain tabindex.
P.close(target === P.$root.children()[0]);
}
}).on('keydown.' + STATE.id, function (event) {
var
// Get the keycode.
keycode = event.keyCode,
// Translate that to a selection change.
keycodeToMove = P.component.key[keycode],
// Grab the target.
target = event.target;
// On escape, close the picker and give focus.
if (keycode == 27) {
P.close(true);
}
// Check if there is a key movement or “enter” keypress on the element.
else if (target == P.$root[0] && (keycodeToMove || keycode == 13)) {
// Prevent the default action to stop page movement.
event.preventDefault();
// Trigger the key movement action.
if (keycodeToMove) {
PickerConstructor._.trigger(P.component.key.go, P, [PickerConstructor._.trigger(keycodeToMove)]);
}
// On “enter”, if the highlighted item isnt disabled, set the value and close.
else if (!P.$root.find('.' + CLASSES.highlighted).hasClass(CLASSES.disabled)) {
P.set('select', P.component.item.highlight);
if (SETTINGS.closeOnSelect) {
P.close(true);
}
}
}
// If the target is within the root and “enter” is pressed,
// prevent the default action and trigger a click on the target instead.
else if ($.contains(P.$root[0], target) && keycode == 13) {
event.preventDefault();
target.click();
}
});
}
// Trigger the queued “open” events.
return P.trigger('open');
}, //open
/**
* Close the picker
*/
close: function (giveFocus) {
// If we need to give focus, do it before changing states.
if (giveFocus) {
// ....ah yes! It wouldve been incomplete without a crazy workaround for IE :|
// The focus is triggered *after* the close has completed - causing it
// to open again. So unbind and rebind the event at the next tick.
P.$root.off('focus.toOpen').eq(0).focus();
setTimeout(function () {
P.$root.on('focus.toOpen', handleFocusToOpenEvent);
}, 0);
}
// Remove the “active” class.
$ELEMENT.removeClass(CLASSES.active);
aria(ELEMENT, 'expanded', false);
// * A Firefox bug, when `html` has `overflow:hidden`, results in
// killing transitions :(. So remove the “opened” state on the next tick.
// Bug: https://bugzilla.mozilla.org/show_bug.cgi?id=625289
setTimeout(function () {
// Remove the “opened” and “focused” class from the picker root.
P.$root.removeClass(CLASSES.opened + ' ' + CLASSES.focused);
aria(P.$root[0], 'hidden', true);
}, 0);
// If its already closed, do nothing more.
if (!STATE.open) return P;
// Set it as closed.
STATE.open = false;
// Allow the page to scroll.
if (IS_DEFAULT_THEME) {
$html.css('overflow', '').css('padding-right', '-=' + getScrollbarWidth());
}
// Unbind the document events.
$document.off('.' + STATE.id);
// Trigger the queued “close” events.
return P.trigger('close');
}, //close
/**
* Clear the values
*/
clear: function (options) {
return P.set('clear', null, options);
}, //clear
/**
* Set something
*/
set: function (thing, value, options) {
var thingItem,
thingValue,
thingIsObject = $.isPlainObject(thing),
thingObject = thingIsObject ? thing : {};
// Make sure we have usable options.
options = thingIsObject && $.isPlainObject(value) ? value : options || {};
if (thing) {
// If the thing isnt an object, make it one.
if (!thingIsObject) {
thingObject[thing] = value;
}
// Go through the things of items to set.
for (thingItem in thingObject) {
// Grab the value of the thing.
thingValue = thingObject[thingItem];
// First, if the item exists and theres a value, set it.
if (thingItem in P.component.item) {
if (thingValue === undefined) thingValue = null;
P.component.set(thingItem, thingValue, options);
}
// Then, check to update the element value and broadcast a change.
if (thingItem == 'select' || thingItem == 'clear') {
$ELEMENT.val(thingItem == 'clear' ? '' : P.get(thingItem, SETTINGS.format)).trigger('change');
}
}
// Render a new picker.
P.render();
}
// When the method isnt muted, trigger queued “set” events and pass the `thingObject`.
return options.muted ? P : P.trigger('set', thingObject);
}, //set
/**
* Get something
*/
get: function (thing, format) {
// Make sure theres something to get.
thing = thing || 'value';
// If a picker state exists, return that.
if (STATE[thing] != null) {
return STATE[thing];
}
// Return the submission value, if that.
if (thing == 'valueSubmit') {
if (P._hidden) {
return P._hidden.value;
}
thing = 'value';
}
// Return the value, if that.
if (thing == 'value') {
return ELEMENT.value;
}
// Check if a component item exists, return that.
if (thing in P.component.item) {
if (typeof format == 'string') {
var thingValue = P.component.get(thing);
return thingValue ? PickerConstructor._.trigger(P.component.formats.toString, P.component, [format, thingValue]) : '';
}
return P.component.get(thing);
}
}, //get
/**
* Bind events on the things.
*/
on: function (thing, method, internal) {
var thingName,
thingMethod,
thingIsObject = $.isPlainObject(thing),
thingObject = thingIsObject ? thing : {};
if (thing) {
// If the thing isnt an object, make it one.
if (!thingIsObject) {
thingObject[thing] = method;
}
// Go through the things to bind to.
for (thingName in thingObject) {
// Grab the method of the thing.
thingMethod = thingObject[thingName];
// If it was an internal binding, prefix it.
if (internal) {
thingName = '_' + thingName;
}
// Make sure the thing methods collection exists.
STATE.methods[thingName] = STATE.methods[thingName] || [];
// Add the method to the relative method collection.
STATE.methods[thingName].push(thingMethod);
}
}
return P;
}, //on
/**
* Unbind events on the things.
*/
off: function () {
var i,
thingName,
names = arguments;
for (i = 0, namesCount = names.length; i < namesCount; i += 1) {
thingName = names[i];
if (thingName in STATE.methods) {
delete STATE.methods[thingName];
}
}
return P;
},
/**
* Fire off method events.
*/
trigger: function (name, data) {
var _trigger = function (name) {
var methodList = STATE.methods[name];
if (methodList) {
methodList.map(function (method) {
PickerConstructor._.trigger(method, P, [data]);
});
}
};
_trigger('_' + name);
_trigger(name);
return P;
} //trigger
//PickerInstance.prototype
/**
* Wrap the picker holder components together.
*/
};function createWrappedComponent() {
// Create a picker wrapper holder
return PickerConstructor._.node('div',
// Create a picker wrapper node
PickerConstructor._.node('div',
// Create a picker frame
PickerConstructor._.node('div',
// Create a picker box node
PickerConstructor._.node('div',
// Create the components nodes.
P.component.nodes(STATE.open),
// The picker box class
CLASSES.box),
// Picker wrap class
CLASSES.wrap),
// Picker frame class
CLASSES.frame),
// Picker holder class
CLASSES.holder); //endreturn
} //createWrappedComponent
/**
* Prepare the input element with all bindings.
*/
function prepareElement() {
$ELEMENT.
// Store the picker data by component name.
data(NAME, P).
// Add the “input” class name.
addClass(CLASSES.input).
// Remove the tabindex.
attr('tabindex', -1).
// If theres a `data-value`, update the value of the element.
val($ELEMENT.data('value') ? P.get('select', SETTINGS.format) : ELEMENT.value);
// Only bind keydown events if the element isnt editable.
if (!SETTINGS.editable) {
$ELEMENT.
// On focus/click, focus onto the root to open it up.
on('focus.' + STATE.id + ' click.' + STATE.id, function (event) {
event.preventDefault();
P.$root.eq(0).focus();
}).
// Handle keyboard event based on the picker being opened or not.
on('keydown.' + STATE.id, handleKeydownEvent);
}
// Update the aria attributes.
aria(ELEMENT, {
haspopup: true,
expanded: false,
readonly: false,
owns: ELEMENT.id + '_root'
});
}
/**
* Prepare the root picker element with all bindings.
*/
function prepareElementRoot() {
P.$root.on({
// For iOS8.
keydown: handleKeydownEvent,
// When something within the root is focused, stop from bubbling
// to the doc and remove the “focused” state from the root.
focusin: function (event) {
P.$root.removeClass(CLASSES.focused);
event.stopPropagation();
},
// When something within the root holder is clicked, stop it
// from bubbling to the doc.
'mousedown click': function (event) {
var target = event.target;
// Make sure the target isnt the root holder so it can bubble up.
if (target != P.$root.children()[0]) {
event.stopPropagation();
// * For mousedown events, cancel the default action in order to
// prevent cases where focus is shifted onto external elements
// when using things like jQuery mobile or MagnificPopup (ref: #249 & #120).
// Also, for Firefox, dont prevent action on the `option` element.
if (event.type == 'mousedown' && !$(target).is('input, select, textarea, button, option')) {
event.preventDefault();
// Re-focus onto the root so that users can click away
// from elements focused within the picker.
P.$root.eq(0).focus();
}
}
}
}).
// Add/remove the “target” class on focus and blur.
on({
focus: function () {
$ELEMENT.addClass(CLASSES.target);
},
blur: function () {
$ELEMENT.removeClass(CLASSES.target);
}
}).
// Open the picker and adjust the root “focused” state
on('focus.toOpen', handleFocusToOpenEvent).
// If theres a click on an actionable element, carry out the actions.
on('click', '[data-pick], [data-nav], [data-clear], [data-close]', function () {
var $target = $(this),
targetData = $target.data(),
targetDisabled = $target.hasClass(CLASSES.navDisabled) || $target.hasClass(CLASSES.disabled),
// * For IE, non-focusable elements can be active elements as well
// (http://stackoverflow.com/a/2684561).
activeElement = getActiveElement();
activeElement = activeElement && (activeElement.type || activeElement.href) && activeElement;
// If its disabled or nothing inside is actively focused, re-focus the element.
if (targetDisabled || activeElement && !$.contains(P.$root[0], activeElement)) {
P.$root.eq(0).focus();
}
// If something is superficially changed, update the `highlight` based on the `nav`.
if (!targetDisabled && targetData.nav) {
P.set('highlight', P.component.item.highlight, { nav: targetData.nav });
}
// If something is picked, set `select` then close with focus.
else if (!targetDisabled && 'pick' in targetData) {
P.set('select', targetData.pick);
if (SETTINGS.closeOnSelect) {
P.close(true);
}
}
// If a “clear” button is pressed, empty the values and close with focus.
else if (targetData.clear) {
P.clear();
if (SETTINGS.closeOnSelect) {
P.close(true);
}
} else if (targetData.close) {
P.close(true);
}
}); //P.$root
aria(P.$root[0], 'hidden', true);
}
/**
* Prepare the hidden input element along with all bindings.
*/
function prepareElementHidden() {
var name;
if (SETTINGS.hiddenName === true) {
name = ELEMENT.name;
ELEMENT.name = '';
} else {
name = [typeof SETTINGS.hiddenPrefix == 'string' ? SETTINGS.hiddenPrefix : '', typeof SETTINGS.hiddenSuffix == 'string' ? SETTINGS.hiddenSuffix : '_submit'];
name = name[0] + ELEMENT.name + name[1];
}
P._hidden = $('<input ' + 'type=hidden ' +
// Create the name using the original inputs with a prefix and suffix.
'name="' + name + '"' + (
// If the element has a value, set the hidden value as well.
$ELEMENT.data('value') || ELEMENT.value ? ' value="' + P.get('select', SETTINGS.formatSubmit) + '"' : '') + '>')[0];
$ELEMENT.
// If the value changes, update the hidden input with the correct format.
on('change.' + STATE.id, function () {
P._hidden.value = ELEMENT.value ? P.get('select', SETTINGS.formatSubmit) : '';
});
// Insert the hidden input as specified in the settings.
if (SETTINGS.container) $(SETTINGS.container).append(P._hidden);else $ELEMENT.before(P._hidden);
}
// For iOS8.
function handleKeydownEvent(event) {
var keycode = event.keyCode,
// Check if one of the delete keys was pressed.
isKeycodeDelete = /^(8|46)$/.test(keycode);
// For some reason IE clears the input value on “escape”.
if (keycode == 27) {
P.close();
return false;
}
// Check if `space` or `delete` was pressed or the picker is closed with a key movement.
if (keycode == 32 || isKeycodeDelete || !STATE.open && P.component.key[keycode]) {
// Prevent it from moving the page and bubbling to doc.
event.preventDefault();
event.stopPropagation();
// If `delete` was pressed, clear the values and close the picker.
// Otherwise open the picker.
if (isKeycodeDelete) {
P.clear().close();
} else {
P.open();
}
}
}
// Separated for IE
function handleFocusToOpenEvent(event) {
// Stop the event from propagating to the doc.
event.stopPropagation();
// If its a focus event, add the “focused” class to the root.
if (event.type == 'focus') {
P.$root.addClass(CLASSES.focused);
}
// And then finally open the picker.
P.open();
}
// Return a new picker instance.
return new PickerInstance();
} //PickerConstructor
/**
* The default classes and prefix to use for the HTML classes.
*/
PickerConstructor.klasses = function (prefix) {
prefix = prefix || 'picker';
return {
picker: prefix,
opened: prefix + '--opened',
focused: prefix + '--focused',
input: prefix + '__input',
active: prefix + '__input--active',
target: prefix + '__input--target',
holder: prefix + '__holder',
frame: prefix + '__frame',
wrap: prefix + '__wrap',
box: prefix + '__box'
};
}; //PickerConstructor.klasses
/**
* Check if the default theme is being used.
*/
function isUsingDefaultTheme(element) {
var theme,
prop = 'position';
// For IE.
if (element.currentStyle) {
theme = element.currentStyle[prop];
}
// For normal browsers.
else if (window.getComputedStyle) {
theme = getComputedStyle(element)[prop];
}
return theme == 'fixed';
}
/**
* Get the width of the browsers scrollbar.
* Taken from: https://github.com/VodkaBears/Remodal/blob/master/src/jquery.remodal.js
*/
function getScrollbarWidth() {
if ($html.height() <= $window.height()) {
return 0;
}
var $outer = $('<div style="visibility:hidden;width:100px" />').appendTo('body');
// Get the width without scrollbars.
var widthWithoutScroll = $outer[0].offsetWidth;
// Force adding scrollbars.
$outer.css('overflow', 'scroll');
// Add the inner div.
var $inner = $('<div style="width:100%" />').appendTo($outer);
// Get the width with scrollbars.
var widthWithScroll = $inner[0].offsetWidth;
// Remove the divs.
$outer.remove();
// Return the difference between the widths.
return widthWithoutScroll - widthWithScroll;
}
/**
* PickerConstructor helper methods.
*/
PickerConstructor._ = {
/**
* Create a group of nodes. Expects:
* `
{
min: {Integer},
max: {Integer},
i: {Integer},
node: {String},
item: {Function}
}
* `
*/
group: function (groupObject) {
var
// Scope for the looped object
loopObjectScope,
// Create the nodes list
nodesList = '',
// The counter starts from the `min`
counter = PickerConstructor._.trigger(groupObject.min, groupObject);
// Loop from the `min` to `max`, incrementing by `i`
for (; counter <= PickerConstructor._.trigger(groupObject.max, groupObject, [counter]); counter += groupObject.i) {
// Trigger the `item` function within scope of the object
loopObjectScope = PickerConstructor._.trigger(groupObject.item, groupObject, [counter]);
// Splice the subgroup and create nodes out of the sub nodes
nodesList += PickerConstructor._.node(groupObject.node, loopObjectScope[0], // the node
loopObjectScope[1], // the classes
loopObjectScope[2] // the attributes
);
}
// Return the list of nodes
return nodesList;
}, //group
/**
* Create a dom node string
*/
node: function (wrapper, item, klass, attribute) {
// If the item is false-y, just return an empty string
if (!item) return '';
// If the item is an array, do a join
item = $.isArray(item) ? item.join('') : item;
// Check for the class
klass = klass ? ' class="' + klass + '"' : '';
// Check for any attributes
attribute = attribute ? ' ' + attribute : '';
// Return the wrapped item
return '<' + wrapper + klass + attribute + '>' + item + '</' + wrapper + '>';
}, //node
/**
* Lead numbers below 10 with a zero.
*/
lead: function (number) {
return (number < 10 ? '0' : '') + number;
},
/**
* Trigger a function otherwise return the value.
*/
trigger: function (callback, scope, args) {
return typeof callback == 'function' ? callback.apply(scope, args || []) : callback;
},
/**
* If the second character is a digit, length is 2 otherwise 1.
*/
digits: function (string) {
return (/\d/.test(string[1]) ? 2 : 1
);
},
/**
* Tell if something is a date object.
*/
isDate: function (value) {
return {}.toString.call(value).indexOf('Date') > -1 && this.isInteger(value.getDate());
},
/**
* Tell if something is an integer.
*/
isInteger: function (value) {
return {}.toString.call(value).indexOf('Number') > -1 && value % 1 === 0;
},
/**
* Create ARIA attribute strings.
*/
ariaAttr: ariaAttr //PickerConstructor._
/**
* Extend the picker with a component and defaults.
*/
};PickerConstructor.extend = function (name, Component) {
// Extend jQuery.
$.fn[name] = function (options, action) {
// Grab the component data.
var componentData = this.data(name);
// If the picker is requested, return the data object.
if (options == 'picker') {
return componentData;
}
// If the component data exists and `options` is a string, carry out the action.
if (componentData && typeof options == 'string') {
return PickerConstructor._.trigger(componentData[options], componentData, [action]);
}
// Otherwise go through each matched element and if the component
// doesnt exist, create a new picker using `this` element
// and merging the defaults and options with a deep copy.
return this.each(function () {
var $this = $(this);
if (!$this.data(name)) {
new PickerConstructor(this, name, Component, options);
}
});
};
// Set the defaults.
$.fn[name].defaults = Component.defaults;
}; //PickerConstructor.extend
function aria(element, attribute, value) {
if ($.isPlainObject(attribute)) {
for (var key in attribute) {
ariaSet(element, key, attribute[key]);
}
} else {
ariaSet(element, attribute, value);
}
}
function ariaSet(element, attribute, value) {
element.setAttribute((attribute == 'role' ? '' : 'aria-') + attribute, value);
}
function ariaAttr(attribute, data) {
if (!$.isPlainObject(attribute)) {
attribute = { attribute: data };
}
data = '';
for (var key in attribute) {
var attr = (key == 'role' ? '' : 'aria-') + key,
attrVal = attribute[key];
data += attrVal == null ? '' : attr + '="' + attribute[key] + '"';
}
return data;
}
// IE8 bug throws an error for activeElements within iframes.
function getActiveElement() {
try {
return document.activeElement;
} catch (err) {}
}
// Expose the picker constructor.
return PickerConstructor;
});
; /*!
* Date picker for pickadate.js v3.5.0
* http://amsul.github.io/pickadate.js/date.htm
*/
(function (factory) {
factory(Materialize.Picker, jQuery);
})(function (Picker, $) {
/**
* Globals and constants
*/
var DAYS_IN_WEEK = 7,
WEEKS_IN_CALENDAR = 6,
_ = Picker._;
/**
* The date picker constructor
*/
function DatePicker(picker, settings) {
var calendar = this,
element = picker.$node[0],
elementValue = element.value,
elementDataValue = picker.$node.data('value'),
valueString = elementDataValue || elementValue,
formatString = elementDataValue ? settings.formatSubmit : settings.format,
isRTL = function () {
return element.currentStyle ?
// For IE.
element.currentStyle.direction == 'rtl' :
// For normal browsers.
getComputedStyle(picker.$root[0]).direction == 'rtl';
};
calendar.settings = settings;
calendar.$node = picker.$node;
// The queue of methods that will be used to build item objects.
calendar.queue = {
min: 'measure create',
max: 'measure create',
now: 'now create',
select: 'parse create validate',
highlight: 'parse navigate create validate',
view: 'parse create validate viewset',
disable: 'deactivate',
enable: 'activate'
// The component's item object.
};calendar.item = {};
calendar.item.clear = null;
calendar.item.disable = (settings.disable || []).slice(0);
calendar.item.enable = -function (collectionDisabled) {
return collectionDisabled[0] === true ? collectionDisabled.shift() : -1;
}(calendar.item.disable);
calendar.set('min', settings.min).set('max', settings.max).set('now');
// When theres a value, set the `select`, which in turn
// also sets the `highlight` and `view`.
if (valueString) {
calendar.set('select', valueString, { format: formatString });
}
// If theres no value, default to highlighting “today”.
else {
calendar.set('select', null).set('highlight', calendar.item.now);
}
// The keycode to movement mapping.
calendar.key = {
40: 7, // Down
38: -7, // Up
39: function () {
return isRTL() ? -1 : 1;
}, // Right
37: function () {
return isRTL() ? 1 : -1;
}, // Left
go: function (timeChange) {
var highlightedObject = calendar.item.highlight,
targetDate = new Date(highlightedObject.year, highlightedObject.month, highlightedObject.date + timeChange);
calendar.set('highlight', targetDate, { interval: timeChange });
this.render();
}
// Bind some picker events.
};picker.on('render', function () {
picker.$root.find('.' + settings.klass.selectMonth).on('change', function () {
var value = this.value;
if (value) {
picker.set('highlight', [picker.get('view').year, value, picker.get('highlight').date]);
picker.$root.find('.' + settings.klass.selectMonth).trigger('focus');
}
});
picker.$root.find('.' + settings.klass.selectYear).on('change', function () {
var value = this.value;
if (value) {
picker.set('highlight', [value, picker.get('view').month, picker.get('highlight').date]);
picker.$root.find('.' + settings.klass.selectYear).trigger('focus');
}
});
}, 1).on('open', function () {
var includeToday = '';
if (calendar.disabled(calendar.get('now'))) {
includeToday = ':not(.' + settings.klass.buttonToday + ')';
}
picker.$root.find('button' + includeToday + ', select').attr('disabled', false);
}, 1).on('close', function () {
picker.$root.find('button, select').attr('disabled', true);
}, 1);
} //DatePicker
/**
* Set a datepicker item object.
*/
DatePicker.prototype.set = function (type, value, options) {
var calendar = this,
calendarItem = calendar.item;
// If the value is `null` just set it immediately.
if (value === null) {
if (type == 'clear') type = 'select';
calendarItem[type] = value;
return calendar;
}
// Otherwise go through the queue of methods, and invoke the functions.
// Update this as the time unit, and set the final value as this item.
// * In the case of `enable`, keep the queue but set `disable` instead.
// And in the case of `flip`, keep the queue but set `enable` instead.
calendarItem[type == 'enable' ? 'disable' : type == 'flip' ? 'enable' : type] = calendar.queue[type].split(' ').map(function (method) {
value = calendar[method](type, value, options);
return value;
}).pop();
// Check if we need to cascade through more updates.
if (type == 'select') {
calendar.set('highlight', calendarItem.select, options);
} else if (type == 'highlight') {
calendar.set('view', calendarItem.highlight, options);
} else if (type.match(/^(flip|min|max|disable|enable)$/)) {
if (calendarItem.select && calendar.disabled(calendarItem.select)) {
calendar.set('select', calendarItem.select, options);
}
if (calendarItem.highlight && calendar.disabled(calendarItem.highlight)) {
calendar.set('highlight', calendarItem.highlight, options);
}
}
return calendar;
}; //DatePicker.prototype.set
/**
* Get a datepicker item object.
*/
DatePicker.prototype.get = function (type) {
return this.item[type];
}; //DatePicker.prototype.get
/**
* Create a picker date object.
*/
DatePicker.prototype.create = function (type, value, options) {
var isInfiniteValue,
calendar = this;
// If theres no value, use the type as the value.
value = value === undefined ? type : value;
// If its infinity, update the value.
if (value == -Infinity || value == Infinity) {
isInfiniteValue = value;
}
// If its an object, use the native date object.
else if ($.isPlainObject(value) && _.isInteger(value.pick)) {
value = value.obj;
}
// If its an array, convert it into a date and make sure
// that its a valid date otherwise default to today.
else if ($.isArray(value)) {
value = new Date(value[0], value[1], value[2]);
value = _.isDate(value) ? value : calendar.create().obj;
}
// If its a number or date object, make a normalized date.
else if (_.isInteger(value) || _.isDate(value)) {
value = calendar.normalize(new Date(value), options);
}
// If its a literal true or any other case, set it to now.
else /*if ( value === true )*/{
value = calendar.now(type, value, options);
}
// Return the compiled object.
return {
year: isInfiniteValue || value.getFullYear(),
month: isInfiniteValue || value.getMonth(),
date: isInfiniteValue || value.getDate(),
day: isInfiniteValue || value.getDay(),
obj: isInfiniteValue || value,
pick: isInfiniteValue || value.getTime()
};
}; //DatePicker.prototype.create
/**
* Create a range limit object using an array, date object,
* literal “true”, or integer relative to another time.
*/
DatePicker.prototype.createRange = function (from, to) {
var calendar = this,
createDate = function (date) {
if (date === true || $.isArray(date) || _.isDate(date)) {
return calendar.create(date);
}
return date;
};
// Create objects if possible.
if (!_.isInteger(from)) {
from = createDate(from);
}
if (!_.isInteger(to)) {
to = createDate(to);
}
// Create relative dates.
if (_.isInteger(from) && $.isPlainObject(to)) {
from = [to.year, to.month, to.date + from];
} else if (_.isInteger(to) && $.isPlainObject(from)) {
to = [from.year, from.month, from.date + to];
}
return {
from: createDate(from),
to: createDate(to)
};
}; //DatePicker.prototype.createRange
/**
* Check if a date unit falls within a date range object.
*/
DatePicker.prototype.withinRange = function (range, dateUnit) {
range = this.createRange(range.from, range.to);
return dateUnit.pick >= range.from.pick && dateUnit.pick <= range.to.pick;
};
/**
* Check if two date range objects overlap.
*/
DatePicker.prototype.overlapRanges = function (one, two) {
var calendar = this;
// Convert the ranges into comparable dates.
one = calendar.createRange(one.from, one.to);
two = calendar.createRange(two.from, two.to);
return calendar.withinRange(one, two.from) || calendar.withinRange(one, two.to) || calendar.withinRange(two, one.from) || calendar.withinRange(two, one.to);
};
/**
* Get the date today.
*/
DatePicker.prototype.now = function (type, value, options) {
value = new Date();
if (options && options.rel) {
value.setDate(value.getDate() + options.rel);
}
return this.normalize(value, options);
};
/**
* Navigate to next/prev month.
*/
DatePicker.prototype.navigate = function (type, value, options) {
var targetDateObject,
targetYear,
targetMonth,
targetDate,
isTargetArray = $.isArray(value),
isTargetObject = $.isPlainObject(value),
viewsetObject = this.item.view; /*,
safety = 100*/
if (isTargetArray || isTargetObject) {
if (isTargetObject) {
targetYear = value.year;
targetMonth = value.month;
targetDate = value.date;
} else {
targetYear = +value[0];
targetMonth = +value[1];
targetDate = +value[2];
}
// If were navigating months but the view is in a different
// month, navigate to the views year and month.
if (options && options.nav && viewsetObject && viewsetObject.month !== targetMonth) {
targetYear = viewsetObject.year;
targetMonth = viewsetObject.month;
}
// Figure out the expected target year and month.
targetDateObject = new Date(targetYear, targetMonth + (options && options.nav ? options.nav : 0), 1);
targetYear = targetDateObject.getFullYear();
targetMonth = targetDateObject.getMonth();
// If the month were going to doesnt have enough days,
// keep decreasing the date until we reach the months last date.
while ( /*safety &&*/new Date(targetYear, targetMonth, targetDate).getMonth() !== targetMonth) {
targetDate -= 1;
/*safety -= 1
if ( !safety ) {
throw 'Fell into an infinite loop while navigating to ' + new Date( targetYear, targetMonth, targetDate ) + '.'
}*/
}
value = [targetYear, targetMonth, targetDate];
}
return value;
}; //DatePicker.prototype.navigate
/**
* Normalize a date by setting the hours to midnight.
*/
DatePicker.prototype.normalize = function (value /*, options*/) {
value.setHours(0, 0, 0, 0);
return value;
};
/**
* Measure the range of dates.
*/
DatePicker.prototype.measure = function (type, value /*, options*/) {
var calendar = this;
// If its anything false-y, remove the limits.
if (!value) {
value = type == 'min' ? -Infinity : Infinity;
}
// If its a string, parse it.
else if (typeof value == 'string') {
value = calendar.parse(type, value);
}
// If it's an integer, get a date relative to today.
else if (_.isInteger(value)) {
value = calendar.now(type, value, { rel: value });
}
return value;
}; ///DatePicker.prototype.measure
/**
* Create a viewset object based on navigation.
*/
DatePicker.prototype.viewset = function (type, dateObject /*, options*/) {
return this.create([dateObject.year, dateObject.month, 1]);
};
/**
* Validate a date as enabled and shift if needed.
*/
DatePicker.prototype.validate = function (type, dateObject, options) {
var calendar = this,
// Keep a reference to the original date.
originalDateObject = dateObject,
// Make sure we have an interval.
interval = options && options.interval ? options.interval : 1,
// Check if the calendar enabled dates are inverted.
isFlippedBase = calendar.item.enable === -1,
// Check if we have any enabled dates after/before now.
hasEnabledBeforeTarget,
hasEnabledAfterTarget,
// The min & max limits.
minLimitObject = calendar.item.min,
maxLimitObject = calendar.item.max,
// Check if weve reached the limit during shifting.
reachedMin,
reachedMax,
// Check if the calendar is inverted and at least one weekday is enabled.
hasEnabledWeekdays = isFlippedBase && calendar.item.disable.filter(function (value) {
// If theres a date, check where it is relative to the target.
if ($.isArray(value)) {
var dateTime = calendar.create(value).pick;
if (dateTime < dateObject.pick) hasEnabledBeforeTarget = true;else if (dateTime > dateObject.pick) hasEnabledAfterTarget = true;
}
// Return only integers for enabled weekdays.
return _.isInteger(value);
}).length; /*,
safety = 100*/
// Cases to validate for:
// [1] Not inverted and date disabled.
// [2] Inverted and some dates enabled.
// [3] Not inverted and out of range.
//
// Cases to **not** validate for:
// • Navigating months.
// • Not inverted and date enabled.
// • Inverted and all dates disabled.
// • ..and anything else.
if (!options || !options.nav) if (
/* 1 */!isFlippedBase && calendar.disabled(dateObject) ||
/* 2 */isFlippedBase && calendar.disabled(dateObject) && (hasEnabledWeekdays || hasEnabledBeforeTarget || hasEnabledAfterTarget) ||
/* 3 */!isFlippedBase && (dateObject.pick <= minLimitObject.pick || dateObject.pick >= maxLimitObject.pick)) {
// When inverted, flip the direction if there arent any enabled weekdays
// and there are no enabled dates in the direction of the interval.
if (isFlippedBase && !hasEnabledWeekdays && (!hasEnabledAfterTarget && interval > 0 || !hasEnabledBeforeTarget && interval < 0)) {
interval *= -1;
}
// Keep looping until we reach an enabled date.
while ( /*safety &&*/calendar.disabled(dateObject)) {
/*safety -= 1
if ( !safety ) {
throw 'Fell into an infinite loop while validating ' + dateObject.obj + '.'
}*/
// If weve looped into the next/prev month with a large interval, return to the original date and flatten the interval.
if (Math.abs(interval) > 1 && (dateObject.month < originalDateObject.month || dateObject.month > originalDateObject.month)) {
dateObject = originalDateObject;
interval = interval > 0 ? 1 : -1;
}
// If weve reached the min/max limit, reverse the direction, flatten the interval and set it to the limit.
if (dateObject.pick <= minLimitObject.pick) {
reachedMin = true;
interval = 1;
dateObject = calendar.create([minLimitObject.year, minLimitObject.month, minLimitObject.date + (dateObject.pick === minLimitObject.pick ? 0 : -1)]);
} else if (dateObject.pick >= maxLimitObject.pick) {
reachedMax = true;
interval = -1;
dateObject = calendar.create([maxLimitObject.year, maxLimitObject.month, maxLimitObject.date + (dateObject.pick === maxLimitObject.pick ? 0 : 1)]);
}
// If weve reached both limits, just break out of the loop.
if (reachedMin && reachedMax) {
break;
}
// Finally, create the shifted date using the interval and keep looping.
dateObject = calendar.create([dateObject.year, dateObject.month, dateObject.date + interval]);
}
} //endif
// Return the date object settled on.
return dateObject;
}; //DatePicker.prototype.validate
/**
* Check if a date is disabled.
*/
DatePicker.prototype.disabled = function (dateToVerify) {
var calendar = this,
// Filter through the disabled dates to check if this is one.
isDisabledMatch = calendar.item.disable.filter(function (dateToDisable) {
// If the date is a number, match the weekday with 0index and `firstDay` check.
if (_.isInteger(dateToDisable)) {
return dateToVerify.day === (calendar.settings.firstDay ? dateToDisable : dateToDisable - 1) % 7;
}
// If its an array or a native JS date, create and match the exact date.
if ($.isArray(dateToDisable) || _.isDate(dateToDisable)) {
return dateToVerify.pick === calendar.create(dateToDisable).pick;
}
// If its an object, match a date within the “from” and “to” range.
if ($.isPlainObject(dateToDisable)) {
return calendar.withinRange(dateToDisable, dateToVerify);
}
});
// If this date matches a disabled date, confirm its not inverted.
isDisabledMatch = isDisabledMatch.length && !isDisabledMatch.filter(function (dateToDisable) {
return $.isArray(dateToDisable) && dateToDisable[3] == 'inverted' || $.isPlainObject(dateToDisable) && dateToDisable.inverted;
}).length;
// Check the calendar “enabled” flag and respectively flip the
// disabled state. Then also check if its beyond the min/max limits.
return calendar.item.enable === -1 ? !isDisabledMatch : isDisabledMatch || dateToVerify.pick < calendar.item.min.pick || dateToVerify.pick > calendar.item.max.pick;
}; //DatePicker.prototype.disabled
/**
* Parse a string into a usable type.
*/
DatePicker.prototype.parse = function (type, value, options) {
var calendar = this,
parsingObject = {};
// If its already parsed, were good.
if (!value || typeof value != 'string') {
return value;
}
// We need a `.format` to parse the value with.
if (!(options && options.format)) {
options = options || {};
options.format = calendar.settings.format;
}
// Convert the format into an array and then map through it.
calendar.formats.toArray(options.format).map(function (label) {
var
// Grab the formatting label.
formattingLabel = calendar.formats[label],
// The format length is from the formatting label function or the
// label length without the escaping exclamation (!) mark.
formatLength = formattingLabel ? _.trigger(formattingLabel, calendar, [value, parsingObject]) : label.replace(/^!/, '').length;
// If there's a format label, split the value up to the format length.
// Then add it to the parsing object with appropriate label.
if (formattingLabel) {
parsingObject[label] = value.substr(0, formatLength);
}
// Update the value as the substring from format length to end.
value = value.substr(formatLength);
});
// Compensate for month 0index.
return [parsingObject.yyyy || parsingObject.yy, +(parsingObject.mm || parsingObject.m) - 1, parsingObject.dd || parsingObject.d];
}; //DatePicker.prototype.parse
/**
* Various formats to display the object in.
*/
DatePicker.prototype.formats = function () {
// Return the length of the first word in a collection.
function getWordLengthFromCollection(string, collection, dateObject) {
// Grab the first word from the string.
var word = string.match(/\w+/)[0];
// If there's no month index, add it to the date object
if (!dateObject.mm && !dateObject.m) {
dateObject.m = collection.indexOf(word) + 1;
}
// Return the length of the word.
return word.length;
}
// Get the length of the first word in a string.
function getFirstWordLength(string) {
return string.match(/\w+/)[0].length;
}
return {
d: function (string, dateObject) {
// If there's string, then get the digits length.
// Otherwise return the selected date.
return string ? _.digits(string) : dateObject.date;
},
dd: function (string, dateObject) {
// If there's a string, then the length is always 2.
// Otherwise return the selected date with a leading zero.
return string ? 2 : _.lead(dateObject.date);
},
ddd: function (string, dateObject) {
// If there's a string, then get the length of the first word.
// Otherwise return the short selected weekday.
return string ? getFirstWordLength(string) : this.settings.weekdaysShort[dateObject.day];
},
dddd: function (string, dateObject) {
// If there's a string, then get the length of the first word.
// Otherwise return the full selected weekday.
return string ? getFirstWordLength(string) : this.settings.weekdaysFull[dateObject.day];
},
m: function (string, dateObject) {
// If there's a string, then get the length of the digits
// Otherwise return the selected month with 0index compensation.
return string ? _.digits(string) : dateObject.month + 1;
},
mm: function (string, dateObject) {
// If there's a string, then the length is always 2.
// Otherwise return the selected month with 0index and leading zero.
return string ? 2 : _.lead(dateObject.month + 1);
},
mmm: function (string, dateObject) {
var collection = this.settings.monthsShort;
// If there's a string, get length of the relevant month from the short
// months collection. Otherwise return the selected month from that collection.
return string ? getWordLengthFromCollection(string, collection, dateObject) : collection[dateObject.month];
},
mmmm: function (string, dateObject) {
var collection = this.settings.monthsFull;
// If there's a string, get length of the relevant month from the full
// months collection. Otherwise return the selected month from that collection.
return string ? getWordLengthFromCollection(string, collection, dateObject) : collection[dateObject.month];
},
yy: function (string, dateObject) {
// If there's a string, then the length is always 2.
// Otherwise return the selected year by slicing out the first 2 digits.
return string ? 2 : ('' + dateObject.year).slice(2);
},
yyyy: function (string, dateObject) {
// If there's a string, then the length is always 4.
// Otherwise return the selected year.
return string ? 4 : dateObject.year;
},
// Create an array by splitting the formatting string passed.
toArray: function (formatString) {
return formatString.split(/(d{1,4}|m{1,4}|y{4}|yy|!.)/g);
},
// Format an object into a string using the formatting options.
toString: function (formatString, itemObject) {
var calendar = this;
return calendar.formats.toArray(formatString).map(function (label) {
return _.trigger(calendar.formats[label], calendar, [0, itemObject]) || label.replace(/^!/, '');
}).join('');
}
};
}(); //DatePicker.prototype.formats
/**
* Check if two date units are the exact.
*/
DatePicker.prototype.isDateExact = function (one, two) {
var calendar = this;
// When were working with weekdays, do a direct comparison.
if (_.isInteger(one) && _.isInteger(two) || typeof one == 'boolean' && typeof two == 'boolean') {
return one === two;
}
// When were working with date representations, compare the “pick” value.
if ((_.isDate(one) || $.isArray(one)) && (_.isDate(two) || $.isArray(two))) {
return calendar.create(one).pick === calendar.create(two).pick;
}
// When were working with range objects, compare the “from” and “to”.
if ($.isPlainObject(one) && $.isPlainObject(two)) {
return calendar.isDateExact(one.from, two.from) && calendar.isDateExact(one.to, two.to);
}
return false;
};
/**
* Check if two date units overlap.
*/
DatePicker.prototype.isDateOverlap = function (one, two) {
var calendar = this,
firstDay = calendar.settings.firstDay ? 1 : 0;
// When were working with a weekday index, compare the days.
if (_.isInteger(one) && (_.isDate(two) || $.isArray(two))) {
one = one % 7 + firstDay;
return one === calendar.create(two).day + 1;
}
if (_.isInteger(two) && (_.isDate(one) || $.isArray(one))) {
two = two % 7 + firstDay;
return two === calendar.create(one).day + 1;
}
// When were working with range objects, check if the ranges overlap.
if ($.isPlainObject(one) && $.isPlainObject(two)) {
return calendar.overlapRanges(one, two);
}
return false;
};
/**
* Flip the “enabled” state.
*/
DatePicker.prototype.flipEnable = function (val) {
var itemObject = this.item;
itemObject.enable = val || (itemObject.enable == -1 ? 1 : -1);
};
/**
* Mark a collection of dates as “disabled”.
*/
DatePicker.prototype.deactivate = function (type, datesToDisable) {
var calendar = this,
disabledItems = calendar.item.disable.slice(0);
// If were flipping, thats all we need to do.
if (datesToDisable == 'flip') {
calendar.flipEnable();
} else if (datesToDisable === false) {
calendar.flipEnable(1);
disabledItems = [];
} else if (datesToDisable === true) {
calendar.flipEnable(-1);
disabledItems = [];
}
// Otherwise go through the dates to disable.
else {
datesToDisable.map(function (unitToDisable) {
var matchFound;
// When we have disabled items, check for matches.
// If something is matched, immediately break out.
for (var index = 0; index < disabledItems.length; index += 1) {
if (calendar.isDateExact(unitToDisable, disabledItems[index])) {
matchFound = true;
break;
}
}
// If nothing was found, add the validated unit to the collection.
if (!matchFound) {
if (_.isInteger(unitToDisable) || _.isDate(unitToDisable) || $.isArray(unitToDisable) || $.isPlainObject(unitToDisable) && unitToDisable.from && unitToDisable.to) {
disabledItems.push(unitToDisable);
}
}
});
}
// Return the updated collection.
return disabledItems;
}; //DatePicker.prototype.deactivate
/**
* Mark a collection of dates as “enabled”.
*/
DatePicker.prototype.activate = function (type, datesToEnable) {
var calendar = this,
disabledItems = calendar.item.disable,
disabledItemsCount = disabledItems.length;
// If were flipping, thats all we need to do.
if (datesToEnable == 'flip') {
calendar.flipEnable();
} else if (datesToEnable === true) {
calendar.flipEnable(1);
disabledItems = [];
} else if (datesToEnable === false) {
calendar.flipEnable(-1);
disabledItems = [];
}
// Otherwise go through the disabled dates.
else {
datesToEnable.map(function (unitToEnable) {
var matchFound, disabledUnit, index, isExactRange;
// Go through the disabled items and try to find a match.
for (index = 0; index < disabledItemsCount; index += 1) {
disabledUnit = disabledItems[index];
// When an exact match is found, remove it from the collection.
if (calendar.isDateExact(disabledUnit, unitToEnable)) {
matchFound = disabledItems[index] = null;
isExactRange = true;
break;
}
// When an overlapped match is found, add the “inverted” state to it.
else if (calendar.isDateOverlap(disabledUnit, unitToEnable)) {
if ($.isPlainObject(unitToEnable)) {
unitToEnable.inverted = true;
matchFound = unitToEnable;
} else if ($.isArray(unitToEnable)) {
matchFound = unitToEnable;
if (!matchFound[3]) matchFound.push('inverted');
} else if (_.isDate(unitToEnable)) {
matchFound = [unitToEnable.getFullYear(), unitToEnable.getMonth(), unitToEnable.getDate(), 'inverted'];
}
break;
}
}
// If a match was found, remove a previous duplicate entry.
if (matchFound) for (index = 0; index < disabledItemsCount; index += 1) {
if (calendar.isDateExact(disabledItems[index], unitToEnable)) {
disabledItems[index] = null;
break;
}
}
// In the event that were dealing with an exact range of dates,
// make sure there are no “inverted” dates because of it.
if (isExactRange) for (index = 0; index < disabledItemsCount; index += 1) {
if (calendar.isDateOverlap(disabledItems[index], unitToEnable)) {
disabledItems[index] = null;
break;
}
}
// If something is still matched, add it into the collection.
if (matchFound) {
disabledItems.push(matchFound);
}
});
}
// Return the updated collection.
return disabledItems.filter(function (val) {
return val != null;
});
}; //DatePicker.prototype.activate
/**
* Create a string for the nodes in the picker.
*/
DatePicker.prototype.nodes = function (isOpen) {
var calendar = this,
settings = calendar.settings,
calendarItem = calendar.item,
nowObject = calendarItem.now,
selectedObject = calendarItem.select,
highlightedObject = calendarItem.highlight,
viewsetObject = calendarItem.view,
disabledCollection = calendarItem.disable,
minLimitObject = calendarItem.min,
maxLimitObject = calendarItem.max,
// Create the calendar table head using a copy of weekday labels collection.
// * We do a copy so we don't mutate the original array.
tableHead = function (collection, fullCollection) {
// If the first day should be Monday, move Sunday to the end.
if (settings.firstDay) {
collection.push(collection.shift());
fullCollection.push(fullCollection.shift());
}
// Create and return the table head group.
return _.node('thead', _.node('tr', _.group({
min: 0,
max: DAYS_IN_WEEK - 1,
i: 1,
node: 'th',
item: function (counter) {
return [collection[counter], settings.klass.weekdays, 'scope=col title="' + fullCollection[counter] + '"'];
}
}))); //endreturn
// Materialize modified
}((settings.showWeekdaysFull ? settings.weekdaysFull : settings.weekdaysLetter).slice(0), settings.weekdaysFull.slice(0)),
//tableHead
// Create the nav for next/prev month.
createMonthNav = function (next) {
// Otherwise, return the created month tag.
return _.node('div', ' ', settings.klass['nav' + (next ? 'Next' : 'Prev')] + (
// If the focused month is outside the range, disabled the button.
next && viewsetObject.year >= maxLimitObject.year && viewsetObject.month >= maxLimitObject.month || !next && viewsetObject.year <= minLimitObject.year && viewsetObject.month <= minLimitObject.month ? ' ' + settings.klass.navDisabled : ''), 'data-nav=' + (next || -1) + ' ' + _.ariaAttr({
role: 'button',
controls: calendar.$node[0].id + '_table'
}) + ' ' + 'title="' + (next ? settings.labelMonthNext : settings.labelMonthPrev) + '"'); //endreturn
},
//createMonthNav
// Create the month label.
//Materialize modified
createMonthLabel = function (override) {
var monthsCollection = settings.showMonthsShort ? settings.monthsShort : settings.monthsFull;
// Materialize modified
if (override == "short_months") {
monthsCollection = settings.monthsShort;
}
// If there are months to select, add a dropdown menu.
if (settings.selectMonths && override == undefined) {
return _.node('select', _.group({
min: 0,
max: 11,
i: 1,
node: 'option',
item: function (loopedMonth) {
return [
// The looped month and no classes.
monthsCollection[loopedMonth], 0,
// Set the value and selected index.
'value=' + loopedMonth + (viewsetObject.month == loopedMonth ? ' selected' : '') + (viewsetObject.year == minLimitObject.year && loopedMonth < minLimitObject.month || viewsetObject.year == maxLimitObject.year && loopedMonth > maxLimitObject.month ? ' disabled' : '')];
}
}), settings.klass.selectMonth + ' browser-default', (isOpen ? '' : 'disabled') + ' ' + _.ariaAttr({ controls: calendar.$node[0].id + '_table' }) + ' ' + 'title="' + settings.labelMonthSelect + '"');
}
// Materialize modified
if (override == "short_months") if (selectedObject != null) return monthsCollection[selectedObject.month];else return monthsCollection[viewsetObject.month];
// If there's a need for a month selector
return _.node('div', monthsCollection[viewsetObject.month], settings.klass.month);
},
//createMonthLabel
// Create the year label.
// Materialize modified
createYearLabel = function (override) {
var focusedYear = viewsetObject.year,
// If years selector is set to a literal "true", set it to 5. Otherwise
// divide in half to get half before and half after focused year.
numberYears = settings.selectYears === true ? 5 : ~~(settings.selectYears / 2);
// If there are years to select, add a dropdown menu.
if (numberYears) {
var minYear = minLimitObject.year,
maxYear = maxLimitObject.year,
lowestYear = focusedYear - numberYears,
highestYear = focusedYear + numberYears;
// If the min year is greater than the lowest year, increase the highest year
// by the difference and set the lowest year to the min year.
if (minYear > lowestYear) {
highestYear += minYear - lowestYear;
lowestYear = minYear;
}
// If the max year is less than the highest year, decrease the lowest year
// by the lower of the two: available and needed years. Then set the
// highest year to the max year.
if (maxYear < highestYear) {
var availableYears = lowestYear - minYear,
neededYears = highestYear - maxYear;
lowestYear -= availableYears > neededYears ? neededYears : availableYears;
highestYear = maxYear;
}
if (settings.selectYears && override == undefined) {
return _.node('select', _.group({
min: lowestYear,
max: highestYear,
i: 1,
node: 'option',
item: function (loopedYear) {
return [
// The looped year and no classes.
loopedYear, 0,
// Set the value and selected index.
'value=' + loopedYear + (focusedYear == loopedYear ? ' selected' : '')];
}
}), settings.klass.selectYear + ' browser-default', (isOpen ? '' : 'disabled') + ' ' + _.ariaAttr({ controls: calendar.$node[0].id + '_table' }) + ' ' + 'title="' + settings.labelYearSelect + '"');
}
}
// Materialize modified
if (override === 'raw' && selectedObject != null) {
return _.node('div', selectedObject.year);
}
// Otherwise just return the year focused
return _.node('div', focusedYear, settings.klass.year);
}; //createYearLabel
// Materialize modified
createDayLabel = function () {
if (selectedObject != null) return selectedObject.date;else return nowObject.date;
};
createWeekdayLabel = function () {
var display_day;
if (selectedObject != null) display_day = selectedObject.day;else display_day = nowObject.day;
var weekday = settings.weekdaysShort[display_day];
return weekday;
};
// Create and return the entire calendar.
return _.node(
// Date presentation View
'div', _.node(
// Div for Year
'div', createYearLabel("raw"), settings.klass.year_display) + _.node('span', createWeekdayLabel() + ', ', "picker__weekday-display") + _.node(
// Div for short Month
'span', createMonthLabel("short_months") + ' ', settings.klass.month_display) + _.node(
// Div for Day
'span', createDayLabel(), settings.klass.day_display), settings.klass.date_display) +
// Calendar container
_.node('div', _.node('div', _.node('div', (settings.selectYears ? createMonthLabel() + createYearLabel() : createMonthLabel() + createYearLabel()) + createMonthNav() + createMonthNav(1), settings.klass.header) + _.node('table', tableHead + _.node('tbody', _.group({
min: 0,
max: WEEKS_IN_CALENDAR - 1,
i: 1,
node: 'tr',
item: function (rowCounter) {
// If Monday is the first day and the month starts on Sunday, shift the date back a week.
var shiftDateBy = settings.firstDay && calendar.create([viewsetObject.year, viewsetObject.month, 1]).day === 0 ? -7 : 0;
return [_.group({
min: DAYS_IN_WEEK * rowCounter - viewsetObject.day + shiftDateBy + 1, // Add 1 for weekday 0index
max: function () {
return this.min + DAYS_IN_WEEK - 1;
},
i: 1,
node: 'td',
item: function (targetDate) {
// Convert the time date from a relative date to a target date.
targetDate = calendar.create([viewsetObject.year, viewsetObject.month, targetDate + (settings.firstDay ? 1 : 0)]);
var isSelected = selectedObject && selectedObject.pick == targetDate.pick,
isHighlighted = highlightedObject && highlightedObject.pick == targetDate.pick,
isDisabled = disabledCollection && calendar.disabled(targetDate) || targetDate.pick < minLimitObject.pick || targetDate.pick > maxLimitObject.pick,
formattedDate = _.trigger(calendar.formats.toString, calendar, [settings.format, targetDate]);
return [_.node('div', targetDate.date, function (klasses) {
// Add the `infocus` or `outfocus` classes based on month in view.
klasses.push(viewsetObject.month == targetDate.month ? settings.klass.infocus : settings.klass.outfocus);
// Add the `today` class if needed.
if (nowObject.pick == targetDate.pick) {
klasses.push(settings.klass.now);
}
// Add the `selected` class if something's selected and the time matches.
if (isSelected) {
klasses.push(settings.klass.selected);
}
// Add the `highlighted` class if something's highlighted and the time matches.
if (isHighlighted) {
klasses.push(settings.klass.highlighted);
}
// Add the `disabled` class if something's disabled and the object matches.
if (isDisabled) {
klasses.push(settings.klass.disabled);
}
return klasses.join(' ');
}([settings.klass.day]), 'data-pick=' + targetDate.pick + ' ' + _.ariaAttr({
role: 'gridcell',
label: formattedDate,
selected: isSelected && calendar.$node.val() === formattedDate ? true : null,
activedescendant: isHighlighted ? true : null,
disabled: isDisabled ? true : null
}) + ' ' + (isDisabled ? '' : 'tabindex="0"')), '', _.ariaAttr({ role: 'presentation' })]; //endreturn
}
})]; //endreturn
}
})), settings.klass.table, 'id="' + calendar.$node[0].id + '_table' + '" ' + _.ariaAttr({
role: 'grid',
controls: calendar.$node[0].id,
readonly: true
})), settings.klass.calendar_container) // end calendar
+
// * For Firefox forms to submit, make sure to set the buttons `type` attributes as “button”.
_.node('div', _.node('button', settings.today, "btn-flat picker__today waves-effect", 'type=button data-pick=' + nowObject.pick + (isOpen && !calendar.disabled(nowObject) ? '' : ' disabled') + ' ' + _.ariaAttr({ controls: calendar.$node[0].id })) + _.node('button', settings.clear, "btn-flat picker__clear waves-effect", 'type=button data-clear=1' + (isOpen ? '' : ' disabled') + ' ' + _.ariaAttr({ controls: calendar.$node[0].id })) + _.node('button', settings.close, "btn-flat picker__close waves-effect", 'type=button data-close=true ' + (isOpen ? '' : ' disabled') + ' ' + _.ariaAttr({ controls: calendar.$node[0].id })), settings.klass.footer), 'picker__container__wrapper'); //endreturn
}; //DatePicker.prototype.nodes
/**
* The date picker defaults.
*/
DatePicker.defaults = function (prefix) {
return {
// The title label to use for the month nav buttons
labelMonthNext: 'Next month',
labelMonthPrev: 'Previous month',
// The title label to use for the dropdown selectors
labelMonthSelect: 'Select a month',
labelYearSelect: 'Select a year',
// Months and weekdays
monthsFull: ['January', 'February', 'March', 'April', 'May', 'June', 'July', 'August', 'September', 'October', 'November', 'December'],
monthsShort: ['Jan', 'Feb', 'Mar', 'Apr', 'May', 'Jun', 'Jul', 'Aug', 'Sep', 'Oct', 'Nov', 'Dec'],
weekdaysFull: ['Sunday', 'Monday', 'Tuesday', 'Wednesday', 'Thursday', 'Friday', 'Saturday'],
weekdaysShort: ['Sun', 'Mon', 'Tue', 'Wed', 'Thu', 'Fri', 'Sat'],
// Materialize modified
weekdaysLetter: ['S', 'M', 'T', 'W', 'T', 'F', 'S'],
// Today and clear
today: 'Today',
clear: 'Clear',
close: 'Ok',
// Picker close behavior (Prevent a change in behaviour for backwards compatibility)
closeOnSelect: false,
// The format to show on the `input` element
format: 'd mmmm, yyyy',
// Classes
klass: {
table: prefix + 'table',
header: prefix + 'header',
// Materialize Added klasses
date_display: prefix + 'date-display',
day_display: prefix + 'day-display',
month_display: prefix + 'month-display',
year_display: prefix + 'year-display',
calendar_container: prefix + 'calendar-container',
// end
navPrev: prefix + 'nav--prev',
navNext: prefix + 'nav--next',
navDisabled: prefix + 'nav--disabled',
month: prefix + 'month',
year: prefix + 'year',
selectMonth: prefix + 'select--month',
selectYear: prefix + 'select--year',
weekdays: prefix + 'weekday',
day: prefix + 'day',
disabled: prefix + 'day--disabled',
selected: prefix + 'day--selected',
highlighted: prefix + 'day--highlighted',
now: prefix + 'day--today',
infocus: prefix + 'day--infocus',
outfocus: prefix + 'day--outfocus',
footer: prefix + 'footer',
buttonClear: prefix + 'button--clear',
buttonToday: prefix + 'button--today',
buttonClose: prefix + 'button--close'
}
};
}(Picker.klasses().picker + '__');
/**
* Extend the picker to add the date picker.
*/
Picker.extend('pickadate', DatePicker);
});
; /*!
* ClockPicker v0.0.7 (http://weareoutman.github.io/clockpicker/)
* Copyright 2014 Wang Shenwei.
* Licensed under MIT (https://github.com/weareoutman/clockpicker/blob/gh-pages/LICENSE)
*
* Further modified
* Copyright 2015 Ching Yaw Hao.
*/
(function ($) {
var $win = $(window),
$doc = $(document);
// Can I use inline svg ?
var svgNS = 'http://www.w3.org/2000/svg',
svgSupported = 'SVGAngle' in window && function () {
var supported,
el = document.createElement('div');
el.innerHTML = '<svg/>';
supported = (el.firstChild && el.firstChild.namespaceURI) == svgNS;
el.innerHTML = '';
return supported;
}();
// Can I use transition ?
var transitionSupported = function () {
var style = document.createElement('div').style;
return 'transition' in style || 'WebkitTransition' in style || 'MozTransition' in style || 'msTransition' in style || 'OTransition' in style;
}();
// Listen touch events in touch screen device, instead of mouse events in desktop.
var touchSupported = 'ontouchstart' in window,
mousedownEvent = 'mousedown' + (touchSupported ? ' touchstart' : ''),
mousemoveEvent = 'mousemove.clockpicker' + (touchSupported ? ' touchmove.clockpicker' : ''),
mouseupEvent = 'mouseup.clockpicker' + (touchSupported ? ' touchend.clockpicker' : '');
// Vibrate the device if supported
var vibrate = navigator.vibrate ? 'vibrate' : navigator.webkitVibrate ? 'webkitVibrate' : null;
function createSvgElement(name) {
return document.createElementNS(svgNS, name);
}
function leadingZero(num) {
return (num < 10 ? '0' : '') + num;
}
// Get a unique id
var idCounter = 0;
function uniqueId(prefix) {
var id = ++idCounter + '';
return prefix ? prefix + id : id;
}
// Clock size
var dialRadius = 135,
outerRadius = 105,
// innerRadius = 80 on 12 hour clock
innerRadius = 70,
tickRadius = 20,
diameter = dialRadius * 2,
duration = transitionSupported ? 350 : 1;
// Popover template
var tpl = ['<div class="clockpicker picker">', '<div class="picker__holder">', '<div class="picker__frame">', '<div class="picker__wrap">', '<div class="picker__box">', '<div class="picker__date-display">', '<div class="clockpicker-display">', '<div class="clockpicker-display-column">', '<span class="clockpicker-span-hours text-primary"></span>', ':', '<span class="clockpicker-span-minutes"></span>', '</div>', '<div class="clockpicker-display-column clockpicker-display-am-pm">', '<div class="clockpicker-span-am-pm"></div>', '</div>', '</div>', '</div>', '<div class="picker__container__wrapper">', '<div class="picker__calendar-container">', '<div class="clockpicker-plate">', '<div class="clockpicker-canvas"></div>', '<div class="clockpicker-dial clockpicker-hours"></div>', '<div class="clockpicker-dial clockpicker-minutes clockpicker-dial-out"></div>', '</div>', '<div class="clockpicker-am-pm-block">', '</div>', '</div>', '<div class="picker__footer">', '</div>', '</div>', '</div>', '</div>', '</div>', '</div>', '</div>'].join('');
// ClockPicker
function ClockPicker(element, options) {
var popover = $(tpl),
plate = popover.find('.clockpicker-plate'),
holder = popover.find('.picker__holder'),
hoursView = popover.find('.clockpicker-hours'),
minutesView = popover.find('.clockpicker-minutes'),
amPmBlock = popover.find('.clockpicker-am-pm-block'),
isInput = element.prop('tagName') === 'INPUT',
input = isInput ? element : element.find('input'),
label = $("label[for=" + input.attr("id") + "]"),
self = this;
this.id = uniqueId('cp');
this.element = element;
this.holder = holder;
this.options = options;
this.isAppended = false;
this.isShown = false;
this.currentView = 'hours';
this.isInput = isInput;
this.input = input;
this.label = label;
this.popover = popover;
this.plate = plate;
this.hoursView = hoursView;
this.minutesView = minutesView;
this.amPmBlock = amPmBlock;
this.spanHours = popover.find('.clockpicker-span-hours');
this.spanMinutes = popover.find('.clockpicker-span-minutes');
this.spanAmPm = popover.find('.clockpicker-span-am-pm');
this.footer = popover.find('.picker__footer');
this.amOrPm = "PM";
// Setup for for 12 hour clock if option is selected
if (options.twelvehour) {
if (!options.ampmclickable) {
this.spanAmPm.empty();
$('<div id="click-am">AM</div>').appendTo(this.spanAmPm);
$('<div id="click-pm">PM</div>').appendTo(this.spanAmPm);
} else {
this.spanAmPm.empty();
$('<div id="click-am">AM</div>').on("click", function () {
self.spanAmPm.children('#click-am').addClass("text-primary");
self.spanAmPm.children('#click-pm').removeClass("text-primary");
self.amOrPm = "AM";
}).appendTo(this.spanAmPm);
$('<div id="click-pm">PM</div>').on("click", function () {
self.spanAmPm.children('#click-pm').addClass("text-primary");
self.spanAmPm.children('#click-am').removeClass("text-primary");
self.amOrPm = 'PM';
}).appendTo(this.spanAmPm);
}
}
// Add buttons to footer
$('<button type="button" class="btn-flat picker__clear" tabindex="' + (options.twelvehour ? '3' : '1') + '">' + options.cleartext + '</button>').click($.proxy(this.clear, this)).appendTo(this.footer);
$('<button type="button" class="btn-flat picker__close" tabindex="' + (options.twelvehour ? '3' : '1') + '">' + options.canceltext + '</button>').click($.proxy(this.hide, this)).appendTo(this.footer);
$('<button type="button" class="btn-flat picker__close" tabindex="' + (options.twelvehour ? '3' : '1') + '">' + options.donetext + '</button>').click($.proxy(this.done, this)).appendTo(this.footer);
this.spanHours.click($.proxy(this.toggleView, this, 'hours'));
this.spanMinutes.click($.proxy(this.toggleView, this, 'minutes'));
// Show or toggle
input.on('focus.clockpicker click.clockpicker', $.proxy(this.show, this));
// Build ticks
var tickTpl = $('<div class="clockpicker-tick"></div>'),
i,
tick,
radian,
radius;
// Hours view
if (options.twelvehour) {
for (i = 1; i < 13; i += 1) {
tick = tickTpl.clone();
radian = i / 6 * Math.PI;
radius = outerRadius;
tick.css({
left: dialRadius + Math.sin(radian) * radius - tickRadius,
top: dialRadius - Math.cos(radian) * radius - tickRadius
});
tick.html(i === 0 ? '00' : i);
hoursView.append(tick);
tick.on(mousedownEvent, mousedown);
}
} else {
for (i = 0; i < 24; i += 1) {
tick = tickTpl.clone();
radian = i / 6 * Math.PI;
var inner = i > 0 && i < 13;
radius = inner ? innerRadius : outerRadius;
tick.css({
left: dialRadius + Math.sin(radian) * radius - tickRadius,
top: dialRadius - Math.cos(radian) * radius - tickRadius
});
tick.html(i === 0 ? '00' : i);
hoursView.append(tick);
tick.on(mousedownEvent, mousedown);
}
}
// Minutes view
for (i = 0; i < 60; i += 5) {
tick = tickTpl.clone();
radian = i / 30 * Math.PI;
tick.css({
left: dialRadius + Math.sin(radian) * outerRadius - tickRadius,
top: dialRadius - Math.cos(radian) * outerRadius - tickRadius
});
tick.html(leadingZero(i));
minutesView.append(tick);
tick.on(mousedownEvent, mousedown);
}
// Clicking on minutes view space
plate.on(mousedownEvent, function (e) {
if ($(e.target).closest('.clockpicker-tick').length === 0) {
mousedown(e, true);
}
});
// Mousedown or touchstart
function mousedown(e, space) {
var offset = plate.offset(),
isTouch = /^touch/.test(e.type),
x0 = offset.left + dialRadius,
y0 = offset.top + dialRadius,
dx = (isTouch ? e.originalEvent.touches[0] : e).pageX - x0,
dy = (isTouch ? e.originalEvent.touches[0] : e).pageY - y0,
z = Math.sqrt(dx * dx + dy * dy),
moved = false;
// When clicking on minutes view space, check the mouse position
if (space && (z < outerRadius - tickRadius || z > outerRadius + tickRadius)) {
return;
}
e.preventDefault();
// Set cursor style of body after 200ms
var movingTimer = setTimeout(function () {
self.popover.addClass('clockpicker-moving');
}, 200);
// Clock
self.setHand(dx, dy, !space, true);
// Mousemove on document
$doc.off(mousemoveEvent).on(mousemoveEvent, function (e) {
e.preventDefault();
var isTouch = /^touch/.test(e.type),
x = (isTouch ? e.originalEvent.touches[0] : e).pageX - x0,
y = (isTouch ? e.originalEvent.touches[0] : e).pageY - y0;
if (!moved && x === dx && y === dy) {
// Clicking in chrome on windows will trigger a mousemove event
return;
}
moved = true;
self.setHand(x, y, false, true);
});
// Mouseup on document
$doc.off(mouseupEvent).on(mouseupEvent, function (e) {
$doc.off(mouseupEvent);
e.preventDefault();
var isTouch = /^touch/.test(e.type),
x = (isTouch ? e.originalEvent.changedTouches[0] : e).pageX - x0,
y = (isTouch ? e.originalEvent.changedTouches[0] : e).pageY - y0;
if ((space || moved) && x === dx && y === dy) {
self.setHand(x, y);
}
if (self.currentView === 'hours') {
self.toggleView('minutes', duration / 2);
} else if (options.autoclose) {
self.minutesView.addClass('clockpicker-dial-out');
setTimeout(function () {
self.done();
}, duration / 2);
}
plate.prepend(canvas);
// Reset cursor style of body
clearTimeout(movingTimer);
self.popover.removeClass('clockpicker-moving');
// Unbind mousemove event
$doc.off(mousemoveEvent);
});
}
if (svgSupported) {
// Draw clock hands and others
var canvas = popover.find('.clockpicker-canvas'),
svg = createSvgElement('svg');
svg.setAttribute('class', 'clockpicker-svg');
svg.setAttribute('width', diameter);
svg.setAttribute('height', diameter);
var g = createSvgElement('g');
g.setAttribute('transform', 'translate(' + dialRadius + ',' + dialRadius + ')');
var bearing = createSvgElement('circle');
bearing.setAttribute('class', 'clockpicker-canvas-bearing');
bearing.setAttribute('cx', 0);
bearing.setAttribute('cy', 0);
bearing.setAttribute('r', 4);
var hand = createSvgElement('line');
hand.setAttribute('x1', 0);
hand.setAttribute('y1', 0);
var bg = createSvgElement('circle');
bg.setAttribute('class', 'clockpicker-canvas-bg');
bg.setAttribute('r', tickRadius);
g.appendChild(hand);
g.appendChild(bg);
g.appendChild(bearing);
svg.appendChild(g);
canvas.append(svg);
this.hand = hand;
this.bg = bg;
this.bearing = bearing;
this.g = g;
this.canvas = canvas;
}
raiseCallback(this.options.init);
}
function raiseCallback(callbackFunction) {
if (callbackFunction && typeof callbackFunction === "function") callbackFunction();
}
// Default options
ClockPicker.DEFAULTS = {
'default': '', // default time, 'now' or '13:14' e.g.
fromnow: 0, // set default time to * milliseconds from now (using with default = 'now')
donetext: 'Ok', // done button text
cleartext: 'Clear',
canceltext: 'Cancel',
autoclose: false, // auto close when minute is selected
ampmclickable: true, // set am/pm button on itself
darktheme: false, // set to dark theme
twelvehour: true, // change to 12 hour AM/PM clock from 24 hour
vibrate: true // vibrate the device when dragging clock hand
};
// Show or hide popover
ClockPicker.prototype.toggle = function () {
this[this.isShown ? 'hide' : 'show']();
};
// Set popover position
ClockPicker.prototype.locate = function () {
var element = this.element,
popover = this.popover,
offset = element.offset(),
width = element.outerWidth(),
height = element.outerHeight(),
align = this.options.align,
self = this;
popover.show();
};
// Show popover
ClockPicker.prototype.show = function (e) {
// Not show again
if (this.isShown) {
return;
}
raiseCallback(this.options.beforeShow);
$(':input').each(function () {
$(this).attr('tabindex', -1);
});
var self = this;
// Initialize
this.input.blur();
this.popover.addClass('picker--opened');
this.input.addClass('picker__input picker__input--active');
$(document.body).css('overflow', 'hidden');
// Get the time
var value = ((this.input.prop('value') || this.options['default'] || '') + '').split(':');
if (this.options.twelvehour && !(typeof value[1] === 'undefined')) {
if (value[1].indexOf("AM") > 0) {
this.amOrPm = 'AM';
} else {
this.amOrPm = 'PM';
}
value[1] = value[1].replace("AM", "").replace("PM", "");
}
if (value[0] === 'now') {
var now = new Date(+new Date() + this.options.fromnow);
value = [now.getHours(), now.getMinutes()];
if (this.options.twelvehour) {
this.amOrPm = value[0] >= 12 && value[0] < 24 ? 'PM' : 'AM';
}
}
this.hours = +value[0] || 0;
this.minutes = +value[1] || 0;
this.spanHours.html(this.hours);
this.spanMinutes.html(leadingZero(this.minutes));
if (!this.isAppended) {
// Append popover to input by default
var containerEl = document.querySelector(this.options.container);
if (this.options.container && containerEl) {
containerEl.appendChild(this.popover[0]);
} else {
this.popover.insertAfter(this.input);
}
if (this.options.twelvehour) {
if (this.amOrPm === 'PM') {
this.spanAmPm.children('#click-pm').addClass("text-primary");
this.spanAmPm.children('#click-am').removeClass("text-primary");
} else {
this.spanAmPm.children('#click-am').addClass("text-primary");
this.spanAmPm.children('#click-pm').removeClass("text-primary");
}
}
// Reset position when resize
$win.on('resize.clockpicker' + this.id, function () {
if (self.isShown) {
self.locate();
}
});
this.isAppended = true;
}
// Toggle to hours view
this.toggleView('hours');
// Set position
this.locate();
this.isShown = true;
// Hide when clicking or tabbing on any element except the clock and input
$doc.on('click.clockpicker.' + this.id + ' focusin.clockpicker.' + this.id, function (e) {
var target = $(e.target);
if (target.closest(self.popover.find('.picker__wrap')).length === 0 && target.closest(self.input).length === 0) {
self.hide();
}
});
// Hide when ESC is pressed
$doc.on('keyup.clockpicker.' + this.id, function (e) {
if (e.keyCode === 27) {
self.hide();
}
});
raiseCallback(this.options.afterShow);
};
// Hide popover
ClockPicker.prototype.hide = function () {
raiseCallback(this.options.beforeHide);
this.input.removeClass('picker__input picker__input--active');
this.popover.removeClass('picker--opened');
$(document.body).css('overflow', 'visible');
this.isShown = false;
$(':input').each(function (index) {
$(this).attr('tabindex', index + 1);
});
// Unbinding events on document
$doc.off('click.clockpicker.' + this.id + ' focusin.clockpicker.' + this.id);
$doc.off('keyup.clockpicker.' + this.id);
this.popover.hide();
raiseCallback(this.options.afterHide);
};
// Toggle to hours or minutes view
ClockPicker.prototype.toggleView = function (view, delay) {
var raiseAfterHourSelect = false;
if (view === 'minutes' && $(this.hoursView).css("visibility") === "visible") {
raiseCallback(this.options.beforeHourSelect);
raiseAfterHourSelect = true;
}
var isHours = view === 'hours',
nextView = isHours ? this.hoursView : this.minutesView,
hideView = isHours ? this.minutesView : this.hoursView;
this.currentView = view;
this.spanHours.toggleClass('text-primary', isHours);
this.spanMinutes.toggleClass('text-primary', !isHours);
// Let's make transitions
hideView.addClass('clockpicker-dial-out');
nextView.css('visibility', 'visible').removeClass('clockpicker-dial-out');
// Reset clock hand
this.resetClock(delay);
// After transitions ended
clearTimeout(this.toggleViewTimer);
this.toggleViewTimer = setTimeout(function () {
hideView.css('visibility', 'hidden');
}, duration);
if (raiseAfterHourSelect) {
raiseCallback(this.options.afterHourSelect);
}
};
// Reset clock hand
ClockPicker.prototype.resetClock = function (delay) {
var view = this.currentView,
value = this[view],
isHours = view === 'hours',
unit = Math.PI / (isHours ? 6 : 30),
radian = value * unit,
radius = isHours && value > 0 && value < 13 ? innerRadius : outerRadius,
x = Math.sin(radian) * radius,
y = -Math.cos(radian) * radius,
self = this;
if (svgSupported && delay) {
self.canvas.addClass('clockpicker-canvas-out');
setTimeout(function () {
self.canvas.removeClass('clockpicker-canvas-out');
self.setHand(x, y);
}, delay);
} else this.setHand(x, y);
};
// Set clock hand to (x, y)
ClockPicker.prototype.setHand = function (x, y, roundBy5, dragging) {
var radian = Math.atan2(x, -y),
isHours = this.currentView === 'hours',
unit = Math.PI / (isHours || roundBy5 ? 6 : 30),
z = Math.sqrt(x * x + y * y),
options = this.options,
inner = isHours && z < (outerRadius + innerRadius) / 2,
radius = inner ? innerRadius : outerRadius,
value;
if (options.twelvehour) {
radius = outerRadius;
}
// Radian should in range [0, 2PI]
if (radian < 0) {
radian = Math.PI * 2 + radian;
}
// Get the round value
value = Math.round(radian / unit);
// Get the round radian
radian = value * unit;
// Correct the hours or minutes
if (options.twelvehour) {
if (isHours) {
if (value === 0) value = 12;
} else {
if (roundBy5) value *= 5;
if (value === 60) value = 0;
}
} else {
if (isHours) {
if (value === 12) value = 0;
value = inner ? value === 0 ? 12 : value : value === 0 ? 0 : value + 12;
} else {
if (roundBy5) value *= 5;
if (value === 60) value = 0;
}
}
// Once hours or minutes changed, vibrate the device
if (this[this.currentView] !== value) {
if (vibrate && this.options.vibrate) {
// Do not vibrate too frequently
if (!this.vibrateTimer) {
navigator[vibrate](10);
this.vibrateTimer = setTimeout($.proxy(function () {
this.vibrateTimer = null;
}, this), 100);
}
}
}
this[this.currentView] = value;
if (isHours) {
this['spanHours'].html(value);
} else {
this['spanMinutes'].html(leadingZero(value));
}
// If svg is not supported, just add an active class to the tick
if (!svgSupported) {
this[isHours ? 'hoursView' : 'minutesView'].find('.clockpicker-tick').each(function () {
var tick = $(this);
tick.toggleClass('active', value === +tick.html());
});
return;
}
// Set clock hand and others' position
var cx1 = Math.sin(radian) * (radius - tickRadius),
cy1 = -Math.cos(radian) * (radius - tickRadius),
cx2 = Math.sin(radian) * radius,
cy2 = -Math.cos(radian) * radius;
this.hand.setAttribute('x2', cx1);
this.hand.setAttribute('y2', cy1);
this.bg.setAttribute('cx', cx2);
this.bg.setAttribute('cy', cy2);
};
// Hours and minutes are selected
ClockPicker.prototype.done = function () {
raiseCallback(this.options.beforeDone);
this.hide();
this.label.addClass('active');
var last = this.input.prop('value'),
value = leadingZero(this.hours) + ':' + leadingZero(this.minutes);
if (this.options.twelvehour) {
value = value + this.amOrPm;
}
this.input.prop('value', value);
if (value !== last) {
this.input.triggerHandler('change');
if (!this.isInput) {
this.element.trigger('change');
}
}
if (this.options.autoclose) this.input.trigger('blur');
raiseCallback(this.options.afterDone);
};
// Clear input field
ClockPicker.prototype.clear = function () {
this.hide();
this.label.removeClass('active');
var last = this.input.prop('value'),
value = '';
this.input.prop('value', value);
if (value !== last) {
this.input.triggerHandler('change');
if (!this.isInput) {
this.element.trigger('change');
}
}
if (this.options.autoclose) {
this.input.trigger('blur');
}
};
// Remove clockpicker from input
ClockPicker.prototype.remove = function () {
this.element.removeData('clockpicker');
this.input.off('focus.clockpicker click.clockpicker');
if (this.isShown) {
this.hide();
}
if (this.isAppended) {
$win.off('resize.clockpicker' + this.id);
this.popover.remove();
}
};
// Extends $.fn.clockpicker
$.fn.pickatime = function (option) {
var args = Array.prototype.slice.call(arguments, 1);
return this.each(function () {
var $this = $(this),
data = $this.data('clockpicker');
if (!data) {
var options = $.extend({}, ClockPicker.DEFAULTS, $this.data(), typeof option == 'object' && option);
$this.data('clockpicker', new ClockPicker($this, options));
} else {
// Manual operatsions. show, hide, remove, e.g.
if (typeof data[option] === 'function') {
data[option].apply(data, args);
}
}
});
};
})(jQuery);
;(function ($) {
$.fn.characterCounter = function () {
return this.each(function () {
var $input = $(this);
var $counterElement = $input.parent().find('span[class="character-counter"]');
// character counter has already been added appended to the parent container
if ($counterElement.length) {
return;
}
var itHasLengthAttribute = $input.attr('data-length') !== undefined;
if (itHasLengthAttribute) {
$input.on('input', updateCounter);
$input.on('focus', updateCounter);
$input.on('blur', removeCounterElement);
addCounterElement($input);
}
});
};
function updateCounter() {
var maxLength = +$(this).attr('data-length'),
actualLength = +$(this).val().length,
isValidLength = actualLength <= maxLength;
$(this).parent().find('span[class="character-counter"]').html(actualLength + '/' + maxLength);
addInputStyle(isValidLength, $(this));
}
function addCounterElement($input) {
var $counterElement = $input.parent().find('span[class="character-counter"]');
if ($counterElement.length) {
return;
}
$counterElement = $('<span/>').addClass('character-counter').css('float', 'right').css('font-size', '12px').css('height', 1);
$input.parent().append($counterElement);
}
function removeCounterElement() {
$(this).parent().find('span[class="character-counter"]').html('');
}
function addInputStyle(isValidLength, $input) {
var inputHasInvalidClass = $input.hasClass('invalid');
if (isValidLength && inputHasInvalidClass) {
$input.removeClass('invalid');
} else if (!isValidLength && !inputHasInvalidClass) {
$input.removeClass('valid');
$input.addClass('invalid');
}
}
$(document).ready(function () {
$('input, textarea').characterCounter();
});
})(jQuery);
;(function ($) {
var methods = {
init: function (options) {
var defaults = {
duration: 200, // ms
dist: -100, // zoom scale TODO: make this more intuitive as an option
shift: 0, // spacing for center image
padding: 0, // Padding between non center items
fullWidth: false, // Change to full width styles
indicators: false, // Toggle indicators
noWrap: false, // Don't wrap around and cycle through items.
onCycleTo: null // Callback for when a new slide is cycled to.
};
options = $.extend(defaults, options);
var namespace = Materialize.objectSelectorString($(this));
return this.each(function (i) {
var images, item_width, item_height, offset, center, pressed, dim, count, reference, referenceY, amplitude, target, velocity, scrolling, xform, frame, timestamp, ticker, dragged, vertical_dragged;
var $indicators = $('<ul class="indicators"></ul>');
var scrollingTimeout = null;
var oneTimeCallback = null;
// Initialize
var view = $(this);
var hasMultipleSlides = view.find('.carousel-item').length > 1;
var showIndicators = (view.attr('data-indicators') || options.indicators) && hasMultipleSlides;
var noWrap = view.attr('data-no-wrap') || options.noWrap || !hasMultipleSlides;
var uniqueNamespace = view.attr('data-namespace') || namespace + i;
view.attr('data-namespace', uniqueNamespace);
// Options
var setCarouselHeight = function (imageOnly) {
var firstSlide = view.find('.carousel-item.active').length ? view.find('.carousel-item.active').first() : view.find('.carousel-item').first();
var firstImage = firstSlide.find('img').first();
if (firstImage.length) {
if (firstImage[0].complete) {
// If image won't trigger the load event
var imageHeight = firstImage.height();
if (imageHeight > 0) {
view.css('height', firstImage.height());
} else {
// If image still has no height, use the natural dimensions to calculate
var naturalWidth = firstImage[0].naturalWidth;
var naturalHeight = firstImage[0].naturalHeight;
var adjustedHeight = view.width() / naturalWidth * naturalHeight;
view.css('height', adjustedHeight);
}
} else {
// Get height when image is loaded normally
firstImage.on('load', function () {
view.css('height', $(this).height());
});
}
} else if (!imageOnly) {
var slideHeight = firstSlide.height();
view.css('height', slideHeight);
}
};
if (options.fullWidth) {
options.dist = 0;
setCarouselHeight();
// Offset fixed items when indicators.
if (showIndicators) {
view.find('.carousel-fixed-item').addClass('with-indicators');
}
}
// Don't double initialize.
if (view.hasClass('initialized')) {
// Recalculate variables
$(window).trigger('resize');
// Redraw carousel.
view.trigger('carouselNext', [0.000001]);
return true;
}
view.addClass('initialized');
pressed = false;
offset = target = 0;
images = [];
item_width = view.find('.carousel-item').first().innerWidth();
item_height = view.find('.carousel-item').first().innerHeight();
dim = item_width * 2 + options.padding;
view.find('.carousel-item').each(function (i) {
images.push($(this)[0]);
if (showIndicators) {
var $indicator = $('<li class="indicator-item"></li>');
// Add active to first by default.
if (i === 0) {
$indicator.addClass('active');
}
// Handle clicks on indicators.
$indicator.click(function (e) {
e.stopPropagation();
var index = $(this).index();
cycleTo(index);
});
$indicators.append($indicator);
}
});
if (showIndicators) {
view.append($indicators);
}
count = images.length;
function setupEvents() {
if (typeof window.ontouchstart !== 'undefined') {
view.on('touchstart.carousel', tap);
view.on('touchmove.carousel', drag);
view.on('touchend.carousel', release);
}
view.on('mousedown.carousel', tap);
view.on('mousemove.carousel', drag);
view.on('mouseup.carousel', release);
view.on('mouseleave.carousel', release);
view.on('click.carousel', click);
}
function xpos(e) {
// touch event
if (e.targetTouches && e.targetTouches.length >= 1) {
return e.targetTouches[0].clientX;
}
// mouse event
return e.clientX;
}
function ypos(e) {
// touch event
if (e.targetTouches && e.targetTouches.length >= 1) {
return e.targetTouches[0].clientY;
}
// mouse event
return e.clientY;
}
function wrap(x) {
return x >= count ? x % count : x < 0 ? wrap(count + x % count) : x;
}
function scroll(x) {
// Track scrolling state
scrolling = true;
if (!view.hasClass('scrolling')) {
view.addClass('scrolling');
}
if (scrollingTimeout != null) {
window.clearTimeout(scrollingTimeout);
}
scrollingTimeout = window.setTimeout(function () {
scrolling = false;
view.removeClass('scrolling');
}, options.duration);
// Start actual scroll
var i, half, delta, dir, tween, el, alignment, xTranslation;
var lastCenter = center;
offset = typeof x === 'number' ? x : offset;
center = Math.floor((offset + dim / 2) / dim);
delta = offset - center * dim;
dir = delta < 0 ? 1 : -1;
tween = -dir * delta * 2 / dim;
half = count >> 1;
if (!options.fullWidth) {
alignment = 'translateX(' + (view[0].clientWidth - item_width) / 2 + 'px) ';
alignment += 'translateY(' + (view[0].clientHeight - item_height) / 2 + 'px)';
} else {
alignment = 'translateX(0)';
}
// Set indicator active
if (showIndicators) {
var diff = center % count;
var activeIndicator = $indicators.find('.indicator-item.active');
if (activeIndicator.index() !== diff) {
activeIndicator.removeClass('active');
$indicators.find('.indicator-item').eq(diff).addClass('active');
}
}
// center
// Don't show wrapped items.
if (!noWrap || center >= 0 && center < count) {
el = images[wrap(center)];
// Add active class to center item.
if (!$(el).hasClass('active')) {
view.find('.carousel-item').removeClass('active');
$(el).addClass('active');
}
el.style[xform] = alignment + ' translateX(' + -delta / 2 + 'px)' + ' translateX(' + dir * options.shift * tween * i + 'px)' + ' translateZ(' + options.dist * tween + 'px)';
el.style.zIndex = 0;
if (options.fullWidth) {
tweenedOpacity = 1;
} else {
tweenedOpacity = 1 - 0.2 * tween;
}
el.style.opacity = tweenedOpacity;
el.style.display = 'block';
}
for (i = 1; i <= half; ++i) {
// right side
if (options.fullWidth) {
zTranslation = options.dist;
tweenedOpacity = i === half && delta < 0 ? 1 - tween : 1;
} else {
zTranslation = options.dist * (i * 2 + tween * dir);
tweenedOpacity = 1 - 0.2 * (i * 2 + tween * dir);
}
// Don't show wrapped items.
if (!noWrap || center + i < count) {
el = images[wrap(center + i)];
el.style[xform] = alignment + ' translateX(' + (options.shift + (dim * i - delta) / 2) + 'px)' + ' translateZ(' + zTranslation + 'px)';
el.style.zIndex = -i;
el.style.opacity = tweenedOpacity;
el.style.display = 'block';
}
// left side
if (options.fullWidth) {
zTranslation = options.dist;
tweenedOpacity = i === half && delta > 0 ? 1 - tween : 1;
} else {
zTranslation = options.dist * (i * 2 - tween * dir);
tweenedOpacity = 1 - 0.2 * (i * 2 - tween * dir);
}
// Don't show wrapped items.
if (!noWrap || center - i >= 0) {
el = images[wrap(center - i)];
el.style[xform] = alignment + ' translateX(' + (-options.shift + (-dim * i - delta) / 2) + 'px)' + ' translateZ(' + zTranslation + 'px)';
el.style.zIndex = -i;
el.style.opacity = tweenedOpacity;
el.style.display = 'block';
}
}
// center
// Don't show wrapped items.
if (!noWrap || center >= 0 && center < count) {
el = images[wrap(center)];
el.style[xform] = alignment + ' translateX(' + -delta / 2 + 'px)' + ' translateX(' + dir * options.shift * tween + 'px)' + ' translateZ(' + options.dist * tween + 'px)';
el.style.zIndex = 0;
if (options.fullWidth) {
tweenedOpacity = 1;
} else {
tweenedOpacity = 1 - 0.2 * tween;
}
el.style.opacity = tweenedOpacity;
el.style.display = 'block';
}
// onCycleTo callback
if (lastCenter !== center && typeof options.onCycleTo === "function") {
var $curr_item = view.find('.carousel-item').eq(wrap(center));
options.onCycleTo.call(this, $curr_item, dragged);
}
// One time callback
if (typeof oneTimeCallback === "function") {
oneTimeCallback.call(this, $curr_item, dragged);
oneTimeCallback = null;
}
}
function track() {
var now, elapsed, delta, v;
now = Date.now();
elapsed = now - timestamp;
timestamp = now;
delta = offset - frame;
frame = offset;
v = 1000 * delta / (1 + elapsed);
velocity = 0.8 * v + 0.2 * velocity;
}
function autoScroll() {
var elapsed, delta;
if (amplitude) {
elapsed = Date.now() - timestamp;
delta = amplitude * Math.exp(-elapsed / options.duration);
if (delta > 2 || delta < -2) {
scroll(target - delta);
requestAnimationFrame(autoScroll);
} else {
scroll(target);
}
}
}
function click(e) {
// Disable clicks if carousel was dragged.
if (dragged) {
e.preventDefault();
e.stopPropagation();
return false;
} else if (!options.fullWidth) {
var clickedIndex = $(e.target).closest('.carousel-item').index();
var diff = wrap(center) - clickedIndex;
// Disable clicks if carousel was shifted by click
if (diff !== 0) {
e.preventDefault();
e.stopPropagation();
}
cycleTo(clickedIndex);
}
}
function cycleTo(n) {
var diff = center % count - n;
// Account for wraparound.
if (!noWrap) {
if (diff < 0) {
if (Math.abs(diff + count) < Math.abs(diff)) {
diff += count;
}
} else if (diff > 0) {
if (Math.abs(diff - count) < diff) {
diff -= count;
}
}
}
// Call prev or next accordingly.
if (diff < 0) {
view.trigger('carouselNext', [Math.abs(diff)]);
} else if (diff > 0) {
view.trigger('carouselPrev', [diff]);
}
}
function tap(e) {
// Fixes firefox draggable image bug
if (e.type === 'mousedown' && $(e.target).is('img')) {
e.preventDefault();
}
pressed = true;
dragged = false;
vertical_dragged = false;
reference = xpos(e);
referenceY = ypos(e);
velocity = amplitude = 0;
frame = offset;
timestamp = Date.now();
clearInterval(ticker);
ticker = setInterval(track, 100);
}
function drag(e) {
var x, delta, deltaY;
if (pressed) {
x = xpos(e);
y = ypos(e);
delta = reference - x;
deltaY = Math.abs(referenceY - y);
if (deltaY < 30 && !vertical_dragged) {
// If vertical scrolling don't allow dragging.
if (delta > 2 || delta < -2) {
dragged = true;
reference = x;
scroll(offset + delta);
}
} else if (dragged) {
// If dragging don't allow vertical scroll.
e.preventDefault();
e.stopPropagation();
return false;
} else {
// Vertical scrolling.
vertical_dragged = true;
}
}
if (dragged) {
// If dragging don't allow vertical scroll.
e.preventDefault();
e.stopPropagation();
return false;
}
}
function release(e) {
if (pressed) {
pressed = false;
} else {
return;
}
clearInterval(ticker);
target = offset;
if (velocity > 10 || velocity < -10) {
amplitude = 0.9 * velocity;
target = offset + amplitude;
}
target = Math.round(target / dim) * dim;
// No wrap of items.
if (noWrap) {
if (target >= dim * (count - 1)) {
target = dim * (count - 1);
} else if (target < 0) {
target = 0;
}
}
amplitude = target - offset;
timestamp = Date.now();
requestAnimationFrame(autoScroll);
if (dragged) {
e.preventDefault();
e.stopPropagation();
}
return false;
}
xform = 'transform';
['webkit', 'Moz', 'O', 'ms'].every(function (prefix) {
var e = prefix + 'Transform';
if (typeof document.body.style[e] !== 'undefined') {
xform = e;
return false;
}
return true;
});
var throttledResize = Materialize.throttle(function () {
if (options.fullWidth) {
item_width = view.find('.carousel-item').first().innerWidth();
var imageHeight = view.find('.carousel-item.active').height();
dim = item_width * 2 + options.padding;
offset = center * 2 * item_width;
target = offset;
setCarouselHeight(true);
} else {
scroll();
}
}, 200);
$(window).off('resize.carousel-' + uniqueNamespace).on('resize.carousel-' + uniqueNamespace, throttledResize);
setupEvents();
scroll(offset);
$(this).on('carouselNext', function (e, n, callback) {
if (n === undefined) {
n = 1;
}
if (typeof callback === "function") {
oneTimeCallback = callback;
}
target = dim * Math.round(offset / dim) + dim * n;
if (offset !== target) {
amplitude = target - offset;
timestamp = Date.now();
requestAnimationFrame(autoScroll);
}
});
$(this).on('carouselPrev', function (e, n, callback) {
if (n === undefined) {
n = 1;
}
if (typeof callback === "function") {
oneTimeCallback = callback;
}
target = dim * Math.round(offset / dim) - dim * n;
if (offset !== target) {
amplitude = target - offset;
timestamp = Date.now();
requestAnimationFrame(autoScroll);
}
});
$(this).on('carouselSet', function (e, n, callback) {
if (n === undefined) {
n = 0;
}
if (typeof callback === "function") {
oneTimeCallback = callback;
}
cycleTo(n);
});
});
},
next: function (n, callback) {
$(this).trigger('carouselNext', [n, callback]);
},
prev: function (n, callback) {
$(this).trigger('carouselPrev', [n, callback]);
},
set: function (n, callback) {
$(this).trigger('carouselSet', [n, callback]);
},
destroy: function () {
var uniqueNamespace = $(this).attr('data-namespace');
$(this).removeAttr('data-namespace');
$(this).removeClass('initialized');
$(this).find('.indicators').remove();
// Remove event handlers
$(this).off('carouselNext carouselPrev carouselSet');
$(window).off('resize.carousel-' + uniqueNamespace);
if (typeof window.ontouchstart !== 'undefined') {
$(this).off('touchstart.carousel touchmove.carousel touchend.carousel');
}
$(this).off('mousedown.carousel mousemove.carousel mouseup.carousel mouseleave.carousel click.carousel');
}
};
$.fn.carousel = function (methodOrOptions) {
if (methods[methodOrOptions]) {
return methods[methodOrOptions].apply(this, Array.prototype.slice.call(arguments, 1));
} else if (typeof methodOrOptions === 'object' || !methodOrOptions) {
// Default to "init"
return methods.init.apply(this, arguments);
} else {
$.error('Method ' + methodOrOptions + ' does not exist on jQuery.carousel');
}
}; // Plugin end
})(jQuery);
;(function ($) {
var methods = {
init: function (options) {
return this.each(function () {
var origin = $('#' + $(this).attr('data-activates'));
var screen = $('body');
// Creating tap target
var tapTargetEl = $(this);
var tapTargetWrapper = tapTargetEl.parent('.tap-target-wrapper');
var tapTargetWave = tapTargetWrapper.find('.tap-target-wave');
var tapTargetOriginEl = tapTargetWrapper.find('.tap-target-origin');
var tapTargetContentEl = tapTargetEl.find('.tap-target-content');
// Creating wrapper
if (!tapTargetWrapper.length) {
tapTargetWrapper = tapTargetEl.wrap($('<div class="tap-target-wrapper"></div>')).parent();
}
// Creating content
if (!tapTargetContentEl.length) {
tapTargetContentEl = $('<div class="tap-target-content"></div>');
tapTargetEl.append(tapTargetContentEl);
}
// Creating foreground wave
if (!tapTargetWave.length) {
tapTargetWave = $('<div class="tap-target-wave"></div>');
// Creating origin
if (!tapTargetOriginEl.length) {
tapTargetOriginEl = origin.clone(true, true);
tapTargetOriginEl.addClass('tap-target-origin');
tapTargetOriginEl.removeAttr('id');
tapTargetOriginEl.removeAttr('style');
tapTargetWave.append(tapTargetOriginEl);
}
tapTargetWrapper.append(tapTargetWave);
}
// Open
var openTapTarget = function () {
if (tapTargetWrapper.is('.open')) {
return;
}
// Adding open class
tapTargetWrapper.addClass('open');
setTimeout(function () {
tapTargetOriginEl.off('click.tapTarget').on('click.tapTarget', function (e) {
closeTapTarget();
tapTargetOriginEl.off('click.tapTarget');
});
$(document).off('click.tapTarget').on('click.tapTarget', function (e) {
closeTapTarget();
$(document).off('click.tapTarget');
});
var throttledCalc = Materialize.throttle(function () {
calculateTapTarget();
}, 200);
$(window).off('resize.tapTarget').on('resize.tapTarget', throttledCalc);
}, 0);
};
// Close
var closeTapTarget = function () {
if (!tapTargetWrapper.is('.open')) {
return;
}
tapTargetWrapper.removeClass('open');
tapTargetOriginEl.off('click.tapTarget');
$(document).off('click.tapTarget');
$(window).off('resize.tapTarget');
};
// Pre calculate
var calculateTapTarget = function () {
// Element or parent is fixed position?
var isFixed = origin.css('position') === 'fixed';
if (!isFixed) {
var parents = origin.parents();
for (var i = 0; i < parents.length; i++) {
isFixed = $(parents[i]).css('position') == 'fixed';
if (isFixed) {
break;
}
}
}
// Calculating origin
var originWidth = origin.outerWidth();
var originHeight = origin.outerHeight();
var originTop = isFixed ? origin.offset().top - $(document).scrollTop() : origin.offset().top;
var originLeft = isFixed ? origin.offset().left - $(document).scrollLeft() : origin.offset().left;
// Calculating screen
var windowWidth = $(window).width();
var windowHeight = $(window).height();
var centerX = windowWidth / 2;
var centerY = windowHeight / 2;
var isLeft = originLeft <= centerX;
var isRight = originLeft > centerX;
var isTop = originTop <= centerY;
var isBottom = originTop > centerY;
var isCenterX = originLeft >= windowWidth * 0.25 && originLeft <= windowWidth * 0.75;
var isCenterY = originTop >= windowHeight * 0.25 && originTop <= windowHeight * 0.75;
// Calculating tap target
var tapTargetWidth = tapTargetEl.outerWidth();
var tapTargetHeight = tapTargetEl.outerHeight();
var tapTargetTop = originTop + originHeight / 2 - tapTargetHeight / 2;
var tapTargetLeft = originLeft + originWidth / 2 - tapTargetWidth / 2;
var tapTargetPosition = isFixed ? 'fixed' : 'absolute';
// Calculating content
var tapTargetTextWidth = isCenterX ? tapTargetWidth : tapTargetWidth / 2 + originWidth;
var tapTargetTextHeight = tapTargetHeight / 2;
var tapTargetTextTop = isTop ? tapTargetHeight / 2 : 0;
var tapTargetTextBottom = 0;
var tapTargetTextLeft = isLeft && !isCenterX ? tapTargetWidth / 2 - originWidth : 0;
var tapTargetTextRight = 0;
var tapTargetTextPadding = originWidth;
var tapTargetTextAlign = isBottom ? 'bottom' : 'top';
// Calculating wave
var tapTargetWaveWidth = originWidth > originHeight ? originWidth * 2 : originWidth * 2;
var tapTargetWaveHeight = tapTargetWaveWidth;
var tapTargetWaveTop = tapTargetHeight / 2 - tapTargetWaveHeight / 2;
var tapTargetWaveLeft = tapTargetWidth / 2 - tapTargetWaveWidth / 2;
// Setting tap target
var tapTargetWrapperCssObj = {};
tapTargetWrapperCssObj.top = isTop ? tapTargetTop : '';
tapTargetWrapperCssObj.right = isRight ? windowWidth - tapTargetLeft - tapTargetWidth : '';
tapTargetWrapperCssObj.bottom = isBottom ? windowHeight - tapTargetTop - tapTargetHeight : '';
tapTargetWrapperCssObj.left = isLeft ? tapTargetLeft : '';
tapTargetWrapperCssObj.position = tapTargetPosition;
tapTargetWrapper.css(tapTargetWrapperCssObj);
// Setting content
tapTargetContentEl.css({
width: tapTargetTextWidth,
height: tapTargetTextHeight,
top: tapTargetTextTop,
right: tapTargetTextRight,
bottom: tapTargetTextBottom,
left: tapTargetTextLeft,
padding: tapTargetTextPadding,
verticalAlign: tapTargetTextAlign
});
// Setting wave
tapTargetWave.css({
top: tapTargetWaveTop,
left: tapTargetWaveLeft,
width: tapTargetWaveWidth,
height: tapTargetWaveHeight
});
};
if (options == 'open') {
calculateTapTarget();
openTapTarget();
}
if (options == 'close') closeTapTarget();
});
},
open: function () {},
close: function () {}
};
$.fn.tapTarget = function (methodOrOptions) {
if (methods[methodOrOptions] || typeof methodOrOptions === 'object') return methods.init.apply(this, arguments);
$.error('Method ' + methodOrOptions + ' does not exist on jQuery.tap-target');
};
})(jQuery);